mirror of
https://github.com/OSURoboticsClub/Rover_2017_2018.git
synced 2025-11-09 10:41:15 +00:00
8803 lines
346 KiB
Perl
8803 lines
346 KiB
Perl
#!/usr/bin/env perl
|
|
|
|
# ?? Still need to fix bcf error issue.
|
|
# Don't keep looping after error
|
|
# pvc: Only re-run on USER FILE CHANGE.
|
|
# See # ??????? BCF
|
|
|
|
|
|
#!!!!!!!!??? Check @pwd_log
|
|
|
|
|
|
# !!!!!!!!!! Don't forget to document $silence_logfile_warnings.!!!
|
|
|
|
# N.B. !!!!!!!!!!! See 17 July 2012 comments !!!!!!!!!!!!!!!!!!
|
|
|
|
# On a UNIX-like system, the above enables latexmk to run independently
|
|
# of the location of the perl executable. This line relies on the
|
|
# existence of the program /usr/bin/env
|
|
# If there is a problem for any reason, you can replace the first line of
|
|
# this file by:
|
|
|
|
#!/usr/bin/perl -w
|
|
|
|
# with the path of the perl executable adjusted for your system.
|
|
|
|
use warnings;
|
|
|
|
# Delete #??!! when working
|
|
|
|
# See ?? <===============================
|
|
|
|
## ?? Issues with clean-up
|
|
## List of aux files deleted is those read, not those generated.
|
|
## Other files are generated by (pdf)latex; should they be deleted?
|
|
## (I have hooks for this).
|
|
|
|
|
|
|
|
#=======================================
|
|
|
|
#?? Force mode doesn't appear to do force (if error in latex file)
|
|
#??? Get banner back in.
|
|
#?? CORRECT DIAGNOSTICS ON CHANGED FILES IF THEY DIDN'T EXIST BEFORE
|
|
#?? Further corrections to deal with disappeared source files for custom dependencies.
|
|
# Message repeatedly appears about remake when source file of cusdep doesn't exist.
|
|
#?? logfile w/o fdb file: don't set changed file, perhaps for generated exts.
|
|
# Reconsider
|
|
#?? Do proper run-stuff for bibtex, makeindex, cus-deps. OK I think
|
|
# Parse and correctly find ist files
|
|
|
|
|
|
# ATTEMPT TO ALLOW FILENAMES WITH SPACES:
|
|
# (as of 1 Apr 2006, and then 14 Sep. 2007)
|
|
|
|
# Problems:
|
|
# A. Quoting filenames will not always work.
|
|
# a. Under UNIX, quotes are legal in filenames, so when PERL
|
|
# directly runs a binary, a quoted filename will be treated as
|
|
# as a filename containing a quote character. But when it calls
|
|
# a shell, the quotes are handled by the shell as quotes.
|
|
# b. Under MSWin32, quotes are illegal filename characters, and tend
|
|
# to be handled correctly.
|
|
# c. But under cygwin, results are not so clear (there are many
|
|
# combinations: native v. cygwin perl, native v cygwin programs
|
|
# NT v. unix scripts, which shell is called.
|
|
# B. TeX doesn't always handle filenames with spaces gracefully.
|
|
# a. UNIX/LINUX: The version on gluon2 Mar 31, 2006 to Sep. 2007)
|
|
# doesn't handle them at all. (TeX treats space as separator.)
|
|
# b. At least some later versions actually do (Brad Miller e-mail,
|
|
# Sep. 2007).
|
|
# c. fptex [[e-TeXk, Version 3.141592-2.1 (Web2c 7.5.2)] does, on
|
|
# my MSWin at home. In \input the filename must be in quotes.
|
|
# d. Bibtex [BibTeX (Web2c 7.5.2) 0.99c on my MSWin system at home,
|
|
# Sep. 2007] does not allow names of bibfiles to have spaces.
|
|
# C. =====> Using the shell for command lines is not safe, since special
|
|
# characters can cause lots of mayhem.
|
|
# It will therefore be a good idea to sanitize filenames.
|
|
#
|
|
# I've sanitized all calls out:
|
|
# a. system and exec use a single argument, which forces
|
|
# use of shell, under all circumstances
|
|
# Thus I can safely use quotes on filenames: They will be handled by
|
|
# the shell under UNIX, and simply passed on to the program under MSWin32.
|
|
# b. I reorganized Run, Run_Detached to use single command line
|
|
# c. All calls to Run and Run_Detached have quoted filenames.
|
|
# d. So if a space-free filename with wildcards is given on latexmk's
|
|
# command line, and it globs to space-containing filename(s), that
|
|
# works (fptex on home computer, native NT tex)
|
|
# e. ====> But globbing fails: the glob function takes space as filename
|
|
# separator. ====================
|
|
|
|
#================= TO DO ================
|
|
#
|
|
# 1. See ?? ESPECIALLY $MSWin_fudge_break
|
|
# 2. Check fudged conditions in looping and make_files
|
|
# 3. Should not completely abort after a run that ends in failure from latex
|
|
# Missing input files (including via custom dependency) should be checked for
|
|
# a change in status
|
|
# If sources for missing files from custom dependency
|
|
# are available, then do a rerun
|
|
# If sources of any kind become available rerun (esp. for pvc)
|
|
# rerun
|
|
# Must parse log_file after unsuccessful run of latex: it may give
|
|
# information about missing files.
|
|
# 4. Check file of bug reports and requests
|
|
# 5. Rationalize bibtex warnings and errors. Two almost identical routines.
|
|
# Should 1. Use single routine
|
|
# 2. Convert errors to failure only in calling routine
|
|
# 3. Save first warning/error.
|
|
|
|
# ?? Use of generated_exts arrays and hashes needs rationalization
|
|
|
|
# To do:
|
|
# Rationalize again handling of include files.
|
|
# Now I use kpsewhich to do searches, if file not found
|
|
# (How do I avoid getting slowed down too much?)
|
|
# Document the assumptions at each stage of processing algorithm.
|
|
# Option to restart previewer automatically, if it dies under -pvc
|
|
# Test for already running previewer gets wrong answer if another
|
|
# process has the viewed file in its command line
|
|
|
|
$my_name = 'latexmk';
|
|
$My_name = 'Latexmk';
|
|
$version_num = '4.52c';
|
|
$version_details = "$My_name, John Collins, 19 Jan. 2017";
|
|
|
|
use Config;
|
|
use File::Basename;
|
|
use File::Copy;
|
|
use File::Glob ':glob'; # Better glob. Does not use space as item separator.
|
|
use File::Path 2.08 qw( make_path );
|
|
use FileHandle;
|
|
use File::Find;
|
|
use List::Util qw( max );
|
|
use Cwd; # To be able to change cwd
|
|
use Cwd "chdir"; # Ensure $ENV{PWD} tracks cwd
|
|
use Digest::MD5;
|
|
|
|
#use strict;
|
|
|
|
# The following variables are assigned once and then used in symbolic
|
|
# references, so we need to avoid warnings 'name used only once':
|
|
use vars qw( $dvi_update_command $ps_update_command $pdf_update_command );
|
|
|
|
# Translation of signal names to numbers and vv:
|
|
%signo = ();
|
|
@signame = ();
|
|
if ( defined $Config{sig_name} ) {
|
|
$i = 0;
|
|
foreach $name (split('\s+', $Config{sig_name})) {
|
|
$signo{$name} = $i;
|
|
$signame[$i] = $name;
|
|
$i++;
|
|
}
|
|
}
|
|
else {
|
|
warn "Something wrong with the perl configuration: No signals?\n";
|
|
}
|
|
|
|
## Copyright John Collins 1998-2017
|
|
## (username jcc8 at node psu.edu)
|
|
## (and thanks to David Coppit (username david at node coppit.org)
|
|
## for suggestions)
|
|
## Copyright Evan McLean
|
|
## (modifications up to version 2)
|
|
## Copyright 1992 by David J. Musliner and The University of Michigan.
|
|
## (original version)
|
|
##
|
|
## This program is free software; you can redistribute it and/or modify
|
|
## it under the terms of the GNU General Public License as published by
|
|
## the Free Software Foundation; either version 2 of the License, or
|
|
## (at your option) any later version.
|
|
##
|
|
## This program is distributed in the hope that it will be useful,
|
|
## but WITHOUT ANY WARRANTY; without even the implied warranty of
|
|
## MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
|
## GNU General Public License for more details.
|
|
##
|
|
## You should have received a copy of the GNU General Public License
|
|
## along with this program; if not, write to the Free Software
|
|
## Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307
|
|
##
|
|
##
|
|
##
|
|
## NEW FEATURES, since v. 2.0:
|
|
## 1. Correct algorithm for deciding how many times to run latex:
|
|
## based on whether source file(s) change between runs
|
|
## 2. Continuous preview works, and can be of ps file or dvi file
|
|
## 3. pdf creation by pdflatex possible
|
|
## 4. Defaults for commands are OS dependent.
|
|
## 5. Parsing of log file instead of source file is used to
|
|
## obtain dependencies, by default.
|
|
##
|
|
## Modification log from 9 Dec 2011 onwards in detail
|
|
##
|
|
## 12 Jan 2012 STILL NEED TO DOCUMENT some items below
|
|
##
|
|
## 19 Jan 2017 John Collins Make -jobname work with -pdfxe and -pdflua
|
|
## (v. 4.53c)
|
|
## 17 Jan 2017 John Collins Fix bbl file detection bug.
|
|
## Bbl files were previously only identified
|
|
## from occurrence as input files in log
|
|
## file rather than from fls as well.
|
|
## 16 Jan 2017 John Collins Clean up
|
|
## Add extra item to @file_not_found for
|
|
## xelatex's characteristic message.
|
|
## 14 Jan 2017 John Collins Fix some diagnostics.
|
|
## Detect graphics candidates in log file from
|
|
## <...> constructs.
|
|
## Don't look in log file for input files in the
|
|
## (...) and <...> constructs unless forced to
|
|
## by lack of up-to-date fls file.
|
|
## 13 Jan 2017 John Collins Kpsewhich diagnostics: also if not
|
|
## silent, or when $kpsewhich_show set.
|
|
## Optimize calls to kpsewhich to find files
|
|
## given by lines put in log file by
|
|
## graphics package.
|
|
## Work around LuaTeX line-wrapping bug. (LuaTeX 0.95.0)
|
|
## 12 Jan 2017 John Collins Improve error reporting on failed run.
|
|
## 11 Jan 2017 John Collins With -diagnositcs, include invocation
|
|
## and results for kpsewhich.
|
|
## 4, 10 Jan 2017 John Collins Finish fix for read-after-write files
|
|
## 29-31 Dec 2016 John Collins V. 4.51
|
|
## For biber and bibtex rules, included .blg
|
|
## file as extra generated file.
|
|
## Similarly for makeindex rule
|
|
## 3 Nov 2016 John Collins Start to fix problem reported by jfbu
|
|
## that with deleted aux file, latexmk
|
|
## does too few runs.
|
|
## Problems:
|
|
## 1. latexmk doesn't create initial
|
|
## dummy aux or fdb when only one
|
|
## fails to exist, but only when
|
|
## both fail to exist.
|
|
## 2. latexmk detects the aux file as
|
|
## only read after write, and
|
|
## hence not a true dependent.
|
|
## That is the initial attempt to
|
|
## read, giving a No file message,
|
|
## is not recorded in the fls
|
|
## file.
|
|
## First fix: missing aux file => make
|
|
## dummy.
|
|
## Need better: if source file in fdb
|
|
## doesn't exist initially, then it
|
|
## should be counted as initially
|
|
## read, so not read after write.
|
|
## 18 Oct 2016 John Collins xelatex support via xdv file for speed.
|
|
## lualatex
|
|
## 5 Sep 2016 John Collins Add routines: rdb_list_source, rdb_set_source
|
|
## 17 Aug 2016 John Collins Add XDG Base Directory compatibility
|
|
## for per-user rc file
|
|
## 1 May 2016 John Collins Correct creation of output and aux directories
|
|
## to correctly handle relative paths when -cd
|
|
## is used.
|
|
## 22 Apr 2016 John Collins Fix problem of -C not always working correctly
|
|
## when compilation was with -pdf and clear was default.
|
|
## (Correctly default set of rules in rdb_make_rule_list.)
|
|
## Ver. 4.45
|
|
##
|
|
## 1998-2010, John Collins. Many improvements and fixes.
|
|
## See CHANGE-log.txt for full list, and CHANGES for summary
|
|
##
|
|
## Modified by Evan McLean (no longer available for support)
|
|
## Original script (RCS version 2.3) called "go" written by David J. Musliner
|
|
##
|
|
##-----------------------------------------------------------------------
|
|
|
|
|
|
## Explicit exit codes:
|
|
## 10 = bad command line arguments
|
|
## 11 = file specified on command line not found
|
|
## or other file not found
|
|
## 12 = failure in some part of making files
|
|
## 13 = error in initialization file
|
|
## 20 = probable bug
|
|
## or retcode from called program.
|
|
|
|
|
|
# Line length in log file that indicates wrapping.
|
|
# This number EXCLUDES line-end characters, and is one-based.
|
|
# It is the parameter max_print_line in the TeX program. (tex.web)
|
|
$log_wrap = 79;
|
|
|
|
#########################################################################
|
|
## Default parsing and file-handling settings
|
|
|
|
## Array of reg-exps for patterns in log-file for file-not-found
|
|
## Each item is the string in a regexp, without the enclosing slashes.
|
|
## First parenthesized part is the filename.
|
|
## Note the need to quote slashes and single right quotes to make them
|
|
## appear in the regexp.
|
|
## Add items by push, e.g.,
|
|
## push @file_not_found, '^No data file found `([^\\\']*)\\\'';
|
|
## will give match to line starting "No data file found `filename'"
|
|
@file_not_found = (
|
|
'^No file\\s*(.*)\\.$',
|
|
'^\\! LaTeX Error: File `([^\\\']*)\\\' not found\\.',
|
|
'.*?:\\d*: LaTeX Error: File `([^\\\']*)\\\' not found\\.',
|
|
'^LaTeX Warning: File `([^\\\']*)\\\' not found',
|
|
'^Package .* [fF]ile `([^\\\']*)\\\' not found',
|
|
'Error: pdflatex \(file ([^\)]*)\): cannot find image file',
|
|
': File (.*) not found:\s*$',
|
|
'! Unable to load picture or PDF file \\\'([^\\\']+)\\\'.',
|
|
);
|
|
|
|
## Hash mapping file extension (w/o period, e.g., 'eps') to a single regexp,
|
|
# whose matching by a line in a file with that extension indicates that the
|
|
# line is to be ignored in the calculation of the hash number (md5 checksum)
|
|
# for the file. Typically used for ignoring datestamps in testing whether
|
|
# a file has changed.
|
|
# Add items e.g., by
|
|
# $hash_calc_ignore_pattern{'eps'} = '^%%CreationDate: ';
|
|
# This makes the hash calculation for an eps file ignore lines starting with
|
|
# '%%CreationDate: '
|
|
# ?? Note that a file will be considered changed if
|
|
# (a) its size changes
|
|
# or (b) its hash changes
|
|
# So it is useful to ignore lines in the hash calculation only if they
|
|
# are of a fixed size (as with a date/time stamp).
|
|
%hash_calc_ignore_pattern =();
|
|
|
|
|
|
# Specification of templates for extra rules.
|
|
# See subroutine rdb_make_rule_list for examples of rule templates.
|
|
# See subroutine rdb_set_rules for how they get used to construct rules.
|
|
# (Documentation obviously needs to be improved!)
|
|
%extra_rule_spec = ();
|
|
|
|
|
|
# Hooks for customized extra processing on aux files. The following
|
|
# variable is an array of references to function. Each function is
|
|
# invoked in turn when a line of an aux file is processed (if none
|
|
# of the built-in actions have been done). On entry to the function,
|
|
# the following variables are set:
|
|
# $_ = current line of aux file
|
|
# $rule = name of rule during the invocation of which, the aux file
|
|
# was supposed to have been generated.
|
|
@aux_hooks = ();
|
|
|
|
#########################################################################
|
|
## Default document processing programs, and related settings,
|
|
## These are mostly the same on all systems.
|
|
## Most of these variables represents the external command needed to
|
|
## perform a certain action. Some represent switches.
|
|
|
|
## Commands to invoke latex, pdflatex, etc
|
|
$latex = 'latex %O %S';
|
|
$pdflatex = 'pdflatex %O %S';
|
|
$lualatex = 'lualatex %O %S';
|
|
# xelatex is used to give xdv file, not pdf file
|
|
$xelatex = 'xelatex -no-pdf %O %S';
|
|
|
|
## Default switches:
|
|
$latex_default_switches = '';
|
|
$pdflatex_default_switches = '';
|
|
$lualatex_default_switches = '';
|
|
$xelatex_default_switches = '';
|
|
|
|
## Switch(es) to make them silent:
|
|
$latex_silent_switch = '-interaction=batchmode';
|
|
$pdflatex_silent_switch = '-interaction=batchmode';
|
|
$lualatex_silent_switch = '-interaction=batchmode';
|
|
$xelatex_silent_switch = '-interaction=batchmode';
|
|
|
|
# %input_extensions maps primary_rule_name to pointer to hash of file extensions
|
|
# used for extensionless files specified in the source file by constructs
|
|
# like \input{file} \includegraphics{file}
|
|
# Could write
|
|
#%input_extensions = ( 'latex' => { 'tex' => 1, 'eps' => 1 };,
|
|
# 'pdflatex' => { 'tex' => 1, 'pdf' => 1, 'jpg' => 1, 'png' => 1 }; );
|
|
# Instead we'll exercise the user-friendly access routines:
|
|
add_input_ext( 'latex', 'tex', 'eps' );
|
|
add_input_ext( 'pdflatex', 'tex', 'jpg', 'pdf', 'png' );
|
|
add_input_ext( 'lualatex', 'tex', 'jpg', 'pdf', 'png' );
|
|
add_input_ext( 'xelatex', 'tex', 'jpg', 'pdf', 'png' );
|
|
#show_input_ext( 'latex' ); show_input_ext( 'pdflatex' );
|
|
|
|
# Information about options to latex and pdflatex that latexmk will simply
|
|
# pass through to (pdf)latex
|
|
# Option without arg. maps to itself.
|
|
# Option with arg. maps the option part to the full specification
|
|
# e.g., -kpathsea-debug => -kpathsea-debug=NUMBER
|
|
%allowed_latex_options = ();
|
|
%allowed_latex_options_with_arg = ();
|
|
foreach (
|
|
#####
|
|
# TeXLive options
|
|
"-draftmode switch on draft mode (generates no output PDF)",
|
|
"-enc enable encTeX extensions such as \\mubyte",
|
|
"-etex enable e-TeX extensions",
|
|
"-file-line-error enable file:line:error style messages",
|
|
"-no-file-line-error disable file:line:error style messages",
|
|
"-fmt=FMTNAME use FMTNAME instead of program name or a %& line",
|
|
"-halt-on-error stop processing at the first error",
|
|
"-interaction=STRING set interaction mode (STRING=batchmode/nonstopmode/\n".
|
|
" scrollmode/errorstopmode)",
|
|
"-ipc send DVI output to a socket as well as the usual\n".
|
|
" output file",
|
|
"-ipc-start as -ipc, and also start the server at the other end",
|
|
"-kpathsea-debug=NUMBER set path searching debugging flags according to\n".
|
|
" the bits of NUMBER",
|
|
"-mktex=FMT enable mktexFMT generation (FMT=tex/tfm/pk)",
|
|
"-no-mktex=FMT disable mktexFMT generation (FMT=tex/tfm/pk)",
|
|
"-mltex enable MLTeX extensions such as \charsubdef",
|
|
"-output-comment=STRING use STRING for DVI file comment instead of date\n".
|
|
" (no effect for PDF)",
|
|
"-output-format=FORMAT use FORMAT for job output; FORMAT is `dvi\" or `pdf\"",
|
|
"-parse-first-line enable parsing of first line of input file",
|
|
"-no-parse-first-line disable parsing of first line of input file",
|
|
"-progname=STRING set program (and fmt) name to STRING",
|
|
"-shell-escape enable \\write18{SHELL COMMAND}",
|
|
"-no-shell-escape disable \\write18{SHELL COMMAND}",
|
|
"-shell-restricted enable restricted \\write18",
|
|
"-src-specials insert source specials into the DVI file",
|
|
"-src-specials=WHERE insert source specials in certain places of\n".
|
|
" the DVI file. WHERE is a comma-separated value\n".
|
|
" list: cr display hbox math par parend vbox",
|
|
"-synctex=NUMBER generate SyncTeX data for previewers if nonzero",
|
|
"-translate-file=TCXNAME use the TCX file TCXNAME",
|
|
"-8bit make all characters printable by default",
|
|
|
|
#####
|
|
# MikTeX options not in TeXLive
|
|
"-alias=app pretend to be app",
|
|
"-buf-size=n maximum number of characters simultaneously present\n".
|
|
" in current lines",
|
|
"-c-style-errors C-style error messages",
|
|
"-disable-installer disable automatic installation of missing packages",
|
|
"-disable-pipes disable input (output) from (to) child processes",
|
|
"-disable-write18 disable the \\write18{command} construct",
|
|
"-dont-parse-first-line disable checking whether the first line of the main\n".
|
|
" input file starts with %&",
|
|
"-enable-enctex enable encTeX extensions such as \\mubyte",
|
|
"-enable-installer enable automatic installation of missing packages",
|
|
"-enable-mltex enable MLTeX extensions such as \charsubdef",
|
|
"-enable-pipes enable input (output) from (to) child processes",
|
|
"-enable-write18 fully enable the \\write18{command} construct",
|
|
"-error-line=n set the width of context lines on terminal error\n".
|
|
" messages",
|
|
"-extra-mem-bot=n set the extra size (in memory words) for large data\n".
|
|
" structures",
|
|
"-extra-mem-top=n set the extra size (in memory words) for chars,\n".
|
|
" tokens, et al",
|
|
"-font-max=n set the maximum internal font number",
|
|
"-font-mem-size=n set the size, in TeX memory words, of the font memory",
|
|
"-half-error-line=n set the width of first lines of contexts in terminal\n".
|
|
" error messages",
|
|
"-hash-extra=n set the extra space for the hash table of control\n".
|
|
" sequences",
|
|
"-job-time=file set the time-stamp of all output files equal to\n".
|
|
" file's time-stamp",
|
|
"-main-memory=n change the total size (in memory words) of the main\n".
|
|
" memory array",
|
|
"-max-in-open=n set the maximum number of input files and error\n".
|
|
" insertions that can be going on simultaneously",
|
|
"-max-print-line=n set the width of longest text lines output",
|
|
"-max-strings=n set the maximum number of strings",
|
|
"-nest-size=n set the maximum number of semantic levels\n".
|
|
" simultaneously active",
|
|
"-no-c-style-errors standard error messages",
|
|
"-param-size=n set the the maximum number of simultaneous macro\n".
|
|
" parameters",
|
|
"-pool-size=n set the maximum number of characters in strings",
|
|
"-record-package-usages=file record all package usages and write them into\n".
|
|
" file",
|
|
"-restrict-write18 partially enable the \\write18{command} construct",
|
|
"-save-size=n set the the amount of space for saving values\n".
|
|
" outside of current group",
|
|
"-stack-size=n set the maximum number of simultaneous input sources",
|
|
"-string-vacancies=n set the minimum number of characters that should be\n".
|
|
" available for the user's control sequences and font\n".
|
|
" names",
|
|
"-tcx=name process the TCX table name",
|
|
"-time-statistics show processing time statistics",
|
|
"-trace enable trace messages",
|
|
"-trace=tracestreams enable trace messages. The tracestreams argument is\n".
|
|
" a comma-separated list of trace stream names",
|
|
"-trie-size=n set the amount of space for hyphenation patterns",
|
|
"-undump=name use name as the name of the format to be used,\n".
|
|
" instead of the name by which the program was\n".
|
|
" called or a %& line.",
|
|
|
|
#####
|
|
# Options passed to (pdf)latex that have special processing by latexmk,
|
|
# so they are commented out here.
|
|
#-jobname=STRING set the job name to STRING
|
|
#-aux-directory=dir Set the directory dir to which auxiliary files are written
|
|
#-output-directory=DIR use existing DIR as the directory to write files in
|
|
#-quiet
|
|
#-recorder enable filename recorder
|
|
#
|
|
# Options with different processing by latexmk than (pdf)latex
|
|
#-help
|
|
#-version
|
|
#
|
|
# Options NOT used by latexmk
|
|
#-includedirectory=dir prefix dir to the search path
|
|
#-initialize become the INI variant of the compiler
|
|
#-ini be pdfinitex, for dumping formats; this is implicitly
|
|
# true if the program name is `pdfinitex'
|
|
) {
|
|
if ( /^([^\s=]+)=/ ) {
|
|
$allowed_latex_options_with_arg{$1} = $_;
|
|
}
|
|
elsif ( /^([^\s=]+)\s/ ) {
|
|
$allowed_latex_options{$1} = $_;
|
|
}
|
|
else {
|
|
$allowed_latex_options{$_} = $_;
|
|
}
|
|
}
|
|
|
|
# Arrays of options that will be added to latex and pdflatex.
|
|
# These need to be stored until after the command line parsing is finished,
|
|
# in case the values of $latex and/or $pdflatex change after an option
|
|
# is added.
|
|
@extra_latex_options = ();
|
|
@extra_pdflatex_options = ();
|
|
@extra_lualatex_options = ();
|
|
@extra_xelatex_options = ();
|
|
|
|
|
|
## Command to invoke biber & bibtex
|
|
$biber = 'biber %O %B';
|
|
$bibtex = 'bibtex %O %B';
|
|
# Switch(es) to make biber & bibtex silent:
|
|
$biber_silent_switch = '--onlylog';
|
|
$bibtex_silent_switch = '-terse';
|
|
$bibtex_use = 1; # Whether to actually run bibtex to update bbl files
|
|
# 0: Never run bibtex
|
|
# 1: Run bibtex only if the bibfiles exists
|
|
# according to kpsewhich, and the bbl files
|
|
# appear to be out-of-date
|
|
# 2: Run bibtex when the bbl files are out-of-date
|
|
# In any event bibtex is only run if the log file
|
|
# indicates that the document uses bbl files.
|
|
|
|
## Command to invoke makeindex
|
|
$makeindex = 'makeindex %O -o %D %S';
|
|
# Switch(es) to make makeinex silent:
|
|
$makeindex_silent_switch = '-q';
|
|
|
|
## Command to convert dvi file to pdf file directly:
|
|
$dvipdf = 'dvipdf %O %S %D';
|
|
# N.B. Standard dvipdf runs dvips and gs with their silent switch, so for
|
|
# standard dvipdf $dvipdf_silent_switch is unneeded, but innocuous.
|
|
# But dvipdfmx can be used instead, and it has a silent switch (-q).
|
|
# So implementing $dvipdf_silent_switch is useful.
|
|
|
|
$dvipdf_silent_switch = '-q';
|
|
|
|
## Command to convert dvi file to ps file:
|
|
$dvips = 'dvips %O -o %D %S';
|
|
## Command to convert dvi file to ps file in landscape format:
|
|
$dvips_landscape = 'dvips -tlandscape %O -o %D %S';
|
|
# Switch(es) to get dvips to make ps file suitable for conversion to good pdf:
|
|
# (If this is not used, ps file and hence pdf file contains bitmap fonts
|
|
# (type 3), which look horrible under acroread. An appropriate switch
|
|
# ensures type 1 fonts are generated. You can put this switch in the
|
|
# dvips command if you prefer.)
|
|
$dvips_pdf_switch = '-P pdf';
|
|
# Switch(es) to make dvips silent:
|
|
$dvips_silent_switch = '-q';
|
|
|
|
## Command to convert ps file to pdf file:
|
|
$ps2pdf = 'ps2pdf %O %S %D';
|
|
|
|
## Command to convert xdv file to pdf file
|
|
$xdvipdfmx = 'xdvipdfmx -o %D %O %S';
|
|
$xdvipdfmx_silent_switch = '-q';
|
|
|
|
|
|
## Command to search for tex-related files
|
|
$kpsewhich = 'kpsewhich %S';
|
|
|
|
## Command to run make:
|
|
$make = 'make';
|
|
|
|
##Printing:
|
|
$print_type = 'auto'; # When printing, print the postscript file.
|
|
# Possible values: 'dvi', 'ps', 'pdf', 'auto', 'none'
|
|
# 'auto' ==> set print type according to the printable
|
|
# file(s) being made: priority 'ps', 'pdf', 'dvi'
|
|
|
|
## Which treatment of default extensions and filenames with
|
|
## multiple extensions is used, for given filename on
|
|
## tex/latex's command line? See sub find_basename for the
|
|
## possibilities.
|
|
## Current tex's treat extensions like UNIX teTeX:
|
|
$extension_treatment = 'unix';
|
|
|
|
## Substitute backslashes in file and directory names for
|
|
## MSWin command line
|
|
$MSWin_back_slash = 1;
|
|
|
|
$dvi_update_signal = undef;
|
|
$ps_update_signal = undef;
|
|
$pdf_update_signal = undef;
|
|
|
|
$dvi_update_command = undef;
|
|
$ps_update_command = undef;
|
|
$pdf_update_command = undef;
|
|
|
|
$allow_subdir_creation = 1;
|
|
|
|
$new_viewer_always = 0; # If 1, always open a new viewer in pvc mode.
|
|
# If 0, only open a new viewer if no previous
|
|
# viewer for the same file is detected.
|
|
|
|
$quote_filenames = 1; # Quote filenames in external commands
|
|
|
|
$del_dir = ''; # Directory into which cleaned up files are to be put.
|
|
# If $del_dir is '', just delete the files
|
|
|
|
@rc_system_files = ();
|
|
|
|
#########################################################################
|
|
|
|
################################################################
|
|
## Special variables for system-dependent fudges, etc.
|
|
$log_file_binary = 0; # Whether to treat log file as binary
|
|
# Normally not, since the log file SHOULD be pure text.
|
|
# But Miktex 2.7 sometimes puts binary characters
|
|
# in it. (Typically in construct \OML ... after
|
|
# overfull box with mathmode.)
|
|
# Sometimes there is ctrl/Z, which is not only non-text,
|
|
# but is end-of-file marker for MS-Win in text mode.
|
|
|
|
$MSWin_fudge_break = 1; # Give special treatment to ctrl/C and ctrl/break
|
|
# in -pvc mode under MSWin
|
|
# Under MSWin32 (at least with perl 5.8 and WinXP)
|
|
# when latexmk is running another program, and the
|
|
# user gives ctrl/C or ctrl/break, to stop the
|
|
# daughter program, not only does it reach
|
|
# the daughter, but also latexmk/perl, so
|
|
# latexmk is stopped also. In -pvc mode,
|
|
# this is not normally desired. So when the
|
|
# $MSWin_fudge_break variable is set,
|
|
# latexmk arranges to ignore ctrl/C and
|
|
# ctrl/break during processing of files;
|
|
# only the daughter programs receive them.
|
|
# This fudge is not applied in other
|
|
# situations, since then having latexmk also
|
|
# stopping because of the ctrl/C or
|
|
# ctrl/break signal is desirable.
|
|
# The fudge is not needed under UNIX (at least
|
|
# with Perl 5.005 on Solaris 8). Only the
|
|
# daughter programs receive the signal. In
|
|
# fact the inverse would be useful: In
|
|
# normal processing, as opposed to -pvc, if
|
|
# force mode (-f) is set, a ctrl/C is
|
|
# received by a daughter program does not
|
|
# also stop latexmk. Under tcsh, we get
|
|
# back to a command prompt, while latexmk
|
|
# keeps running in the background!
|
|
|
|
|
|
################################################################
|
|
|
|
|
|
# System-dependent overrides:
|
|
# Currently, the cases I have tests for are: MSWin32, cygwin, linux and
|
|
# darwin, with the main complications being for MSWin32 and cygwin.
|
|
# Special treatment may also be useful for MSYS (for which $^O reports
|
|
# "msys"). This is another *nix-emulation/system for MSWindows. At
|
|
# present it is treated as unix-like, but the environment variables
|
|
# are those of Windows. (The test for USERNAME as well as USER was
|
|
# to make latexmk work under MSYS's perl.)
|
|
#
|
|
if ( $^O eq "MSWin32" ) {
|
|
# Pure MSWindows configuration
|
|
## Configuration parameters:
|
|
|
|
## Use first existing case for $tmpdir:
|
|
$tmpdir = $ENV{TMPDIR} || $ENV{TEMP} || '.';
|
|
$log_file_binary = 1; # Protect against ctrl/Z in log file from
|
|
# Miktex 2.7.
|
|
|
|
## List of possibilities for the system-wide initialization file.
|
|
## The first one found (if any) is used.
|
|
@rc_system_files = ( "C:/latexmk/LatexMk", "C:/latexmk/latexmkrc" );
|
|
|
|
$search_path_separator = ';'; # Separator of elements in search_path
|
|
|
|
# For a pdf-file, "start x.pdf" starts the pdf viewer associated with
|
|
# pdf files, so no program name is needed:
|
|
$pdf_previewer = 'start %O %S';
|
|
$ps_previewer = 'start %O %S';
|
|
$ps_previewer_landscape = $ps_previewer;
|
|
$dvi_previewer = 'start %O %S';
|
|
$dvi_previewer_landscape = "$dvi_previewer";
|
|
# Viewer update methods:
|
|
# 0 => auto update: viewer watches file (e.g., gv)
|
|
# 1 => manual update: user must do something: e.g., click on window.
|
|
# (e.g., ghostview, MSWIN previewers, acroread under UNIX)
|
|
# 2 => send signal. Number of signal in $dvi_update_signal,
|
|
# $ps_update_signal, $pdf_update_signal
|
|
# 3 => viewer can't update, because it locks the file and the file
|
|
# cannot be updated. (acroread under MSWIN)
|
|
# 4 => run a command to force the update. The commands are
|
|
# specified by the variables $dvi_update_command,
|
|
# $ps_update_command, $pdf_update_command
|
|
$dvi_update_method = 1;
|
|
$ps_update_method = 1;
|
|
$pdf_update_method = 3; # acroread locks the pdf file
|
|
# Use NONE as flag that I am not implementing some commands:
|
|
$lpr =
|
|
'NONE $lpr variable is not configured to allow printing of ps files';
|
|
$lpr_dvi =
|
|
'NONE $lpr_dvi variable is not configured to allow printing of dvi files';
|
|
$lpr_pdf =
|
|
'NONE $lpr_pdf variable is not configured to allow printing of pdf files';
|
|
# The $pscmd below holds a command to list running processes. It
|
|
# is used to find the process ID of the viewer looking at the
|
|
# current output file. The output of the command must include the
|
|
# process number and the command line of the processes, since the
|
|
# relevant process is identified by the name of file to be viewed.
|
|
# Its use is not essential.
|
|
$pscmd =
|
|
'NONE $pscmd variable is not configured to detect running processes';
|
|
$pid_position = -1; # offset of PID in output of pscmd.
|
|
# Negative means I cannot use ps
|
|
}
|
|
elsif ( $^O eq "cygwin" ) {
|
|
# The problem is a mixed MSWin32 and UNIX environment.
|
|
# Perl decides the OS is cygwin in two situations:
|
|
# 1. When latexmk is run from a cygwin shell under a cygwin
|
|
# environment. Perl behaves in a UNIX way. This is OK, since
|
|
# the user is presumably expecting UNIXy behavior.
|
|
# 2. When CYGWIN exectuables are in the path, but latexmk is run
|
|
# from a native NT shell. Presumably the user is expecting NT
|
|
# behavior. But perl behaves more UNIXy. This causes some
|
|
# clashes.
|
|
# The issues to handle are:
|
|
# 1. Perl sees both MSWin32 and cygwin filenames. This is
|
|
# normally only an advantage.
|
|
# 2. Perl uses a UNIX shell in the system command
|
|
# This is a nasty problem: under native NT, there is a
|
|
# start command that knows about NT file associations, so that
|
|
# we can do, e.g., (under native NT) system("start file.pdf");
|
|
# But this won't work when perl has decided the OS is cygwin,
|
|
# even if it is invoked from a native NT command line. An
|
|
# NT command processor must be used to deal with this.
|
|
# 3. External executables can be native NT (which only know
|
|
# NT-style file names) or cygwin executables (which normally
|
|
# know both cygwin UNIX-style file names and NT file names,
|
|
# but not always; some do not know about drive names, for
|
|
# example).
|
|
# Cygwin executables for tex and latex may only know cygwin
|
|
# filenames.
|
|
# 4. The BIBINPUTS environment variables may be
|
|
# UNIX-style or MSWin-style depending on whether native NT or
|
|
# cygwin executables are used. They are therefore parsed
|
|
# differently. Here is the clash:
|
|
# a. If a user is running under an NT shell, is using a
|
|
# native NT installation of tex (e.g., fptex or miktex),
|
|
# but has the cygwin executables in the path, then perl
|
|
# detects the OS as cygwin, but the user needs NT
|
|
# behavior from latexmk.
|
|
# b. If a user is running under an UNIX shell in a cygwin
|
|
# environment, and is using the cygwin installation of
|
|
# tex, then perl detects the OS as cygwin, and the user
|
|
# needs UNIX behavior from latexmk.
|
|
# Latexmk has no way of detecting the difference. The two
|
|
# situations may even arise for the same user on the same
|
|
# computer simply by changing the order of directories in the
|
|
# path environment variable
|
|
|
|
|
|
## Configuration parameters: We'll assume native NT executables.
|
|
## The user should override if they are not.
|
|
|
|
# This may fail: perl converts MSWin temp directory name to cygwin
|
|
# format. Names containing this string cannot be handled by native
|
|
# NT executables.
|
|
$tmpdir = $ENV{TMPDIR} || $ENV{TEMP} || '.';
|
|
|
|
## List of possibilities for the system-wide initialization file.
|
|
## The first one found (if any) is used.
|
|
## We could stay with MSWin files here, since cygwin perl understands them
|
|
## @rc_system_files = ( 'C:/latexmk/LatexMk', 'C:/latexmk/latexmkrc' );
|
|
## But they are deprecated in v. 1.7. So use the UNIX version, prefixed
|
|
## with a cygwin equivalent of the MSWin location
|
|
## In addition, we need to add the same set of possible locations as with
|
|
## unix, so that the user use a unix-style setup.
|
|
@rc_system_files = ();
|
|
foreach ( 'LatexMk', 'latexmkrc' ) {
|
|
push @rc_system_files,
|
|
( "/cygdrive/c/latexmk/$_",
|
|
"/opt/local/share/latexmk/$_",
|
|
"/usr/local/share/latexmk/$_",
|
|
"/usr/local/lib/latexmk/$_" );
|
|
}
|
|
$search_path_separator = ';'; # Separator of elements in search_path
|
|
# This is tricky. The search_path_separator depends on the kind
|
|
# of executable: native NT v. cygwin.
|
|
# So the user will have to override this.
|
|
|
|
# We will assume that files can be viewed by native NT programs.
|
|
# Then we must fix the start command/directive, so that the
|
|
# NT-native start command of a cmd.exe is used.
|
|
# For a pdf-file, "start x.pdf" starts the pdf viewer associated with
|
|
# pdf files, so no program name is needed:
|
|
$start_NT = "cmd /c start \"\"";
|
|
$pdf_previewer = "$start_NT %O %S";
|
|
$ps_previewer = "$start_NT %O %S";
|
|
$ps_previewer_landscape = $ps_previewer;
|
|
$dvi_previewer = "$start_NT %O %S";
|
|
$dvi_previewer_landscape = $dvi_previewer;
|
|
# Viewer update methods:
|
|
# 0 => auto update: viewer watches file (e.g., gv)
|
|
# 1 => manual update: user must do something: e.g., click on window.
|
|
# (e.g., ghostview, MSWIN previewers, acroread under UNIX)
|
|
# 2 => send signal. Number of signal in $dvi_update_signal,
|
|
# $ps_update_signal, $pdf_update_signal
|
|
# 3 => viewer can't update, because it locks the file and the file
|
|
# cannot be updated. (acroread under MSWIN)
|
|
$dvi_update_method = 1;
|
|
$ps_update_method = 1;
|
|
$pdf_update_method = 3; # acroread locks the pdf file
|
|
# Use NONE as flag that I am not implementing some commands:
|
|
$lpr =
|
|
'NONE $lpr variable is not configured to allow printing of ps files';
|
|
$lpr_dvi =
|
|
'NONE $lpr_dvi variable is not configured to allow printing of dvi files';
|
|
$lpr_pdf =
|
|
'NONE $lpr_pdf variable is not configured to allow printing of pdf files';
|
|
# The $pscmd below holds a command to list running processes. It
|
|
# is used to find the process ID of the viewer looking at the
|
|
# current output file. The output of the command must include the
|
|
# process number and the command line of the processes, since the
|
|
# relevant process is identified by the name of file to be viewed.
|
|
# Its use is not essential.
|
|
# When the OS is detected as cygwin, there are two possibilities:
|
|
# a. Latexmk was run from an NT prompt, but cygwin is in the
|
|
# path. Then the cygwin ps command will not see commands
|
|
# started from latexmk. So we cannot use it.
|
|
# b. Latexmk was started within a cygwin environment. Then
|
|
# the ps command works as we need.
|
|
# Only the user, not latemk knows which, so we default to not
|
|
# using the ps command. The user can override this in a
|
|
# configuration file.
|
|
$pscmd =
|
|
'NONE $pscmd variable is not configured to detect running processes';
|
|
$pid_position = -1; # offset of PID in output of pscmd.
|
|
# Negative means I cannot use ps
|
|
}
|
|
else {
|
|
# Assume anything else is UNIX or clone
|
|
|
|
## Configuration parameters:
|
|
|
|
|
|
## Use first existing case for $tmpdir:
|
|
$tmpdir = $ENV{TMPDIR} || '/tmp';
|
|
|
|
## List of possibilities for the system-wide initialization file.
|
|
## The first one found (if any) is used.
|
|
## Normally on a UNIX it will be in a subdirectory of /opt/local/share or
|
|
## /usr/local/share, depending on the local conventions.
|
|
## But /usr/local/lib/latexmk is put in the list for
|
|
## compatibility with older versions of latexmk.
|
|
@rc_system_files = ();
|
|
foreach ( 'LatexMk', 'latexmkrc' ) {
|
|
push @rc_system_files,
|
|
( "/opt/local/share/latexmk/$_",
|
|
"/usr/local/share/latexmk/$_",
|
|
"/usr/local/lib/latexmk/$_" );
|
|
}
|
|
$search_path_separator = ':'; # Separator of elements in search_path
|
|
|
|
$dvi_update_signal = $signo{USR1}
|
|
if ( defined $signo{USR1} ); # Suitable for xdvi
|
|
$ps_update_signal = $signo{HUP}
|
|
if ( defined $signo{HUP} ); # Suitable for gv
|
|
$pdf_update_signal = $signo{HUP}
|
|
if ( defined $signo{HUP} ); # Suitable for gv
|
|
## default document processing programs.
|
|
# Viewer update methods:
|
|
# 0 => auto update: viewer watches file (e.g., gv)
|
|
# 1 => manual update: user must do something: e.g., click on window.
|
|
# (e.g., ghostview, MSWIN previewers, acroread under UNIX)
|
|
# 2 => send signal. Number of signal in $dvi_update_signal,
|
|
# $ps_update_signal, $pdf_update_signal
|
|
# 3 => viewer can't update, because it locks the file and the file
|
|
# cannot be updated. (acroread under MSWIN)
|
|
# 4 => Run command to update. Command in $dvi_update_command,
|
|
# $ps_update_command, $pdf_update_command.
|
|
$dvi_previewer = 'start xdvi %O %S';
|
|
$dvi_previewer_landscape = 'start xdvi -paper usr %O %S';
|
|
if ( defined $dvi_update_signal ) {
|
|
$dvi_update_method = 2; # xdvi responds to signal to update
|
|
} else {
|
|
$dvi_update_method = 1;
|
|
}
|
|
# if ( defined $ps_update_signal ) {
|
|
# $ps_update_method = 2; # gv responds to signal to update
|
|
# $ps_previewer = 'start gv -nowatch';
|
|
# $ps_previewer_landscape = 'start gv -swap -nowatch';
|
|
# } else {
|
|
# $ps_update_method = 0; # gv -watch watches the ps file
|
|
# $ps_previewer = 'start gv -watch';
|
|
# $ps_previewer_landscape = 'start gv -swap -watch';
|
|
# }
|
|
# Turn off the fancy options for gv. Regular gv likes -watch etc
|
|
# GNU gv likes --watch etc. User must configure
|
|
$ps_update_method = 0; # gv -watch watches the ps file
|
|
$ps_previewer = 'start gv %O %S';
|
|
$ps_previewer_landscape = 'start gv -swap %O %S';
|
|
$pdf_previewer = 'start acroread %O %S';
|
|
$pdf_update_method = 1; # acroread under unix needs manual update
|
|
$lpr = 'lpr %O %S'; # Assume lpr command prints postscript files correctly
|
|
$lpr_dvi =
|
|
'NONE $lpr_dvi variable is not configured to allow printing of dvi files';
|
|
$lpr_pdf =
|
|
'NONE $lpr_pdf variable is not configured to allow printing of pdf files';
|
|
# The $pscmd below holds a command to list running processes. It
|
|
# is used to find the process ID of the viewer looking at the
|
|
# current output file. The output of the command must include the
|
|
# process number and the command line of the processes, since the
|
|
# relevant process is identified by the name of file to be viewed.
|
|
# Uses:
|
|
# 1. In preview_continuous mode, to save running a previewer
|
|
# when one is already running on the relevant file.
|
|
# 2. With xdvi in preview_continuous mode, xdvi must be
|
|
# signalled to make it read a new dvi file.
|
|
#
|
|
# The following works on Solaris, LINUX, HP-UX, IRIX
|
|
# Use -f to get full listing, including command line arguments.
|
|
# Use -u $ENV{USER} to get all processes started by current user (not just
|
|
# those associated with current terminal), but none of other users'
|
|
# processes.
|
|
# However, the USER environment variable may not exist. Windows uses
|
|
# USERNAME instead. (And this propagates to a situation of
|
|
# unix-emulation software running under Windows.)
|
|
if ( exists $ENV{USER} ) {
|
|
$pscmd = "ps -f -u $ENV{USER}";
|
|
}
|
|
elsif ( exists $ENV{USERNAME} ) {
|
|
$pscmd = "ps -f -u $ENV{USERNAME}";
|
|
}
|
|
else {
|
|
$pscmd = "ps -f";
|
|
}
|
|
$pid_position = 1; # offset of PID in output of pscmd; first item is 0.
|
|
if ( $^O eq "linux" ) {
|
|
# Ps on Redhat (at least v. 7.2) appears to truncate its output
|
|
# at 80 cols, so that a long command string is truncated.
|
|
# Fix this with the --width option. This option works under
|
|
# other versions of linux even if not necessary (at least
|
|
# for SUSE 7.2).
|
|
# However the option is not available under other UNIX-type
|
|
# systems, e.g., Solaris 8.
|
|
# But (19 Aug 2010), the truncation doesn't happen on RHEL4 and 5,
|
|
# unless the output is written to a terminal. So the --width
|
|
# option is now unnecessary
|
|
# $pscmd = "ps --width 200 -f -u $ENV{USER}";
|
|
}
|
|
elsif ( $^O eq "darwin" ) {
|
|
# OS-X on Macintosh
|
|
# open starts command associated with a file.
|
|
# For pdf, this is set by default to OS-X's preview, which is suitable.
|
|
# Manual update is simply by clicking on window etc, which is OK.
|
|
# For ps, this is set also to preview. This works, but since it
|
|
# converts the file to pdf and views the pdf file, it doesn't
|
|
# see updates, and a refresh cannot be done. This is far from
|
|
# optimal.
|
|
# For a full installation of MacTeX, which is probably the most common
|
|
# on OS-X, an association is created between dvi files and TeXShop.
|
|
# This also converts the file to pdf, so again while it works, it
|
|
# does not deal with changed dvi files, as far as I can see.
|
|
$pdf_previewer = 'open %S';
|
|
$pdf_update_method = 1; # manual
|
|
$dvi_previewer = $dvi_previewer_landscape = 'NONE';
|
|
$ps_previewer = $ps_previewer_landscape = 'NONE';
|
|
# Others
|
|
$lpr_pdf = 'lpr %O %S';
|
|
$pscmd = "ps -ww -u $ENV{USER}";
|
|
}
|
|
}
|
|
|
|
## default parameters
|
|
$auto_rc_use = 1; # Whether to read rc files automatically
|
|
$max_repeat = 5; # Maximum times I repeat latex. Normally
|
|
# 3 would be sufficient: 1st run generates aux file,
|
|
# 2nd run picks up aux file, and maybe toc, lof which
|
|
# contain out-of-date information, e.g., wrong page
|
|
# references in toc, lof and index, and unresolved
|
|
# references in the middle of lines. But the
|
|
# formatting is more-or-less correct. On the 3rd
|
|
# run, the page refs etc in toc, lof, etc are about
|
|
# correct, but some slight formatting changes may
|
|
# occur, which mess up page numbers in the toc and lof,
|
|
# Hence a 4th run is conceivably necessary.
|
|
# At least one document class (JHEP.cls) works
|
|
# in such a way that a 4th run is needed.
|
|
# We allow an extra run for safety for a
|
|
# maximum of 5. Needing further runs is
|
|
# usually an indication of a problem; further
|
|
# runs may not resolve the problem, and
|
|
# instead could cause an infinite loop.
|
|
$clean_ext = ""; # space separated extensions of files that are
|
|
# to be deleted when doing cleanup, beyond
|
|
# standard set
|
|
$clean_full_ext = ""; # space separated extensions of files that are
|
|
# to be deleted when doing cleanup_full, beyond
|
|
# standard set and those in $clean_ext
|
|
@cus_dep_list = (); # Custom dependency list
|
|
@default_files = ( '*.tex' ); # Array of LaTeX files to process when
|
|
# no files are specified on the command line.
|
|
# Wildcards allowed
|
|
# Best used for project specific files.
|
|
@default_excluded_files = ( );
|
|
# Array of LaTeX files to exclude when using
|
|
# @default_files, i.e., when no files are specified
|
|
# on the command line.
|
|
# Wildcards allowed
|
|
# Best used for project specific files.
|
|
$texfile_search = ""; # Specification for extra files to search for
|
|
# when no files are specified on the command line
|
|
# and the @default_files variable is empty.
|
|
# Space separated, and wildcards allowed.
|
|
# These files are IN ADDITION to *.tex in current
|
|
# directory.
|
|
# This variable is obsolete, and only in here for
|
|
# backward compatibility.
|
|
|
|
$fdb_ext = 'fdb_latexmk'; # Extension for the file for latexmk's
|
|
# file-database
|
|
# Make it long to avoid possible collisions.
|
|
$fdb_ver = 3; # Version number for kind of fdb_file.
|
|
|
|
$jobname = ''; # Jobname: as with current tex, etc indicates
|
|
# basename of generated files.
|
|
# Defined so that --jobname=STRING on latexmk's
|
|
# command line has same effect as with current
|
|
# tex, etc. (If $jobname is non-empty, then
|
|
# the --jobname=... option is used on tex.)
|
|
$out_dir = ''; # Directory for output files.
|
|
# Cf. --output-directory of current (pdf)latex
|
|
$aux_dir = ''; # Directory for aux files (log, aux, etc).
|
|
# Cf. --aux-directory of current (pdf)latex in MiKTeX.
|
|
|
|
|
|
## default flag settings.
|
|
$recorder = 1; # Whether to use recorder option on latex/pdflatex
|
|
$silent = 0; # Silence latex's messages?
|
|
$silence_logfile_warnings = 0; # Do list warnings in log file
|
|
$kpsewhich_show = 0; # Show calls to and results from kpsewhich
|
|
$landscape_mode = 0; # default to portrait mode
|
|
$analyze_input_log_always = 0; # Always analyze .log for input files in the
|
|
# <...> and (...) constructions. Otherwise, only
|
|
# do the analysis when fls file doesn't exist or is
|
|
# out of date.
|
|
|
|
# The following two arrays contain lists of extensions (without
|
|
# period) for files that are read in during a (pdf)LaTeX run but that
|
|
# are generated automatically from the previous run, as opposed to
|
|
# being user generated files (directly or indirectly from a custom
|
|
# dependency). These files get two kinds of special treatment:
|
|
# 1. In clean up, where depending on the kind of clean up, some
|
|
# or all of these generated files are deleted.
|
|
# (Note that special treatment is given to aux files.)
|
|
# 2. In analyzing the results of a run of (pdf)LaTeX, to
|
|
# determine if another run is needed. With an error free run,
|
|
# a rerun should be provoked by a change in any source file,
|
|
# whether a user file or a generated file. But with a run
|
|
# that ends in an error, only a change in a user file during
|
|
# the run (which might correct the error) should provoke a
|
|
# rerun, but a change in a generated file should not.
|
|
# These arrays can be user-configured.
|
|
|
|
@generated_exts = ( 'aux', 'bcf', 'fls', 'idx', 'ind', 'lof', 'lot',
|
|
'out', 'toc' );
|
|
# N.B. 'out' is generated by hyperref package
|
|
|
|
# Which kinds of file do I have requests to make?
|
|
# If no requests at all are made, then I will make dvi file
|
|
# If particular requests are made then other files may also have to be
|
|
# made. E.g., ps file requires a dvi file
|
|
$dvi_mode = 0; # No dvi file requested
|
|
$postscript_mode = 0; # No postscript file requested
|
|
$pdf_mode = 0; # No pdf file requested to be made by pdflatex
|
|
# Possible values:
|
|
# 0 don't create pdf file
|
|
# 1 to create pdf file by pdflatex
|
|
# 2 to create pdf file by ps2pdf
|
|
# 3 to create pdf file by dvipdf
|
|
# 4 to create pdf file by lualatex
|
|
# 5 to create pdf file by xelatex + xdvipdfmx
|
|
$view = 'default'; # Default preview is of highest of dvi, ps, pdf
|
|
$sleep_time = 2; # time to sleep b/w checks for file changes in -pvc mode
|
|
$banner = 0; # Non-zero if we have a banner to insert
|
|
$banner_scale = 220; # Original default scale
|
|
$banner_intensity = 0.95; # Darkness of the banner message
|
|
$banner_message = 'DRAFT'; # Original default message
|
|
$do_cd = 0; # Do not do cd to directory of source file.
|
|
# Thus behave like latex.
|
|
$dependents_list = 0; # Whether to display list(s) of dependencies
|
|
$dependents_phony = 0; # Whether list(s) of dependencies includes phony targets
|
|
# (as with 'gcc -MP').
|
|
$deps_file = '-'; # File for dependency list output. Default stdout.
|
|
$rules_list = 0; # Whether to display list(s) of dependencies
|
|
@dir_stack = (); # Stack of pushed directories, each of form of
|
|
# pointer to array [ cwd, good_cwd ], where
|
|
# good_cwd differs from cwd by being converted
|
|
# to native MSWin path when cygwin is used.
|
|
$cleanup_mode = 0; # No cleanup of nonessential LaTex-related files.
|
|
# $cleanup_mode = 0: no cleanup
|
|
# $cleanup_mode = 1: full cleanup
|
|
# $cleanup_mode = 2: cleanup except for dvi,
|
|
# dviF, pdf, ps, psF & xdv
|
|
$cleanup_fdb = 0; # No removal of file for latexmk's file-database
|
|
$cleanup_only = 0; # When doing cleanup, do not go on to making files
|
|
$cleanup_includes_generated = 0;
|
|
# Determines whether cleanup deletes files generated by
|
|
# custom dependencies
|
|
$cleanup_includes_cusdep_generated = 0;
|
|
# Determines whether cleanup deletes files generated by
|
|
# (pdf)latex (found from \openout lines in log file).
|
|
$diagnostics = 0;
|
|
$dvi_filter = ''; # DVI filter command
|
|
$ps_filter = ''; # Postscript filter command
|
|
|
|
$force_mode = 0; # =1 to force processing past errors
|
|
$go_mode = 0; # =1 to force processing regardless of time-stamps
|
|
# =2 full clean-up first
|
|
$preview_mode = 0;
|
|
$preview_continuous_mode = 0;
|
|
$printout_mode = 0; # Don't print the file
|
|
|
|
$show_time = 0;
|
|
@timings = ();
|
|
$processing_time1 = processing_time();
|
|
|
|
$use_make_for_missing_files = 0; # Whether to use make to try to make missing files.
|
|
|
|
# Do we make view file in temporary then move to final destination?
|
|
# (To avoid premature updating by viewer).
|
|
$always_view_file_via_temporary = 0; # Set to 1 if viewed file is always
|
|
# made through a temporary.
|
|
$pvc_view_file_via_temporary = 1; # Set to 1 if only in -pvc mode is viewed
|
|
# file made through a temporary.
|
|
|
|
# State variables initialized here:
|
|
|
|
$updated = 0; # Flags when something has been remade
|
|
# Used to allow convenient user message in -pvc mode
|
|
$waiting = 0; # Flags whether we are in loop waiting for an event
|
|
# Used to avoid unnecessary repeated o/p in wait loop
|
|
|
|
# Used for some results of parsing log file:
|
|
$reference_changed = 0;
|
|
$mult_defined = 0;
|
|
$bad_reference = 0;
|
|
$bad_citation = 0;
|
|
|
|
# Cache of expensive-to-compute state variables, e.g., cwd in form
|
|
# fixed to deal with cygwin issues.
|
|
%cache = ();
|
|
&cache_good_cwd;
|
|
|
|
# Set search paths for includes.
|
|
# Set them early so that they can be overridden
|
|
$BIBINPUTS = $ENV{'BIBINPUTS'};
|
|
if (!$BIBINPUTS) { $BIBINPUTS = '.'; }
|
|
|
|
# Convert search paths to arrays:
|
|
# If any of the paths end in '//' then recursively search the
|
|
# directory. After these operations, @BIBINPUTS should
|
|
# have all the directories that need to be searched
|
|
|
|
@BIBINPUTS = find_dirs1( $BIBINPUTS );
|
|
|
|
|
|
######################################################################
|
|
######################################################################
|
|
#
|
|
# ??? UPDATE THE FOLLOWING!!
|
|
#
|
|
# We will need to determine whether source files for runs of various
|
|
# programs are out of date. In a normal situation, this is done by
|
|
# asking whether the times of the source files are later than the
|
|
# destination files. But this won't work for us, since a common
|
|
# situation is that a file is written on one run of latex, for
|
|
# example, and read back in on the next run (e.g., an .aux file).
|
|
# Some situations of this kind are standard in latex generally; others
|
|
# occur with particular macro packages or with particular
|
|
# postprocessors.
|
|
#
|
|
# The correct criterion for whether a source is out-of-date is
|
|
# therefore NOT that its modification time is later than the
|
|
# destination file, but whether the contents of the source file have
|
|
# changed since the last successful run. This also handles the case
|
|
# that the user undoes some changes to a source file by replacing the
|
|
# source file by reverting to an earlier version, which may well have
|
|
# an older time stamp. Since a direct comparison of old and new files
|
|
# would involve storage and access of a large number of backup files,
|
|
# we instead use the md5 signature of the files. (Previous versions
|
|
# of latexmk used the backup file method, but restricted to the case
|
|
# of .aux and .idx files, sufficient for most, but not all,
|
|
# situations.)
|
|
#
|
|
# We will have a database of (time, size, md5) for the relevant
|
|
# files. If the time and size of a file haven't changed, then the file
|
|
# is assumed not to have changed; this saves us from having to
|
|
# determine its md5 signature, which would involve reading the whole
|
|
# file, which is naturally time-consuming, especially if network file
|
|
# access to a server is needed, and many files are involved, when most
|
|
# of them don't change. It is of course possible to change a file
|
|
# without changing its size, but then to adjust its timestamp
|
|
# to what it was previously; this requires a certain amount of
|
|
# perversity. We can safely assume that if the user edits a file or
|
|
# changes its contents, then the file's timestamp changes. The
|
|
# interesting case is that the timestamp does change, because the file
|
|
# has actually been written to, but that the contents do not change;
|
|
# it is for this that we use the md5 signature. However, since
|
|
# computing the md5 signature involves reading the whole file, which
|
|
# may be large, we should avoid computing it more than necessary.
|
|
#
|
|
# So we get the following structure:
|
|
#
|
|
# 1. For each relevant run (latex, pdflatex, each instance of a
|
|
# custom dependency) we have a database of the state of the
|
|
# source files that were last used by the run.
|
|
# 2. On an initial startup, the database for a primary tex file
|
|
# is read that was created by a previous run of latex or
|
|
# pdflatex, if this exists.
|
|
# 3. If the file doesn't exist, then the criterion for
|
|
# out-of-dateness for an initial run is that it goes by file
|
|
# timestamps, as in previous versions of latexmk, with due
|
|
# (dis)regard to those files that are known to be generated by
|
|
# latex and re-read on the next run.
|
|
# 4. Immediately before a run, the database is updated to
|
|
# represent the current conditions of the run's source files.
|
|
# 5. After the run, it is determined whether any of the source
|
|
# files have changed. This covers both files written by the
|
|
# run, which are therefore in a dependency loop, and files that
|
|
# the user may have updated during the run. (The last often
|
|
# happens when latex takes a long time, for a big document,
|
|
# and the user makes edits before latex has finished. This is
|
|
# particularly prevalent when latexmk is used with
|
|
# preview-continuous mode.)
|
|
# 6. In the case of latex or pdflatex, the custom dependencies
|
|
# must also be checked and redone if out-of-date.
|
|
# 7. If any source files have changed, the run is redone,
|
|
# starting at step 1.
|
|
# 8. There is naturally a limit on the number of reruns, to avoid
|
|
# infinite loops from bugs and from pathological or unforeseen
|
|
# conditions.
|
|
# 9. After the run is done, the run's file database is updated.
|
|
# (By hypothesis, the sizes and md5s are correct, if the run
|
|
# is successful.)
|
|
# 10. To allow reuse of data from previous runs, the file database
|
|
# is written to a file after every complete set of passes
|
|
# through latex or pdflatex. (Note that there is separate
|
|
# information for latex and pdflatex; the necessary
|
|
# information won't coincide: Out-of-dateness for the files
|
|
# for each program concerns the properties of the files when
|
|
# the other program was run, and the set of source files could
|
|
# be different, e.g., for graphics files.)
|
|
#
|
|
# We therefore maintain the following data structures.:
|
|
#
|
|
# a. For each run (latex, pdflatex, each custom dependency) a
|
|
# database is maintained. This is a hash from filenames to a
|
|
# reference to an array: [time, size, md5]. The semantics of
|
|
# the database is that it represents the state of the source
|
|
# files used in the run. During a run it represents the state
|
|
# immediately before the run; after a run, with all reruns, it
|
|
# represents the state of the files used, modified by having
|
|
# the latest timestamps for generated files.
|
|
# b. There is a global database for all files, which represents
|
|
# the current state. This saves having to recompute the md5
|
|
# signatures of a changed file used in more than one run
|
|
# (e.g., latex and pdflatex).
|
|
# c. Each of latex and pdflatex has a list of the relevant custom
|
|
# dependencies.
|
|
#
|
|
# In all the following a fdb-hash is a hash of the form:
|
|
# filename -> [time, size, md5]
|
|
# If a file is found to disappear, its entry is removed from the hash.
|
|
# In returns from fdb access routines, a size entry of -1 indicates a
|
|
# non-existent file.
|
|
|
|
|
|
# List of known rules. Rule types: primary,
|
|
# external (calls program), internal (calls routine), cusdep.
|
|
|
|
%possible_primaries = ( 'latex' => 'primary', 'pdflatex' => 'primary',
|
|
'lualatex' => 'primary', 'xelatex' => 'primary' );
|
|
%primaries = (); # Hash of rules for primary part of make. Keys are
|
|
# currently 'latex', 'pdflatex' or both; also 'lualatex'
|
|
# and 'xelatex'. Value is currently irrelevant.
|
|
# Use hash for ease of lookup
|
|
# Make remove this later, if use rdb_makeB
|
|
|
|
# Hashes, whose keys give names of particular kinds of rule. We use
|
|
# hashes for ease of lookup.
|
|
%possible_one_time = ( 'view' => 1, 'print' => 1, 'update_view' => 1, );
|
|
%requested_filerules = (); # Hash for rules corresponding to requested files.
|
|
# The keys are the rulenames and the value is
|
|
# currently irrelevant.
|
|
%one_time = (); # Hash for requested one-time-only rules, currently
|
|
# possible values 'print' and 'view'.
|
|
|
|
|
|
%rule_db = (); # Database of all rules:
|
|
# Hash: rulename -> [array of rule data]
|
|
# Rule data:
|
|
# 0: [ cmd_type, ext_cmd, int_cmd, test_kind,
|
|
# source, dest, base,
|
|
# out_of_date, out_of_date_user,
|
|
# time_of_last_run, time_of_last_file_check,
|
|
# changed
|
|
# last_result, last_message,
|
|
# default_extra_generated
|
|
# ]
|
|
# where
|
|
# cmd_type is 'primary', 'external', or 'cusdep'
|
|
# ext_cmd is string for associated external command
|
|
# with substitutions (%D for destination, %S
|
|
# for source, %B for base of current rule,
|
|
# %R for base of primary tex file, %T for
|
|
# texfile name, %O for options,
|
|
# %Y for $aux_dir1, and %Z for $out_dir1
|
|
# int_cmd specifies any internal command to be
|
|
# used to implement the application of the
|
|
# rule. If this is present, it overrides
|
|
# the external command, and it is the
|
|
# responsibility of the perl subroutine
|
|
# specified in intcmd to execute the
|
|
# external command if this is appropriate.
|
|
# This variable intcmd is a reference to an array,
|
|
# $$intcmd[0] = internal routine
|
|
# $$intcmd[1...] = its arguments (if any)
|
|
# test_kind specifies method of determining
|
|
# whether a file is out-of-date:
|
|
# 0 for never
|
|
# 1 for usual: whether there is a source
|
|
# file change
|
|
# 2 for dest earlier than source
|
|
# 3 for method 2 at first run, 1 thereafter
|
|
# (used when don't have file data from
|
|
# previous run).
|
|
# source = name of primary source file, if any
|
|
# dest = name of primary destination file,
|
|
# if any
|
|
# base = base name, if any, of files for
|
|
# this rule
|
|
# out_of_date = 1 if it has been detected that
|
|
# this rule needs to be run
|
|
# (typically because a source
|
|
# file has changed).
|
|
# 0 otherwise
|
|
# out_of_date_user is like out_of_date, except
|
|
# that the detection of out-of-dateness
|
|
# has been made from a change of a
|
|
# putative user file, i.e., one that is
|
|
# not a generated file (e.g., aux). This
|
|
# kind of out-of-dateness should provoke a
|
|
# rerun whether or not there was an error
|
|
# during a run of (pdf)LaTeX. Normally,
|
|
# if there is an error, one should wait
|
|
# for the user to correct the error. But
|
|
# it is possible the error condition is
|
|
# already corrected during the run, e.g.,
|
|
# by the user changing a source file in
|
|
# response to an error message.
|
|
# time_of_last_run = time that this rule was
|
|
# last applied. (In standard units
|
|
# from perl, to be directly compared
|
|
# with file modification times.)
|
|
# time_of_last_file_check = last time that a check
|
|
# was made for changes in source files.
|
|
# changed flags whether special changes have been made
|
|
# that require file-existence status to be ignored
|
|
# last_result is
|
|
# -1 if no run has been made,
|
|
# 0 if the last run was successful
|
|
# 1 if last run was successful, but
|
|
# failed to create an output file
|
|
# 2 if last run failed
|
|
# 200 if last run gave a warning that is
|
|
# important enough to be reported with
|
|
# the error summary. The warning
|
|
# message is stored in last_message.
|
|
# last_message is error message for last run
|
|
# default_extra_generated is a reference to an array
|
|
# of specifications of extra generated files (beyond
|
|
# the main dest file. Standard place holders are used.
|
|
# Example ['%Y%R.log'] for (pdf)latex, and ['%R.blg']
|
|
# for bibtex. (There's no need for '%R.aux', here,
|
|
# since such generated files are detected dynamically.)
|
|
# 1: {Hash sourcefile -> [source-file data] }
|
|
# Source-file data array:
|
|
# 0: time
|
|
# 1: size
|
|
# 2: md5
|
|
# 3: name of rule to make this file
|
|
# 4: whether the file is of the kind made by epstopdf.sty
|
|
# during a primary run. It will have been read during
|
|
# the run, so that even though the file changes during
|
|
# a primary run, there is no need to trigger another
|
|
# run because of this.
|
|
# Size and md5 correspond to the values at the last run.
|
|
# But time may be updated to correspond to the time
|
|
# for the file, if the file is otherwise unchanged.
|
|
# This saves excessive md5 calculations, which would
|
|
# otherwise be done everytime the file is checked,
|
|
# in the following situation:
|
|
# When the file has been rewritten after a run
|
|
# has started (commonly aux, bbl files etc),
|
|
# but the actual file contents haven't
|
|
# changed. Then because the filetime has
|
|
# changed, on every file-change check latexmk
|
|
# would normally redo the md5 calculation to
|
|
# test for actual changes. Once one such
|
|
# check is done, and the contents are
|
|
# unchanged, later checks are superfluous, and
|
|
# can be avoided by changing the file's time
|
|
# in the source-file list.
|
|
# 2: {Hash generated_file -> 1 }
|
|
# This lists all generated files; the values
|
|
# are currently unused, only the keys
|
|
|
|
%fdb_current = (); # Fdb-hash for all files used.
|
|
|
|
|
|
# User's home directory
|
|
$HOME = '';
|
|
if (exists $ENV{'HOME'} ) {
|
|
$HOME = $ENV{'HOME'};
|
|
}
|
|
elsif (exists $ENV{'USERPROFILE'} ) {
|
|
$HOME = $ENV{'USERPROFILE'};
|
|
}
|
|
# XDG configuration home
|
|
$XDG_CONFIG_HOME = '';
|
|
if (exists $ENV{'XDG_CONFIG_HOME'} ) {
|
|
$XDG_CONFIG_HOME = $ENV{'XDG_CONFIG_HOME'};
|
|
}
|
|
elsif ($HOME ne '') {
|
|
if ( -d "$HOME/.config") {
|
|
$XDG_CONFIG_HOME = "$HOME/.config";
|
|
}
|
|
}
|
|
|
|
|
|
#==================================================
|
|
|
|
# Options that are to be obeyed before rc files are read:
|
|
|
|
foreach $_ ( @ARGV )
|
|
{
|
|
if (/^-{1,2}norc$/ ) {
|
|
$auto_rc_use = 0;
|
|
}
|
|
}
|
|
|
|
#==================================================
|
|
## Read rc files with this subroutine
|
|
|
|
sub read_first_rc_file_in_list {
|
|
foreach my $rc_file ( @_ ) {
|
|
#print "===Testing for rc file \"$rc_file\" ...\n";
|
|
if ( -d $rc_file ) {
|
|
warn "$My_name: I have found a DIRECTORY named \"$rc_file\".\n",
|
|
" Have you perhaps misunderstood latexmk's documentation?\n",
|
|
" This name is normally used for a latexmk configuration (rc) file,\n",
|
|
" and in that case it should be a regular text file, not a directory.\n";
|
|
}
|
|
elsif ( -e $rc_file ) {
|
|
#print "===Reading rc file \"$rc_file\" ...\n";
|
|
process_rc_file( $rc_file );
|
|
return;
|
|
}
|
|
}
|
|
}
|
|
|
|
# Note that each rc file may unset $auto_rc_use to
|
|
# prevent lower-level rc files from being read.
|
|
# So test on $auto_rc_use in each case.
|
|
if ( $auto_rc_use ) {
|
|
# System rc file:
|
|
read_first_rc_file_in_list( @rc_system_files );
|
|
}
|
|
if ( $auto_rc_use && ($HOME ne "" ) ) {
|
|
# User rc file:
|
|
@user_rc = ();
|
|
if ( $XDG_CONFIG_HOME ) {
|
|
push @user_rc, "$XDG_CONFIG_HOME/latexmk/latexmkrc";
|
|
}
|
|
# N.B. $HOME equals "" if latexmk couldn't determine a home directory.
|
|
# In that case, we shouldn't look for an rc file there.
|
|
if ( $HOME ) {
|
|
push @user_rc, "$HOME/.latexmkrc";
|
|
}
|
|
read_first_rc_file_in_list( @user_rc );
|
|
}
|
|
if ( $auto_rc_use ) {
|
|
# Rc file in current directory:
|
|
read_first_rc_file_in_list( "latexmkrc", ".latexmkrc" );
|
|
}
|
|
|
|
## Process command line args.
|
|
@command_line_file_list = ();
|
|
$bad_options = 0;
|
|
|
|
while ($_ = $ARGV[0])
|
|
{
|
|
# Make -- and - equivalent at beginning of option,
|
|
# but save original for possible use in (pdf)latex command line
|
|
$original = $_;
|
|
s/^--/-/;
|
|
shift;
|
|
if ( /^-aux-directory=(.*)$/ || /^-auxdir=(.*)$/ ) {
|
|
$aux_dir = $1;
|
|
}
|
|
elsif (/^-bibtex$/) { $bibtex_use = 2; }
|
|
elsif (/^-bibtex-$/) { $bibtex_use = 0; }
|
|
elsif (/^-nobibtex$/) { $bibtex_use = 0; }
|
|
elsif (/^-bibtex-cond$/) { $bibtex_use = 1; }
|
|
elsif (/^-c$/) { $cleanup_mode = 2; $cleanup_fdb = 1; $cleanup_only = 1; }
|
|
elsif (/^-C$/ || /^-CA$/ ) { $cleanup_mode = 1; $cleanup_fdb = 1; $cleanup_only = 1; }
|
|
elsif (/^-CF$/) { $cleanup_fdb = 1; }
|
|
elsif (/^-cd$/) { $do_cd = 1; }
|
|
elsif (/^-cd-$/) { $do_cd = 0; }
|
|
elsif (/^-commands$/) { &print_commands; exit; }
|
|
elsif (/^-d$/) { $banner = 1; }
|
|
elsif (/^-dependents$/ || /^-deps$/ || /^-M$/ ) { $dependents_list = 1; }
|
|
elsif (/^-nodependents$/ || /^-dependents-$/ || /^-deps-$/) { $dependents_list = 0; }
|
|
elsif (/^-deps-out=(.*)$/) {
|
|
$deps_file = $1;
|
|
$dependents_list = 1;
|
|
}
|
|
elsif (/^-diagnostics/) { $diagnostics = 1; }
|
|
elsif (/^-dvi$/) { $dvi_mode = 1; }
|
|
elsif (/^-dvi-$/) { $dvi_mode = 0; }
|
|
elsif (/^-f$/) { $force_mode = 1; }
|
|
elsif (/^-f-$/) { $force_mode = 0; }
|
|
elsif (/^-g$/) { $go_mode = 1; }
|
|
elsif (/^-g-$/) { $go_mode = 0; }
|
|
elsif (/^-gg$/) {
|
|
$go_mode = 2; $cleanup_mode = 1; $cleanup_fdb = 1; $cleanup_only = 0;
|
|
}
|
|
elsif ( /^-h$/ || /^-help$/ ) { &print_help; exit;}
|
|
elsif (/^-jobname=(.*)$/) {
|
|
$jobname = $1;
|
|
}
|
|
elsif (/^-l$/) { $landscape_mode = 1; }
|
|
elsif (/^-l-$/) { $landscape_mode = 0; }
|
|
elsif (/^-latex=(.*)$/) {
|
|
$latex = $1;
|
|
}
|
|
elsif (/^-latexoption=(.*)$/) {
|
|
push @extra_latex_options, $1;
|
|
push @extra_pdflatex_options, $1;
|
|
push @extra_lualatex_options, $1;
|
|
push @extra_xelatex_options, $1;
|
|
}
|
|
elsif ( /^-logfilewarninglist$/ || /^-logfilewarnings$/ )
|
|
{ $silence_logfile_warnings = 0; }
|
|
elsif ( /^-logfilewarninglist-$/ || /^-logfilewarnings-$/ )
|
|
{ $silence_logfile_warnings = 1; }
|
|
# See above for -M
|
|
elsif (/^-MF$/) {
|
|
if ( $ARGV[0] eq '' ) {
|
|
&exit_help( "No file name specified after -MF switch");
|
|
}
|
|
$deps_file = $ARGV[0];
|
|
shift;
|
|
}
|
|
elsif ( /^-MP$/ ) { $dependents_phony = 1; }
|
|
elsif (/^-new-viewer$/) {
|
|
$new_viewer_always = 1;
|
|
}
|
|
elsif (/^-new-viewer-$/) {
|
|
$new_viewer_always = 0;
|
|
}
|
|
elsif (/^-norc$/ ) {
|
|
$auto_rc_use = 0;
|
|
# N.B. This has already been obeyed.
|
|
}
|
|
elsif ( /^-output-directory=(.*)$/ ||/^-outdir=(.*)$/ ) {
|
|
$out_dir = $1;
|
|
}
|
|
elsif (/^-p$/) { $printout_mode = 1;
|
|
$preview_continuous_mode = 0; # to avoid conflicts
|
|
$preview_mode = 0;
|
|
}
|
|
elsif (/^-p-$/) { $printout_mode = 0; }
|
|
elsif (/^-pdf$/) { $pdf_mode = 1; }
|
|
elsif (/^-pdf-$/) { $pdf_mode = 0; }
|
|
elsif (/^-pdfdvi$/){ $pdf_mode = 3; }
|
|
elsif (/^-pdflua$/){ $pdf_mode = 4; }
|
|
elsif (/^-pdfxe$/) { $pdf_mode = 5; }
|
|
# elsif (/^-pdflatex$/) {
|
|
# $pdflatex = "pdflatex %O %S";
|
|
# $pdf_mode = 1;
|
|
# $dvi_mode = $postscript_mode = 0;
|
|
# }
|
|
elsif (/^-pdflatex=(.*)$/) {
|
|
$pdflatex = $1;
|
|
}
|
|
elsif (/^-pdfps$/) { $pdf_mode = 2; }
|
|
elsif (/^-print=(.*)$/) {
|
|
$value = $1;
|
|
if ( $value =~ /^dvi$|^ps$|^pdf$|^auto$/ ) {
|
|
$print_type = $value;
|
|
$printout_mode = 1;
|
|
}
|
|
else {
|
|
&exit_help("$My_name: unknown print type '$value' in option '$_'");
|
|
}
|
|
}
|
|
elsif (/^-ps$/) { $postscript_mode = 1; }
|
|
elsif (/^-ps-$/) { $postscript_mode = 0; }
|
|
elsif (/^-pv$/) { $preview_mode = 1;
|
|
$preview_continuous_mode = 0; # to avoid conflicts
|
|
$printout_mode = 0;
|
|
}
|
|
elsif (/^-pv-$/) { $preview_mode = 0; }
|
|
elsif (/^-pvc$/) { $preview_continuous_mode = 1;
|
|
$force_mode = 0; # So that errors do not cause loops
|
|
$preview_mode = 0; # to avoid conflicts
|
|
$printout_mode = 0;
|
|
}
|
|
elsif (/^-pvc-$/) { $preview_continuous_mode = 0; }
|
|
elsif (/^-recorder$/ ){ $recorder = 1; }
|
|
elsif (/^-recorder-$/ ){ $recorder = 0; }
|
|
elsif (/^-rules$/ ) { $rules_list = 1; }
|
|
elsif (/^-norules$/ || /^-rules-$/ ) { $rules_list = 0; }
|
|
elsif (/^-showextraoptions$/) {
|
|
print "List of extra latex and pdflatex options recognized by $my_name.\n",
|
|
"These are passed as is to (pdf)latex. They may not be recognized by\n",
|
|
"particular versions of (pdf)latex. This list is a combination of those\n",
|
|
"for TeXLive and MikTeX.\n",
|
|
"\n",
|
|
"Note that in addition to the options in this list, there are several\n",
|
|
"options known to the (pdf)latex programs that are also recognized by\n",
|
|
"latexmk and trigger special behavior by latexmk. Since these options\n",
|
|
"appear in the main list given by running 'latexmk --help', they do not\n",
|
|
"appear in the following list\n",
|
|
"NOTE ALSO: Not all of these options are supported by all versions of (pdf)latex.\n",
|
|
"\n";
|
|
foreach $option ( sort( keys %allowed_latex_options, keys %allowed_latex_options_with_arg ) ) {
|
|
if (exists $allowed_latex_options{$option} ) { print " $allowed_latex_options{$option}\n"; }
|
|
if (exists $allowed_latex_options_with_arg{$option} ) { print " $allowed_latex_options_with_arg{$option}\n"; }
|
|
}
|
|
exit;
|
|
}
|
|
elsif (/^-silent$/ || /^-quiet$/ ){ $silent = 1; }
|
|
elsif (/^-time$/) { $show_time = 1;}
|
|
elsif (/^-time-$/) { $show_time = 0;}
|
|
elsif (/^-use-make$/) { $use_make_for_missing_files = 1; }
|
|
elsif (/^-use-make-$/) { $use_make_for_missing_files = 0; }
|
|
elsif (/^-v$/ || /^-version$/) {
|
|
print "\n$version_details. Version $version_num\n";
|
|
exit;
|
|
}
|
|
elsif (/^-verbose$/) { $silent = 0; }
|
|
elsif (/^-view=default$/) { $view = "default";}
|
|
elsif (/^-view=dvi$/) { $view = "dvi";}
|
|
elsif (/^-view=none$/) { $view = "none";}
|
|
elsif (/^-view=ps$/) { $view = "ps";}
|
|
elsif (/^-view=pdf$/) { $view = "pdf"; }
|
|
elsif (/^-lualatex$/) {
|
|
$pdf_mode = 4;
|
|
$dvi_mode = $postscript_mode = 0;
|
|
}
|
|
elsif (/^-xelatex$/) {
|
|
$pdf_mode = 5;
|
|
$dvi_mode = $postscript_mode = 0;
|
|
}
|
|
elsif (/^-e$/) {
|
|
if ( $#ARGV < 0 ) {
|
|
&exit_help( "No code to execute specified after -e switch");
|
|
}
|
|
execute_code_string( $ARGV[0] );
|
|
shift;
|
|
}
|
|
elsif (/^-r$/) {
|
|
if ( $ARGV[0] eq '' ) {
|
|
&exit_help( "No RC file specified after -r switch");
|
|
}
|
|
if ( -e $ARGV[0] ) {
|
|
process_rc_file( $ARGV[0] );
|
|
}
|
|
else {
|
|
die "$My_name: RC file [$ARGV[0]] does not exist\n";
|
|
}
|
|
shift;
|
|
}
|
|
elsif (/^-bm$/) {
|
|
if ( $ARGV[0] eq '' ) {
|
|
&exit_help( "No message specified after -bm switch");
|
|
}
|
|
$banner = 1; $banner_message = $ARGV[0];
|
|
shift;
|
|
}
|
|
elsif (/^-bi$/) {
|
|
if ( $ARGV[0] eq '' ) {
|
|
&exit_help( "No intensity specified after -bi switch");
|
|
}
|
|
$banner_intensity = $ARGV[0];
|
|
shift;
|
|
}
|
|
elsif (/^-bs$/) {
|
|
if ( $ARGV[0] eq '' ) {
|
|
&exit_help( "No scale specified after -bs switch");
|
|
}
|
|
$banner_scale = $ARGV[0];
|
|
shift;
|
|
}
|
|
elsif (/^-dF$/) {
|
|
if ( $ARGV[0] eq '' ) {
|
|
&exit_help( "No dvi filter specified after -dF switch");
|
|
}
|
|
$dvi_filter = $ARGV[0];
|
|
shift;
|
|
}
|
|
elsif (/^-pF$/) {
|
|
if ( $ARGV[0] eq '' ) {
|
|
&exit_help( "No ps filter specified after -pF switch");
|
|
}
|
|
$ps_filter = $ARGV[0];
|
|
shift;
|
|
}
|
|
elsif ( ( exists( $allowed_latex_options{$_} ) )
|
|
|| ( /^(-.+)=/ && exists( $allowed_latex_options_with_arg{$1} ) )
|
|
)
|
|
{
|
|
push @extra_latex_options, $original;
|
|
push @extra_pdflatex_options, $original;
|
|
push @extra_lualatex_options, $original;
|
|
push @extra_xelatex_options, $original;
|
|
}
|
|
elsif (/^-/) {
|
|
warn "$My_name: $_ bad option\n";
|
|
$bad_options++;
|
|
}
|
|
else {
|
|
push @command_line_file_list, $_ ;
|
|
}
|
|
}
|
|
|
|
if ( $bad_options > 0 ) {
|
|
&exit_help( "Bad options specified" );
|
|
}
|
|
|
|
warn "$My_name: This is $version_details, version: $version_num.\n",
|
|
unless $silent;
|
|
|
|
if ( ($out_dir ne '') && ($aux_dir eq '') ){
|
|
$aux_dir = $out_dir;
|
|
}
|
|
|
|
# Versions terminating in directory/path separator
|
|
$out_dir1 = $out_dir;
|
|
$aux_dir1 = $aux_dir;
|
|
foreach ( $aux_dir1, $out_dir1 ) {
|
|
if ( ($_ ne '') && ! m([\\/\:]$) ) {
|
|
$_ .= '/';
|
|
}
|
|
}
|
|
|
|
# At least one widely package (revtex4-1) generates a bib file
|
|
# (which is used in revtex4-1 for putting footnotes in the reference
|
|
# list), and bibtex must be run to use it. But latexmk needs to
|
|
# determine the existence of the bib file by use of kpsewhich, otherwise
|
|
# there is an error. So cope with this situation (and any analogous
|
|
# cases by adding the aux_dir to the relevant path search environment
|
|
# variables. BIBINPUTS seems to be the only one currently affected.
|
|
foreach ( 'BIBINPUTS' ) {
|
|
if ( exists $ENV{$_} ) {
|
|
$ENV{$_} = $aux_dir.$search_path_separator.$ENV{$_};
|
|
}
|
|
else {
|
|
$ENV{$_} = $aux_dir.$search_path_separator;
|
|
}
|
|
}
|
|
|
|
|
|
if ($bibtex_use > 1) {
|
|
push @generated_exts, 'bbl';
|
|
}
|
|
|
|
# For backward compatibility, convert $texfile_search to @default_files
|
|
# Since $texfile_search is initialized to "", a nonzero value indicates
|
|
# that an initialization file has set it.
|
|
if ( $texfile_search ne "" ) {
|
|
@default_files = split /\s+/, "*.tex $texfile_search";
|
|
}
|
|
|
|
#Glob the filenames command line if the script was not invoked under a
|
|
# UNIX-like environment.
|
|
# Cases: (1) MS/MSwin native Glob
|
|
# (OS detected as MSWin32)
|
|
# (2) MS/MSwin cygwin Glob [because we do not know whether
|
|
# the cmd interpreter is UNIXy (and does glob) or is
|
|
# native MS-Win (and does not glob).]
|
|
# (OS detected as cygwin)
|
|
# (3) UNIX Don't glob (cmd interpreter does it)
|
|
# (Currently, I assume this is everything else)
|
|
if ( ($^O eq "MSWin32") || ($^O eq "cygwin") ) {
|
|
# Preserve ordering of files
|
|
@file_list = glob_list1(@command_line_file_list);
|
|
#print "A1:File list:\n";
|
|
#for ($i = 0; $i <= $#file_list; $i++ ) { print "$i: '$file_list[$i]'\n"; }
|
|
}
|
|
else {
|
|
@file_list = @command_line_file_list;
|
|
}
|
|
@file_list = uniq1( @file_list );
|
|
|
|
|
|
# Check we haven't selected mutually exclusive modes.
|
|
# Note that -c overrides all other options, but doesn't cause
|
|
# an error if they are selected.
|
|
if (($printout_mode && ( $preview_mode || $preview_continuous_mode ))
|
|
|| ( $preview_mode && $preview_continuous_mode ))
|
|
{
|
|
# Each of the options -p, -pv, -pvc turns the other off.
|
|
# So the only reason to arrive here is an incorrect inititalization
|
|
# file, or a bug.
|
|
&exit_help( "Conflicting options (print, preview, preview_continuous) selected");
|
|
}
|
|
|
|
if ( @command_line_file_list ) {
|
|
# At least one file specified on command line (before possible globbing).
|
|
if ( !@file_list ) {
|
|
&exit_help( "Wildcards in file names didn't match any files");
|
|
}
|
|
}
|
|
else {
|
|
# No files specified on command line, try and find some
|
|
# Evaluate in order specified. The user may have some special
|
|
# for wanting processing in a particular order, especially
|
|
# if there are no wild cards.
|
|
# Preserve ordering of files
|
|
my @file_list1 = uniq1( glob_list1(@default_files) );
|
|
my @excluded_file_list = uniq1( glob_list1(@default_excluded_files) );
|
|
# Make hash of excluded files, for easy checking:
|
|
my %excl = ();
|
|
foreach my $file (@excluded_file_list) {
|
|
$excl{$file} = '';
|
|
}
|
|
foreach my $file (@file_list1) {
|
|
push( @file_list, $file) unless ( exists $excl{$file} );
|
|
}
|
|
if ( !@file_list ) {
|
|
&exit_help( "No file name specified, and I couldn't find any");
|
|
}
|
|
}
|
|
|
|
$num_files = $#file_list + 1;
|
|
$num_specified = $#command_line_file_list + 1;
|
|
|
|
#print "Command line file list:\n";
|
|
#for ($i = 0; $i <= $#command_line_file_list; $i++ ) { print "$i: '$command_line_file_list[$i]'\n"; }
|
|
#print "File list:\n";
|
|
#for ($i = 0; $i <= $#file_list; $i++ ) { print "$i: '$file_list[$i]'\n"; }
|
|
|
|
|
|
# If selected a preview-continuous mode, make sure exactly one filename was specified
|
|
if ($preview_continuous_mode && ($num_files != 1) ) {
|
|
if ($num_specified > 1) {
|
|
&exit_help(
|
|
"Need to specify exactly one filename for ".
|
|
"preview-continuous mode\n".
|
|
" but $num_specified were specified"
|
|
);
|
|
}
|
|
elsif ($num_specified == 1) {
|
|
&exit_help(
|
|
"Need to specify exactly one filename for ".
|
|
"preview-continuous mode\n".
|
|
" but wildcarding produced $num_files files"
|
|
);
|
|
}
|
|
else {
|
|
&exit_help(
|
|
"Need to specify exactly one filename for ".
|
|
"preview-continuous mode.\n".
|
|
" Since none were specified on the command line, I looked for \n".
|
|
" files in '@default_files'.\n".
|
|
" But I found $num_files files, not 1."
|
|
);
|
|
}
|
|
}
|
|
|
|
# If selected jobname, can only apply that to one file:
|
|
if ( ($jobname ne '') && ($num_files > 1) ) {
|
|
&exit_help(
|
|
"Need to specify at most one filename if ".
|
|
"jobname specified, \n".
|
|
" but $num_files were found (after defaults and wildcarding)."
|
|
);
|
|
}
|
|
|
|
|
|
# Normalize the commands, to have place-holders for source, dest etc:
|
|
&fix_cmds;
|
|
|
|
# Add common options
|
|
add_option( $latex_default_switches, \$latex );
|
|
add_option( $pdflatex_default_switches, \$pdflatex );
|
|
add_option( $lualatex_default_switches, \$lualatex );
|
|
add_option( $xelatex_default_switches, \$xelatex );
|
|
|
|
foreach (@extra_latex_options) { add_option( $_, \$latex ); }
|
|
foreach (@extra_pdflatex_options) { add_option( $_, \$pdflatex ); }
|
|
foreach (@extra_lualatex_options) { add_option( $_, \$lualatex ); }
|
|
foreach (@extra_xelatex_options) { add_option( $_, \$xelatex ); }
|
|
|
|
|
|
# If landscape mode, change dvips processor, and the previewers:
|
|
if ( $landscape_mode )
|
|
{
|
|
$dvips = $dvips_landscape;
|
|
$dvi_previewer = $dvi_previewer_landscape;
|
|
$ps_previewer = $ps_previewer_landscape;
|
|
}
|
|
|
|
if ( $silent ) {
|
|
add_option( "$latex_silent_switch", \$latex );
|
|
add_option( "$pdflatex_silent_switch", \$pdflatex );
|
|
add_option( "$lualatex_silent_switch", \$lualatex );
|
|
add_option( "$xelatex_silent_switch", \$xelatex );
|
|
add_option( "$biber_silent_switch", \$biber );
|
|
add_option( "$bibtex_silent_switch", \$bibtex );
|
|
add_option( "$makeindex_silent_switch", \$makeindex );
|
|
add_option( "$dvipdf_silent_switch", \$dvipdf );
|
|
add_option( "$dvips_silent_switch", \$dvips );
|
|
add_option( "$xdvipdfmx_silent_switch", \$xdvipdfmx );
|
|
}
|
|
|
|
if ( $recorder ) {
|
|
add_option( "-recorder", \$latex, \$pdflatex, \$lualatex, \$xelatex );
|
|
}
|
|
|
|
# If the output and/or aux directories are specified, fix the (pdf)latex
|
|
# commands to use them.
|
|
# N.B. We'll ensure that the directories actually exist only after a
|
|
# possible cd to the document directory, since the directories can be
|
|
# relative to the document.
|
|
|
|
if ( $out_dir ) {
|
|
add_option( "-output-directory=\"$out_dir\"",
|
|
\$latex, \$pdflatex, \$lualatex, \$xelatex );
|
|
}
|
|
if ( $aux_dir && ($aux_dir ne $out_dir) ) {
|
|
# N.B. If $aux_dir and $out_dir are the same, then the -output-directory
|
|
# option is sufficient, especially because the -aux-directory exists
|
|
# only in MiKTeX, not in TeXLive.
|
|
add_option( "-aux-directory=\"$aux_dir\"",
|
|
\$latex, \$pdflatex, \$lualatex, \$xelatex );
|
|
}
|
|
|
|
if ( $jobname ne '' ) {
|
|
$jobstring = "--jobname=\"$jobname\"";
|
|
add_option( "$jobstring", \$latex, \$lualatex, \$pdflatex, \$xelatex );
|
|
}
|
|
|
|
# Which kind of file do we preview?
|
|
if ( $view eq "default" ) {
|
|
# If default viewer requested, use "highest" of dvi, ps and pdf
|
|
# that was requested by user.
|
|
# No explicit request means view dvi.
|
|
$view = "dvi";
|
|
if ( $postscript_mode ) { $view = "ps"; }
|
|
if ( $pdf_mode ) { $view = "pdf"; }
|
|
}
|
|
|
|
# Make sure we make the kind of file we want to view:
|
|
if ($view eq 'dvi') { $dvi_mode = 1; }
|
|
if ($view eq 'ps') { $postscript_mode = 1; }
|
|
if ( ($view eq 'pdf') && ($pdf_mode == 0) ) {
|
|
$pdf_mode = 1;
|
|
}
|
|
|
|
# Make sure that we make something if all requests are turned off
|
|
if ( ! ( $dvi_mode || $pdf_mode || $postscript_mode || $printout_mode) ) {
|
|
print "No specific requests made, so default to dvi by latex\n";
|
|
$dvi_mode = 1;
|
|
}
|
|
|
|
# Set new-style requested rules:
|
|
if ( $dvi_mode ) { $requested_filerules{'latex'} = 1; }
|
|
if ( $pdf_mode == 1 ) { $requested_filerules{'pdflatex'} = 1; }
|
|
elsif ( $pdf_mode == 2 ) {
|
|
$requested_filerules{'latex'} = 1;
|
|
$requested_filerules{'dvips'} = 1;
|
|
$requested_filerules{'ps2pdf'} = 1;
|
|
}
|
|
elsif ( $pdf_mode == 3 ) {
|
|
$requested_filerules{'latex'} = 1;
|
|
$requested_filerules{'dvipdf'} = 1;
|
|
}
|
|
elsif ( $pdf_mode == 4 ) {
|
|
$requested_filerules{'lualatex'} = 1;
|
|
}
|
|
elsif ( $pdf_mode == 5 ) {
|
|
$requested_filerules{'xelatex'} = 1;
|
|
$requested_filerules{'xdvipdfmx'} = 1;
|
|
}
|
|
if ( $postscript_mode ) {
|
|
$requested_filerules{'latex'} = 1;
|
|
$requested_filerules{'dvips'} = 1;
|
|
}
|
|
if ($print_type eq 'auto') {
|
|
if ( $postscript_mode ) { $print_type = 'ps'; }
|
|
elsif ( $pdf_mode ) { $print_type = 'pdf'; }
|
|
elsif ( $dvi_mode ) { $print_type = 'dvi'; }
|
|
else { $print_type = 'none'; }
|
|
}
|
|
if ( $printout_mode ) {
|
|
$one_time{'print'} = 1;
|
|
if ($print_type eq 'none'){
|
|
warn "$My_name: You have requested printout, but \$print_type is set to 'none'\n";
|
|
}
|
|
}
|
|
if ( $preview_continuous_mode || $preview_mode ) { $one_time{'view'} = 1; }
|
|
if ( length($dvi_filter) != 0 ) { $requested_filerules{'dvi_filter'} = 1; }
|
|
if ( length($ps_filter) != 0 ) { $requested_filerules{'ps_filter'} = 1; }
|
|
if ( $banner ) { $requested_filerules{'dvips'} = 1; }
|
|
|
|
|
|
if ( $pdf_mode == 2 ) {
|
|
# We generate pdf from ps. Make sure we have the correct kind of ps.
|
|
add_option( "$dvips_pdf_switch", \$dvips );
|
|
}
|
|
|
|
# Note sleep has granularity of 1 second.
|
|
# Sleep periods 0 < $sleep_time < 1 give zero delay,
|
|
# which is probably not what the user intended.
|
|
# Sleep periods less than zero give infinite delay
|
|
if ( $sleep_time < 0 ) {
|
|
warn "$My_name: Correcting negative sleep_time to 1 sec.\n";
|
|
$sleep_time = 1;
|
|
}
|
|
elsif ( ($sleep_time < 1) && ( $sleep_time != 0 ) ) {
|
|
warn "$My_name: Correcting nonzero sleep_time of less than 1 sec to 1 sec.\n";
|
|
$sleep_time = 1;
|
|
}
|
|
elsif ( $sleep_time == 0 ) {
|
|
warn "$My_name: sleep_time was configured to zero.\n",
|
|
" Do you really want to do this? It will give 100% CPU usage.\n";
|
|
}
|
|
|
|
# Make convenient forms for lookup.
|
|
# Extensions always have period.
|
|
|
|
# Convert @generated_exts to a hash for ease of look up and deletion
|
|
# Keep extension without period!
|
|
%generated_exts_all = ();
|
|
foreach (@generated_exts ) {
|
|
$generated_exts_all{$_} = 1;
|
|
}
|
|
|
|
if ($aux_dir) {
|
|
# Ensure $aux_dir is in TEXINPUTS search path.
|
|
# This is used by dvips for files generated by mpost.
|
|
if ( ! exists $ENV{TEXINPUTS} ) {
|
|
# Note the trailing ":" which ensures that the last item
|
|
# in the list of paths is the empty path, which actually
|
|
# means the default path, i.e., the following means that
|
|
# the TEXINPUTS search path is $aux_dir and the standard
|
|
# value.
|
|
$ENV{TEXINPUTS} = $aux_dir.$search_path_separator;
|
|
}
|
|
elsif ( $ENV{TEXINPUTS} !~ /$aux_dir$search_path_separator/ ) {
|
|
$ENV{TEXINPUTS} = $aux_dir.$search_path_separator.$ENV{TEXINPUTS};
|
|
}
|
|
}
|
|
|
|
$quell_uptodate_msgs = $silent;
|
|
# Whether to quell informational messages when files are uptodate
|
|
# Will turn off in -pvc mode
|
|
|
|
$failure_count = 0;
|
|
@failed_primaries = ();
|
|
|
|
if ($deps_file eq '' ) {
|
|
# Standardize name used for stdout
|
|
$deps_file = '-';
|
|
}
|
|
|
|
# In non-pvc mode, the dependency list is global to all processed TeX files,
|
|
# so we open a single file here, and add items to it after processing each file
|
|
# But in -pvc mode, the dependency list should be written after round of
|
|
# processing the single TeX file (as if each round were a separate run of
|
|
# latexmk). There's undoubtedly some non-optimal structuring here!
|
|
if ( $dependents_list && ! $preview_continuous_mode ) {
|
|
$deps_handle = new FileHandle "> $deps_file";
|
|
if (! defined $deps_handle ) {
|
|
die "Cannot open '$deps_file' for output of dependency information\n";
|
|
}
|
|
}
|
|
|
|
# Remove leading and trailing space in the following space-separated lists,
|
|
# and collapse multiple spaces to one,
|
|
# to avoid getting incorrect blank items when they are split.
|
|
foreach ($clean_ext, $clean_full_ext) { s/^\s+//; s/\s+$//; s/\s+/ /g; }
|
|
|
|
|
|
FILE:
|
|
foreach $filename ( @file_list )
|
|
{
|
|
# Global variables for making of current file:
|
|
$updated = 0;
|
|
$failure = 0; # Set nonzero to indicate failure at some point of
|
|
# a make. Use value as exit code if I exit.
|
|
$failure_msg = ''; # Indicate reason for failure
|
|
|
|
if ( $do_cd ) {
|
|
($filename, $path) = fileparse( $filename );
|
|
warn "$My_name: Changing directory to '$path'\n";
|
|
pushd( $path );
|
|
}
|
|
else {
|
|
$path = '';
|
|
}
|
|
|
|
# Ensure the output/auxiliary directories exist, if need be
|
|
if ( $out_dir ) {
|
|
if ( ! -e $out_dir ) {
|
|
warn "$My_name: making output directory '$out_dir'\n"
|
|
if ! $silent;
|
|
make_path $out_dir;
|
|
}
|
|
elsif ( ! -d $out_dir ) {
|
|
warn "$My_name: you requested output directory '$out_dir',\n",
|
|
" but an ordinary file of the same name exists, which will\n",
|
|
" probably give an error later\n";
|
|
}
|
|
}
|
|
|
|
if ( $aux_dir && ($aux_dir ne $out_dir) ) {
|
|
# N.B. If $aux_dir and $out_dir are the same, then the -output-directory
|
|
# option is sufficient, especially because the -aux-directory exists
|
|
# only in MiKTeX, not in TeXLive.
|
|
if ( ! -e $aux_dir ) {
|
|
warn "$My_name: making auxiliary directory '$aux_dir'\n"
|
|
if ! $silent;
|
|
make_path $aux_dir;
|
|
}
|
|
elsif ( ! -d $aux_dir ) {
|
|
warn "$My_name: you requested aux directory '$aux_dir',\n",
|
|
" but an ordinary file of the same name exists, which will\n",
|
|
" probably give an error later\n";
|
|
}
|
|
}
|
|
|
|
## remove extension from filename if was given.
|
|
if ( find_basename($filename, $root_filename, $texfile_name) )
|
|
{
|
|
if ( $force_mode ) {
|
|
warn "$My_name: Could not find file [$texfile_name]\n";
|
|
}
|
|
else {
|
|
&ifcd_popd;
|
|
&exit_msg1( "Could not find file [$texfile_name]",
|
|
11);
|
|
}
|
|
}
|
|
if ($jobname ne '' ) {
|
|
$root_filename = $jobname;
|
|
}
|
|
|
|
$aux_main = "$aux_dir1$root_filename.aux";
|
|
$log_name = "$aux_dir1$root_filename.log";
|
|
$fdb_name = "$aux_dir1$root_filename.$fdb_ext";
|
|
|
|
# Initialize basic dependency information:
|
|
|
|
# For use under error conditions:
|
|
@default_includes = ($texfile_name, $aux_main);
|
|
|
|
# Initialize rule database.
|
|
# ?? Should I also initialize file database?
|
|
%rule_list = ();
|
|
&rdb_make_rule_list;
|
|
&rdb_set_rules( \%rule_list, \%extra_rule_spec );
|
|
|
|
if ( $cleanup_mode > 0 ) {
|
|
# ?? MAY NEED TO FIX THE FOLLOWING IF $aux_dir or $out_dir IS SET.
|
|
my %other_generated = ();
|
|
my @index_bibtex_generated = ();
|
|
my @aux_files = ();
|
|
$have_fdb = 0;
|
|
if ( -e $fdb_name ) {
|
|
print "$My_name: Examining fdb file '$fdb_name' for rules ...\n"
|
|
if $diagnostics;
|
|
$have_fdb = ( 0 == rdb_read( $fdb_name ) );
|
|
}
|
|
if ( $have_fdb ) {
|
|
rdb_for_all(
|
|
sub { # Find generated files at rule level
|
|
my ($base, $path, $ext) = fileparseA( $$Psource );
|
|
$base = $path.$base;
|
|
if ( $rule =~ /^makeindex/ ) {
|
|
push @index_bibtex_generated, $$Psource, $$Pdest, "$base.ilg";
|
|
}
|
|
elsif ( $rule =~ /^(bibtex|biber)/ ) {
|
|
push @index_bibtex_generated, $$Pdest, "$base.blg";
|
|
push @aux_files, $$Psource;
|
|
}
|
|
elsif ( exists $other_generated{$$Psource} ) {
|
|
$other_generated{$$Pdest};
|
|
}
|
|
},
|
|
sub { # Find generated files at source file level
|
|
if ( $file =~ /\.aux$/ ) { push @aux_files, $file; }
|
|
}
|
|
);
|
|
}
|
|
elsif ( -e $log_name ) {
|
|
# No fdb file, but log file exists, so do inferior job by parse_log
|
|
print "$My_name: Examining log file '$log_name' for generated files...\n"
|
|
if $diagnostics;
|
|
# Variables set by parse_log. Can I remove them?
|
|
local %generated_log = ();
|
|
local %dependents = (); # Maps files to status. Not used here.
|
|
local @bbl_files = (); # Not used here.
|
|
local %idx_files = (); # Maps idx_file to (ind_file, base). Not used here.
|
|
local %conversions = (); # (pdf)latex-performed conversions. Not used here.
|
|
# Maps output file created and read by (pdf)latex
|
|
# to source file of conversion.
|
|
local $primary_out = ''; # Actual output file (dvi or pdf). Not used here.
|
|
local $fls_file_analyzed = 0;
|
|
&parse_log;
|
|
%other_generated = %generated_log;
|
|
}
|
|
else {
|
|
print "$My_name: No fdb or log file, so clean up default set of files ...\n"
|
|
if $diagnostics;
|
|
}
|
|
|
|
if ( ($go_mode == 2) && !$silent ) {
|
|
warn "$My_name: Removing all generated files\n" unless $silent;
|
|
}
|
|
if ($bibtex_use < 2) {
|
|
delete $generated_exts_all{'bbl'};
|
|
}
|
|
# Convert two arrays to hashes:
|
|
my %index_bibtex_generated = ();
|
|
my %aux_files = ();
|
|
foreach (@index_bibtex_generated) {
|
|
$index_bibtex_generated{$_} = 1
|
|
unless ( /\.bbl$/ && ($bibtex_use < 2) );
|
|
delete( $other_generated{$_} );
|
|
}
|
|
foreach (@aux_files) {
|
|
$aux_files{$_} = 1;
|
|
delete( $other_generated{$_} );
|
|
}
|
|
if ($diagnostics) {
|
|
show_array( "For deletion, the following were determined from fdb file or log file:\n"
|
|
." Generated (from makeindex and bibtex):",
|
|
keys %index_bibtex_generated );
|
|
show_array( " Aux files:", keys %aux_files );
|
|
show_array( " Other generated files:\n"
|
|
." (only deleted if \$cleanup_includes_generated is set): ",
|
|
keys %other_generated );
|
|
show_array( " Yet other generated files:\n",
|
|
keys %generated_exts_all );
|
|
}
|
|
&cleanup1( $aux_dir1, $fdb_ext, 'blg', 'ilg', 'log', 'aux.bak', 'idx.bak',
|
|
split('\s+',$clean_ext),
|
|
keys %generated_exts_all
|
|
);
|
|
unlink_or_move( 'texput.log', "texput.aux", "missfont.log",
|
|
keys %index_bibtex_generated,
|
|
keys %aux_files );
|
|
if ( $dependents_list && ( $deps_file ne '-' ) ) {
|
|
unlink_or_move( $deps_file );
|
|
}
|
|
if ($cleanup_includes_generated) {
|
|
unlink_or_move( keys %other_generated );
|
|
}
|
|
if ( $cleanup_includes_cusdep_generated) {
|
|
&cleanup_cusdep_generated;
|
|
}
|
|
if ( $cleanup_mode == 1 ) {
|
|
&cleanup1( $out_dir1, 'dvi', 'dviF', 'ps', 'psF', 'pdf',
|
|
'synctex.gz', 'xdv',
|
|
split('\s+', $clean_full_ext)
|
|
);
|
|
}
|
|
}
|
|
if ($cleanup_fdb) {
|
|
unlink_or_move( $fdb_name );
|
|
# If the fdb file exists, it will have been read, and therefore changed
|
|
# rule database. But deleting the fdb file implies we also want
|
|
# a virgin rule database, so we must reset it:
|
|
rdb_set_rules( \%rule_list );
|
|
}
|
|
if ($cleanup_only) { next FILE; }
|
|
|
|
|
|
#??? The following are not needed if use rdb_make.
|
|
# ?? They may be set too early?
|
|
# Arrays and hashes for picking out accessible rules.
|
|
# Distinguish rules for making files and others
|
|
@accessible_all = sort ( &rdb_accessible( keys %requested_filerules, keys %one_time ));
|
|
%accessible_filerules = ();
|
|
foreach (@accessible_all) {
|
|
unless ( /view/ || /print/ ) { $accessible_filerules{$_} = 1; }
|
|
}
|
|
@accessible_filerules = sort keys %accessible_filerules;
|
|
|
|
# show_array ( "=======All rules used", @accessible_all );
|
|
# show_array ( "=======Requested file rules", sort keys %requested_filerules );
|
|
# show_array ( "=======Rules for files", @accessible_filerules );
|
|
|
|
if ( $diagnostics ) {
|
|
print "$My_name: Rules after start up for '$texfile_name'\n";
|
|
rdb_show();
|
|
}
|
|
|
|
%primaries = ();
|
|
foreach (@accessible_all) {
|
|
if ( ($_ eq 'latex') || ($_ eq 'pdflatex') || ($_ eq 'lualatex')
|
|
|| ($_ eq 'xelatex') )
|
|
{ $primaries{$_} = 1; }
|
|
}
|
|
|
|
$have_fdb = 0;
|
|
if (! -e $aux_main ) {
|
|
# No aux file => set up trivial aux file
|
|
# and corresponding fdb_file. Arrange them to provoke one run
|
|
# as minimum, but no more if actual aux file is trivial.
|
|
# (Useful on big files without cross references.)
|
|
# If aux file doesn't exist, then any fdb file is surely
|
|
# wrong.
|
|
# Previously, I had condition for this as being both aux and
|
|
# fdb files failing to exist. But it's not obvious what to
|
|
# do if aux exists and fdb doesn't. So I won't do anything.
|
|
&set_trivial_aux_fdb;
|
|
}
|
|
|
|
if ( -e $fdb_name ) {
|
|
$rdb_errors = rdb_read( $fdb_name );
|
|
$have_fdb = ($rdb_errors == 0);
|
|
}
|
|
if (!$have_fdb) {
|
|
# We didn't get a valid set of data on files used in
|
|
# previous run. So use filetime criterion for make
|
|
# instead of change from previous run, until we have
|
|
# done our own make.
|
|
rdb_recurse( [keys %possible_primaries],
|
|
sub{ if ( $$Ptest_kind == 1 ) { $$Ptest_kind = 3;} }
|
|
);
|
|
if ( -e $log_name ) {
|
|
rdb_for_some( [keys %possible_primaries], \&rdb_set_latex_deps );
|
|
}
|
|
}
|
|
foreach $rule ( rdb_accessible( uniq1( keys %requested_filerules ) ) ){
|
|
# For all source files of all accessible rules,
|
|
# if the file data are not already set (e.g., from fdb_latexmk
|
|
# file, set them from disk.
|
|
rdb_one_rule ($rule, undef,
|
|
sub{ if ( $$Ptime == 0) { &rdb_update1; } }
|
|
);
|
|
}
|
|
|
|
if ($go_mode) {
|
|
# Force everything to be remade.
|
|
rdb_recurse( [keys %requested_filerules], sub{$$Pout_of_date=1;} );
|
|
}
|
|
|
|
|
|
if ( $diagnostics ) {
|
|
print "$My_name: Rules after initialization\n";
|
|
rdb_show();
|
|
}
|
|
|
|
#************************************************************
|
|
|
|
if ( $preview_continuous_mode ) {
|
|
&make_preview_continuous;
|
|
next FILE;
|
|
}
|
|
|
|
|
|
## Handling of failures:
|
|
## Variable $failure is set to indicate a failure, with information
|
|
## put in $failure_msg.
|
|
## These variables should be set to 0 and '' at any point at which it
|
|
## should be assumed that no failures have occurred.
|
|
## When after a routine is called it is found that $failure is set, then
|
|
## processing should normally be aborted, e.g., by return.
|
|
## Then there is a cascade of returns back to the outermost level whose
|
|
## responsibility is to handle the error.
|
|
## Exception: An outer level routine may reset $failure and $failure_msg
|
|
## after initial processing, when the error condition may get
|
|
## ameliorated later.
|
|
#Initialize failure flags now.
|
|
$failure = 0;
|
|
$failure_msg = '';
|
|
$failure = rdb_make( keys %requested_filerules );
|
|
if ( ( $failure <= 0 ) || $force_mode ) {
|
|
rdb_for_some( [keys %one_time], \&rdb_run1 );
|
|
}
|
|
if ($failure > 0) { next FILE; }
|
|
} # end FILE
|
|
continue {
|
|
if ($deps_handle) { deps_list($deps_handle); }
|
|
# If requested, print the list of rules. But don't do this in -pvc
|
|
# mode, since the rules list has already been printed.
|
|
if ($rules_list && ! $preview_continuous_mode) { rdb_list(); }
|
|
# Handle any errors
|
|
$error_message_count = rdb_show_rule_errors();
|
|
if ( ($error_message_count == 0) || ($failure > 0) ) {
|
|
if ( $failure_msg ) {
|
|
#Remove trailing space
|
|
$failure_msg =~ s/\s*$//;
|
|
warn "$My_name: Did not finish processing file '$filename':\n",
|
|
" $failure_msg\n";
|
|
$failure = 1;
|
|
}
|
|
}
|
|
if ( ($failure > 0) || ($error_message_count > 0) ) {
|
|
$failure_count ++;
|
|
push @failed_primaries, $filename;
|
|
}
|
|
&ifcd_popd;
|
|
}
|
|
close($deps_handle) if ( $deps_handle );
|
|
|
|
if ($show_time) { show_timing();}
|
|
|
|
sub show_timing {
|
|
my $processing_time = processing_time() - $processing_time1;
|
|
print @timings, "Accumulated processing time = $processing_time\n";
|
|
@timings = ();
|
|
$processing_time1 = processing_time();
|
|
}
|
|
|
|
# If we get here without going through the continue section:
|
|
if ( $do_cd && ($#dir_stack > -1) ) {
|
|
# Just in case we did an abnormal exit from the loop
|
|
warn "$My_name: Potential bug: dir_stack not yet unwound, undoing all directory changes now\n";
|
|
&finish_dir_stack;
|
|
}
|
|
|
|
if ($failure_count > 0) {
|
|
if ( $#file_list > 0 ) {
|
|
# Error occured, but multiple files were processed, so
|
|
# user may not have seen all the error messages
|
|
warn "\n------------\n";
|
|
show_array(
|
|
"$My_name: Some operations failed, for the following tex file(s)",
|
|
@failed_primaries);
|
|
}
|
|
if ( !$force_mode ) {
|
|
warn "$My_name: Use the -f option to force complete processing,\n",
|
|
" unless error was exceeding maximum runs of latex/pdflatex.\n";
|
|
}
|
|
exit 12;
|
|
}
|
|
|
|
|
|
|
|
# end MAIN PROGRAM
|
|
#############################################################
|
|
|
|
sub fix_cmds {
|
|
# If commands do not have placeholders for %S etc, put them in
|
|
foreach ($latex, $pdflatex, $lpr, $lpr_dvi, $lpr_pdf,
|
|
$pdf_previewer, $ps_previewer, $ps_previewer_landscape,
|
|
$dvi_previewer, $dvi_previewer_landscape,
|
|
$kpsewhich
|
|
) {
|
|
# Source only
|
|
if ( $_ && ! /%/ ) { $_ .= " %O %S"; }
|
|
}
|
|
foreach ($pdf_previewer, $ps_previewer, $ps_previewer_landscape,
|
|
$dvi_previewer, $dvi_previewer_landscape,
|
|
) {
|
|
# Run previewers detached
|
|
if ( $_ && ! /^(nostart|NONE|internal) / ) {
|
|
$_ = "start $_";
|
|
}
|
|
}
|
|
foreach ($biber, $bibtex) {
|
|
# Base only
|
|
if ( $_ && ! /%/ ) { $_ .= " %O %B"; }
|
|
}
|
|
foreach ($dvipdf, $ps2pdf) {
|
|
# Source and dest without flag for destination
|
|
if ( $_ && ! /%/ ) { $_ .= " %O %S %D"; }
|
|
}
|
|
foreach ($dvips, $makeindex) {
|
|
# Source and dest with -o dest before source
|
|
if ( $_ && ! /%/ ) { $_ .= " %O -o %D %S"; }
|
|
}
|
|
foreach ($dvi_filter, $ps_filter) {
|
|
# Source and dest, but as filters
|
|
if ( $_ && ! /%/ ) { $_ .= " %O <%S >%D"; }
|
|
}
|
|
} #END fix_cmds
|
|
|
|
#############################################################
|
|
|
|
sub add_option {
|
|
# Call add_option( $opt, \$cmd ... )
|
|
# Add option to one or more commands
|
|
my $option = shift;
|
|
while (@_) {
|
|
if ( ${$_[0]} !~ /%/ ) { &fix_cmds; }
|
|
${$_[0]} =~ s/%O/$option %O/;
|
|
shift;
|
|
}
|
|
} #END add_option
|
|
|
|
#############################################################
|
|
|
|
sub rdb_make_rule_list {
|
|
# Set up specifications for standard rules, adjusted to current conditions
|
|
# Substitutions: %S = source, %D = dest, %B = this rule's base
|
|
# %T = texfile, %R = root = base for latex.
|
|
# %Y for $aux_dir1, %Z for $out_dir1
|
|
|
|
# Defaults for dvi, ps, and pdf files
|
|
# Use local, not my, so these variables can be referenced
|
|
local $dvi_final = "%Z%R.dvi";
|
|
local $ps_final = "%Z%R.ps";
|
|
local $pdf_final = "%Z%R.pdf";
|
|
local $xdv_final = "%Z%R.xdv";
|
|
if ( length($dvi_filter) > 0) {
|
|
$dvi_final = "%Z%R.dviF";
|
|
}
|
|
if ( length($ps_filter) > 0) {
|
|
$ps_final = "%Z%R.psF";
|
|
}
|
|
|
|
my $print_file = '';
|
|
my $print_cmd = 'NONE';
|
|
if ( $print_type eq 'dvi' ) {
|
|
$print_file = $dvi_final;
|
|
$print_cmd = $lpr_dvi;
|
|
}
|
|
elsif ( $print_type eq 'pdf' ) {
|
|
$print_file = $pdf_final;
|
|
$print_cmd = $lpr_pdf;
|
|
}
|
|
elsif ( $print_type eq 'ps' ) {
|
|
$print_file = $ps_final;
|
|
$print_cmd = $lpr;
|
|
}
|
|
elsif ( $print_type eq 'none' ) {
|
|
$print_cmd = 'NONE echo NO PRINTING CONFIGURED';
|
|
}
|
|
|
|
my $view_file = '';
|
|
my $viewer = '';
|
|
my $viewer_update_method = 0;
|
|
my $viewer_update_signal = undef;
|
|
my $viewer_update_command = undef;
|
|
|
|
if ( ($view eq 'dvi') || ($view eq 'pdf') || ($view eq 'ps') ) {
|
|
$view_file = ${$view.'_final'};
|
|
$viewer = ${$view.'_previewer'};
|
|
$viewer_update_method = ${$view.'_update_method'};
|
|
$viewer_update_signal = ${$view.'_update_signal'};
|
|
if (defined ${$view.'_update_command'}) {
|
|
$viewer_update_command = ${$view.'_update_command'};
|
|
}
|
|
}
|
|
# Specification of internal command for viewer update:
|
|
my $PA_update = ['do_update_view', $viewer_update_method, $viewer_update_signal, 0, 1];
|
|
|
|
# For test_kind: Use file contents for latex and friends, but file time for the others.
|
|
# This is because, especially for dvi file, the contents of the file may contain
|
|
# a pointer to a file to be included, not the contents of the file!
|
|
%rule_list = (
|
|
'latex' => [ 'primary', "$latex", '', "%T", "%Z%B.dvi", "%R", 1, ["%Y%R.log"] ],
|
|
'pdflatex' => [ 'primary', "$pdflatex", '', "%T", "%Z%B.pdf", "%R", 1, ["%Y%R.log"] ],
|
|
'lualatex' => [ 'primary', "$lualatex", '', "%T", "%Z%B.pdf", "%R", 1, ["%Y%R.log"] ],
|
|
'xelatex' => [ 'primary', "$xelatex", '', "%T", "%Z%B.xdv", "%R", 1, ["%Y%R.log"] ],
|
|
'dvipdf' => [ 'external', "$dvipdf", 'do_viewfile', $dvi_final, "%B.pdf", "%Z%R", 2 ],
|
|
'xdvipdfmx' => [ 'external', "$xdvipdfmx", 'do_viewfile', $xdv_final, "%B.pdf", "%Z%R", 2 ],
|
|
'dvips' => [ 'external', "$dvips", 'do_viewfile', $dvi_final, "%B.ps", "%Z%R", 2 ],
|
|
'dvifilter'=> [ 'external', $dvi_filter, 'do_viewfile', "%B.dvi", "%B.dviF", "%Z%R", 2 ],
|
|
'ps2pdf' => [ 'external', "$ps2pdf", 'do_viewfile', $ps_final, "%B.pdf", "%Z%R", 2 ],
|
|
'psfilter' => [ 'external', $ps_filter, 'do_viewfile', "%B.ps", "%B.psF", "%Z%R", 2 ],
|
|
'print' => [ 'external', "$print_cmd", 'if_source', $print_file, "", "", 2 ],
|
|
'update_view' => [ 'external', $viewer_update_command, $PA_update,
|
|
$view_file, "", "", 2 ],
|
|
'view' => [ 'external', "$viewer", 'if_source', $view_file, "", "", 2 ],
|
|
);
|
|
|
|
# Ensure we only have one way to make pdf file, and that it is appropriate:
|
|
if ($pdf_mode == 2) { delete $rule_list{'dvipdf'}; delete $rule_list{'pdflatex'}; delete $rule_list{'lualatex'}; delete $rule_list{'xelatex'}; }
|
|
elsif ($pdf_mode == 3) { delete $rule_list{'pdflatex'}; delete $rule_list{'ps2pdf'}; delete $rule_list{'lualatex'}; delete $rule_list{'xelatex'}; }
|
|
elsif ($pdf_mode == 4) { delete $rule_list{'pdflatex'}; delete $rule_list{'ps2pdf'}; delete $rule_list{'dvipdf'}; delete $rule_list{'xelatex'}; }
|
|
elsif ($pdf_mode == 5) { delete $rule_list{'pdflatex'}; delete $rule_list{'ps2pdf'}; delete $rule_list{'dvipdf'}; delete $rule_list{'lualatex'}; }
|
|
else { # Default is to leave pdflatex
|
|
delete $rule_list{'dvipdf'}; delete $rule_list{'ps2pdf'}; delete $rule_list{'lualatex'}; delete $rule_list{'xelatex'};
|
|
}
|
|
|
|
} # END rdb_make_rule_list
|
|
|
|
#************************************************************
|
|
|
|
sub rdb_set_rules {
|
|
# Call rdb_set_rules( \%rule_list, ...)
|
|
# Set up rule database from definitions
|
|
|
|
# Map of files to rules that MAKE them:
|
|
%rule_db = ();
|
|
|
|
foreach my $Prule_list (@_) {
|
|
foreach my $rule ( keys %$Prule_list) {
|
|
my ( $cmd_type, $ext_cmd, $int_cmd, $source, $dest, $base, $test_kind, $PA_extra_gen ) = @{$$Prule_list{$rule}};
|
|
if ( ! $PA_extra_gen ) { $PA_extra_gen = []; }
|
|
my $needs_making = 0;
|
|
# Substitute in the filename variables, since we will use
|
|
# those for determining filenames. But delay expanding $cmd
|
|
# until run time, in case of changes.
|
|
foreach ($base, $source, $dest, @$PA_extra_gen ) {
|
|
s/%R/$root_filename/;
|
|
s/%Y/$aux_dir1/;
|
|
s/%Z/$out_dir1/;
|
|
}
|
|
foreach ($source, $dest ) {
|
|
s/%B/$base/;
|
|
s/%T/$texfile_name/;
|
|
}
|
|
# print "$rule: $cmd_type, EC='$ext_cmd', IC='$int_cmd', $test_kind,\n",
|
|
# " S='$source', D='$dest', B='$base' $needs_making\n";
|
|
rdb_create_rule( $rule, $cmd_type, $ext_cmd, $int_cmd, $test_kind,
|
|
$source, $dest, $base,
|
|
$needs_making, undef, undef, 1, $PA_extra_gen );
|
|
# !! ?? Last line was
|
|
# $needs_making, undef, ($test_kind==1) );
|
|
}
|
|
} # End arguments of subroutine
|
|
&rdb_make_links;
|
|
} # END rdb_set_rules
|
|
|
|
#************************************************************
|
|
|
|
sub rdb_make_links {
|
|
# ?? Problem if there are multiple rules for getting a file. Notably pdf.
|
|
# Which one to choose?
|
|
# Create $from_rule if there's a suitable rule.
|
|
# Map files to rules:
|
|
local %from_rules = ();
|
|
rdb_for_all( sub{ if($$Pdest){$from_rules{$$Pdest} = $rule;} } );
|
|
#?? foreach (sort keys %from_rules) {print "D='$_' F='$from_rules{$_}\n";}
|
|
rdb_for_all(
|
|
0,
|
|
sub{
|
|
# Set from_rule, but only if it isn't set or is invalid.
|
|
# Don't forget the biber v. bibtex issue
|
|
if ( exists $from_rules{$file}
|
|
&& ( (!$$Pfrom_rule) || (! exists $rule_db{$$Pfrom_rule} ) )
|
|
)
|
|
{ $$Pfrom_rule = $from_rules{$file};
|
|
}
|
|
}
|
|
);
|
|
rdb_for_all(
|
|
0,
|
|
sub{
|
|
if ( exists $from_rules{$file} ) {
|
|
$$Pfrom_rule = $from_rules{$file};
|
|
}
|
|
if ( $$Pfrom_rule && (! rdb_rule_exists( $$Pfrom_rule ) ) ) {
|
|
$$Pfrom_rule = '';
|
|
}
|
|
#?? print "$rule: $file, $$Pfrom_rule\n";
|
|
}
|
|
);
|
|
} # END rdb_make_links
|
|
|
|
#************************************************************
|
|
|
|
sub set_trivial_aux_fdb {
|
|
# 1. Write aux file EXACTLY as would be written if the tex file
|
|
# had no cross references, etc. I.e., a minimal .aux file.
|
|
# 2. Write a corresponding fdb file
|
|
# 3. Provoke a run of (pdf)latex (actually of all primaries).
|
|
|
|
local *aux_file;
|
|
open( aux_file, '>', $aux_main )
|
|
or die "Cannot write file '$aux_main'\n";
|
|
print aux_file "\\relax \n";
|
|
close(aux_file);
|
|
|
|
foreach my $rule (keys %primaries ) {
|
|
rdb_ensure_file( $rule, $texfile_name );
|
|
rdb_ensure_file( $rule, $aux_main );
|
|
rdb_one_rule( $rule,
|
|
sub{ $$Pout_of_date = 1; }
|
|
);
|
|
}
|
|
&rdb_write( $fdb_name );
|
|
} #END set_trivial_aux_fdb
|
|
|
|
#************************************************************
|
|
#### Particular actions
|
|
#************************************************************
|
|
#************************************************************
|
|
|
|
sub do_cusdep {
|
|
# Unconditional application of custom-dependency
|
|
# except that rule is not applied if the source file source
|
|
# does not exist, and an error is returned if the dest is not made.
|
|
#
|
|
# Assumes rule context for the custom-dependency, and that my first
|
|
# argument is the name of the subroutine to apply
|
|
my $func_name = $_[0];
|
|
my $return = 0;
|
|
if ( !-e $$Psource ) {
|
|
# Source does not exist. Users of this rule will need to turn
|
|
# it off when custom dependencies are reset
|
|
if ( !$silent ) {
|
|
## ??? Was commented out. 1 Sep. 2008 restored, for cusdep no-file-exists issue
|
|
warn "$My_name: In trying to apply custom-dependency rule\n",
|
|
" to make '$$Pdest' from '$$Psource'\n",
|
|
" the source file has disappeared since the last run\n";
|
|
}
|
|
# Treat as successful
|
|
}
|
|
elsif ( !$func_name ) {
|
|
warn "$My_name: Possible misconfiguration or bug:\n",
|
|
" In trying to apply custom-dependency rule\n",
|
|
" to make '$$Pdest' from '$$Psource'\n",
|
|
" the function name is blank.\n";
|
|
}
|
|
elsif ( ! defined &$func_name ) {
|
|
warn "$My_name: Misconfiguration or bug,",
|
|
" in trying to apply custom-dependency rule\n",
|
|
" to make '$$Pdest' from '$$Psource'\n",
|
|
" function name '$func_name' does not exists.\n";
|
|
}
|
|
else {
|
|
my $cusdep_ret = &$func_name( $$Pbase );
|
|
if ( defined $cusdep_ret && ($cusdep_ret != 0) ) {
|
|
$return = $cusdep_ret;
|
|
if ($return) {
|
|
warn "Rule '$rule', function '$func_name'\n",
|
|
" failed with return code = $return\n";
|
|
}
|
|
}
|
|
elsif ( !-e $$Pdest ) {
|
|
# Destination non-existent, but routine failed to give an error
|
|
warn "$My_name: In running custom-dependency rule\n",
|
|
" to make '$$Pdest' from '$$Psource'\n",
|
|
" function '$func_name' did not make the destination.\n";
|
|
$return = -1;
|
|
}
|
|
}
|
|
return $return;
|
|
} # END do_cusdep
|
|
|
|
#************************************************************
|
|
|
|
sub do_viewfile {
|
|
# Unconditionally make file for viewing, going through temporary file if
|
|
# Assumes rule context
|
|
|
|
my $return = 0;
|
|
my ($base, $path, $ext) = fileparseA( $$Pdest );
|
|
if ( &view_file_via_temporary ) {
|
|
if ( $$Pext_cmd =~ /%D/ ) {
|
|
my $tmpfile = tempfile1( "${root_filename}_tmp", $ext );
|
|
warn "$My_name: Making '$$Pdest' via temporary '$tmpfile'...\n";
|
|
$return = &Run_subst( undef, undef, undef, undef, $tmpfile );
|
|
move( $tmpfile, $$Pdest );
|
|
}
|
|
else {
|
|
warn "$My_name is configured to make '$$Pdest' via a temporary file\n",
|
|
" but the command template '$$Pext_cmd' does not have a slot\n",
|
|
" to set the destination file, so I won't use a temporary file\n";
|
|
$return = &Run_subst();
|
|
}
|
|
}
|
|
else {
|
|
$return = &Run_subst();
|
|
}
|
|
return $return;
|
|
} #END do_viewfile
|
|
|
|
#************************************************************
|
|
|
|
sub do_update_view {
|
|
# Update viewer
|
|
# Assumes rule context
|
|
# Arguments: (method, signal, viewer_process)
|
|
|
|
my $return = 0;
|
|
|
|
# Although the process is passed as an argument, we'll need to update it.
|
|
# So (FUDGE??) bypass the standard interface for the process.
|
|
# We might as well do this for all the arguments.
|
|
my $viewer_update_method = ${$PAint_cmd}[1];
|
|
my $viewer_update_signal = ${$PAint_cmd}[2];
|
|
my $Pviewer_process = \${$PAint_cmd}[3];
|
|
my $Pneed_to_get_viewer_process = \${$PAint_cmd}[4];
|
|
|
|
if ($viewer_update_method == 2) {
|
|
if ($$Pneed_to_get_viewer_process) {
|
|
$$Pviewer_process = &find_process_id( $$Psource );
|
|
if ($$Pviewer_process != 0) {
|
|
$$Pneed_to_get_viewer_process = 0;
|
|
}
|
|
}
|
|
if ($$Pviewer_process == 0) {
|
|
print "$My_name: need to signal viewer for file '$$Psource', but didn't get \n",
|
|
" process ID for some reason, e.g., no viewer, bad configuration, bug\n"
|
|
if $diagnostics ;
|
|
}
|
|
elsif ( defined $viewer_update_signal) {
|
|
print "$My_name: signalling viewer, process ID $$Pviewer_process ",
|
|
"with signal $viewer_update_signal\n"
|
|
if $diagnostics ;
|
|
kill $viewer_update_signal, $$Pviewer_process;
|
|
}
|
|
else {
|
|
warn "$My_name: viewer is supposed to be sent a signal\n",
|
|
" but no signal is defined. Misconfiguration or bug?\n";
|
|
$return = 1;
|
|
}
|
|
}
|
|
elsif ($viewer_update_method == 4) {
|
|
if (defined $$Pext_cmd) {
|
|
$return = &Run_subst();
|
|
}
|
|
else {
|
|
warn "$My_name: viewer is supposed to be updated by running a command,\n",
|
|
" but no command is defined. Misconfiguration or bug?\n";
|
|
}
|
|
}
|
|
return $return;
|
|
} #END do_update_view
|
|
|
|
#************************************************************
|
|
|
|
sub if_source {
|
|
# Unconditionally apply rule if source file exists.
|
|
# Assumes rule context
|
|
if ( -e $$Psource ) {
|
|
return &Run_subst();
|
|
}
|
|
else {
|
|
warn "Needed source file '$$Psource' does not exist.\n";
|
|
return -1;
|
|
}
|
|
} #END if_source
|
|
|
|
#************************************************************
|
|
#### Subroutines
|
|
#************************************************************
|
|
#************************************************************
|
|
|
|
sub find_basename {
|
|
# Finds the basename of the root file
|
|
# Arguments:
|
|
# 1 - Filename to breakdown
|
|
# 2 - Where to place base file
|
|
# 3 - Where to place tex file
|
|
# Returns non-zero if tex file does not exist
|
|
#
|
|
# The rules for determining this depend on the implementation of TeX.
|
|
# The variable $extension_treatment determines which rules are used.
|
|
|
|
# !!!!!!!! I still need to implement use of kpsewhich to match behavior
|
|
# of (pdf)latex correctly.
|
|
|
|
local($given_name, $base_name, $ext, $path, $tex_name);
|
|
$given_name = $_[0];
|
|
if ( "$extension_treatment" eq "miktex_old" ) {
|
|
# Miktex v. 1.20d:
|
|
# 1. If the filename has an extension, then use it.
|
|
# 2. Else append ".tex".
|
|
# 3. The basename is obtained from the filename by
|
|
# removing the path component, and the extension, if it
|
|
# exists. If a filename has a multiple extension, then
|
|
# all parts of the extension are removed.
|
|
# 4. The names of generated files (log, aux) are obtained by
|
|
# appending .log, .aux, etc to the basename. Note that
|
|
# these are all in the CURRENT directory, and the drive/path
|
|
# part of the originally given filename is ignored.
|
|
#
|
|
# Thus when the given filename is "\tmp\a.b.c", the tex
|
|
# filename is the same, and the basename is "a".
|
|
|
|
($base_name, $path, $ext) = fileparse( $given_name, '\..*' );
|
|
if ( "$ext" eq "") { $tex_name = "$given_name.tex"; }
|
|
else { $tex_name = $given_name; }
|
|
$_[1] = $base_name;
|
|
$_[2] = $tex_name;
|
|
}
|
|
elsif ( "$extension_treatment" eq "unix" ) {
|
|
# unix (at least TeXLive 2016) =>
|
|
# A. Finding of tex file:
|
|
# 1. If filename.tex exists, use it,
|
|
# 2. else if kpsewhich finds filename.tex, use it
|
|
# 3. else if filename exists, use it,
|
|
# 4. else if kpsewhich finds filename, use it.
|
|
# (Probably can unify the above by
|
|
# 1'. If kpsewhich finds filename.tex, use result.
|
|
# 2'. else if kpsewhich finds filename, use result.
|
|
# 3'. else report file not found.
|
|
# B. The base filename is obtained by deleting the path
|
|
# component and, if an extension exists, the last
|
|
# component of the extension, even if the extension is
|
|
# null. (A name ending in "." has a null extension.)
|
|
# C. The names of generated files (log, aux) are obtained by
|
|
# appending .log, .aux, etc to the basename. Note that
|
|
# these are all in the CURRENT directory, and the drive/path
|
|
# part of the originally given filename is ignored.
|
|
#
|
|
# Thus when the given filename is "/tmp/a.b.c", there are two
|
|
# cases:
|
|
# a. /tmp/a.b.c.tex exists. Then this is the tex file,
|
|
# and the basename is "a.b.c".
|
|
# b. /tmp/a.b.c.tex does not exist. Then the tex file is
|
|
# "/tmp/a.b.c", and the basename is "a.b".
|
|
# But there are also modifications of this when a file can be
|
|
# found by kpsewhich.
|
|
|
|
if ( -f "$given_name.tex" ) {
|
|
$tex_name = "$given_name.tex";
|
|
}
|
|
else {
|
|
$tex_name = "$given_name";
|
|
}
|
|
($base_name, $path, $ext) = fileparse( $tex_name, '\.[^\.]*' );
|
|
$_[1] = $base_name;
|
|
$_[2] = $tex_name;
|
|
}
|
|
else {
|
|
die "$My_name: Incorrect configuration gives \$extension_treatment=",
|
|
"'$extension_treatment'\n";
|
|
}
|
|
if ($diagnostics) {
|
|
print "Given='$given_name', tex='$tex_name', base='$base_name'\n";
|
|
}
|
|
return ! -e $tex_name;
|
|
} #END find_basename
|
|
|
|
#************************************************************
|
|
|
|
sub make_preview_continuous {
|
|
local @changed = ();
|
|
local @disappeared = ();
|
|
local @no_dest = (); # Non-existent destination files
|
|
local @rules_never_run = ();
|
|
local @rules_to_apply = ();
|
|
|
|
local $failure = 0;
|
|
local %rules_applied = ();
|
|
local $updated = 0;
|
|
|
|
# What to make?
|
|
my @targets = keys %requested_filerules;
|
|
|
|
$quell_uptodate_msgs = 1;
|
|
|
|
local $view_file = '';
|
|
rdb_one_rule( 'view', sub{ $view_file = $$Psource; } );
|
|
|
|
if ( ($view eq 'dvi') || ($view eq 'pdf') || ($view eq 'ps') ) {
|
|
warn "Viewing $view\n";
|
|
}
|
|
elsif ( $view eq 'none' ) {
|
|
warn "Not using a previewer\n";
|
|
$view_file = '';
|
|
}
|
|
else {
|
|
warn "$My_name: BUG: Invalid preview method '$view'\n";
|
|
exit 20;
|
|
}
|
|
|
|
my $viewer_running = 0; # No viewer known to be running yet
|
|
# Get information from update_view rule
|
|
local $viewer_update_method = 0;
|
|
# Pointers so we can update the following:
|
|
local $Pviewer_process = undef;
|
|
local $Pneed_to_get_viewer_process = undef;
|
|
rdb_one_rule( 'update_view',
|
|
sub{ $viewer_update_method = $$PAint_cmd[1];
|
|
$Pviewer_process = \$$PAint_cmd[3];
|
|
$Pneed_to_get_viewer_process = \$$PAint_cmd[4];
|
|
}
|
|
);
|
|
# Note that we don't get the previewer process number from the program
|
|
# that starts it; that might only be a script to get things set up and the
|
|
# actual previewer could be (and sometimes IS) another process.
|
|
|
|
if ( ($view_file ne '') && (-e $view_file) && !$new_viewer_always ) {
|
|
# Is a viewer already running?
|
|
# (We'll save starting up another viewer.)
|
|
$$Pviewer_process = &find_process_id( $view_file );
|
|
if ( $$Pviewer_process ) {
|
|
warn "$My_name: Previewer is already running\n"
|
|
if !$silent;
|
|
$viewer_running = 1;
|
|
$$Pneed_to_get_viewer_process = 0;
|
|
}
|
|
}
|
|
|
|
# Loop forever, rebuilding .dvi and .ps as necessary.
|
|
# Set $first_time to flag first run (to save unnecessary diagnostics)
|
|
CHANGE:
|
|
for (my $first_time = 1; 1; $first_time = 0 ) {
|
|
my %rules_to_watch = %requested_filerules;
|
|
$updated = 0;
|
|
$failure = 0;
|
|
$failure_msg = '';
|
|
if ( $MSWin_fudge_break && ($^O eq "MSWin32") ) {
|
|
# Fudge under MSWin32 ONLY, to stop perl/latexmk from
|
|
# catching ctrl/C and ctrl/break, and let it only reach
|
|
# downstream programs. See comments at first definition of
|
|
# $MSWin_fudge_break.
|
|
$SIG{BREAK} = $SIG{INT} = 'IGNORE';
|
|
}
|
|
if ($compiling_cmd) {
|
|
Run_subst( $compiling_cmd );
|
|
}
|
|
$failure = rdb_make( @targets );
|
|
|
|
## warn "=========Viewer PID = $$Pviewer_process; updated=$updated\n";
|
|
|
|
if ( $MSWin_fudge_break && ($^O eq "MSWin32") ) {
|
|
$SIG{BREAK} = $SIG{INT} = 'DEFAULT';
|
|
}
|
|
# Start viewer if needed.
|
|
if ( ($failure > 0) && (! $force_mode) ) {
|
|
# No viewer yet
|
|
}
|
|
elsif ( ($view_file ne '') && (-e $view_file) && $updated && $viewer_running ) {
|
|
# A viewer is running. Explicitly get it to update screen if we have to do it:
|
|
rdb_one_rule( 'update_view', \&rdb_run1 );
|
|
}
|
|
elsif ( ($view_file ne '') && (-e $view_file) && !$viewer_running ) {
|
|
# Start the viewer
|
|
if ( !$silent ) {
|
|
if ($new_viewer_always) {
|
|
warn "$My_name: starting previewer for '$view_file'\n",
|
|
"------------\n";
|
|
}
|
|
else {
|
|
warn "$My_name: I have not found a previewer that ",
|
|
"is already running. \n",
|
|
" So I will start it for '$view_file'\n",
|
|
"------------\n";
|
|
}
|
|
}
|
|
local $retcode = 0;
|
|
rdb_one_rule( 'view', sub { $retcode = &rdb_run1;} );
|
|
if ( $retcode != 0 ) {
|
|
if ($force_mode) {
|
|
warn "$My_name: I could not run previewer\n";
|
|
}
|
|
else {
|
|
&exit_msg1( "I could not run previewer", $retcode);
|
|
}
|
|
}
|
|
else {
|
|
$viewer_running = 1;
|
|
$$Pneed_to_get_viewer_process = 1;
|
|
} # end analyze result of trying to run viewer
|
|
} # end start viewer
|
|
if ( $failure > 0 ) {
|
|
if ( !$failure_msg ) {
|
|
$failure_msg = 'Failure to make the files correctly';
|
|
}
|
|
@pre_primary = (); # Array of rules
|
|
@post_primary = (); # Array of rules
|
|
@unusual_one_time = (); # Array of rules
|
|
&rdb_classify_rules( \%possible_primaries, keys %requested_filerules );
|
|
# There will be files changed during the run that are irrelevant.
|
|
# We need to wait for the user to change the files.
|
|
|
|
# So set the GENERATED files from (pdf)latex as up-to-date:
|
|
rdb_for_some( [keys %current_primaries], \&rdb_update_gen_files );
|
|
|
|
# And don't watch for changes for post_primary rules (ps and pdf
|
|
# from dvi, etc haven't been run after an error in (pdf)latex, so
|
|
# are out-of-date by filetime criterion, but they should not be run
|
|
# until after another (pdf)latex run:
|
|
foreach (@post_primary) { delete $rules_to_watch{$_}; }
|
|
|
|
$failure_msg =~ s/\s*$//; #Remove trailing space
|
|
warn "$My_name: $failure_msg\n",
|
|
" ==> You will need to change a source file before I do another run <==\n";
|
|
if ($failure_cmd) {
|
|
Run_subst( $failure_cmd );
|
|
}
|
|
}
|
|
else {
|
|
if ($success_cmd) {
|
|
Run_subst( $success_cmd );
|
|
}
|
|
}
|
|
rdb_show_rule_errors();
|
|
if ($rules_list) { rdb_list(); }
|
|
if ($show_time && ! $first_time) { show_timing(); }
|
|
if ( $dependents_list && ($updated || $failure) ) {
|
|
my $deps_handle = new FileHandle "> $deps_file";
|
|
if ( defined $deps_handle ) {
|
|
deps_list($deps_handle);
|
|
close($deps_handle);
|
|
}
|
|
else {
|
|
warn "Cannot open '$deps_file' for output of dependency information\n";
|
|
}
|
|
}
|
|
if ( $first_time || $updated || $failure ) {
|
|
print "\n=== Watching for updated files. Use ctrl/C to stop ...\n";
|
|
}
|
|
$waiting = 1; if ($diagnostics) { warn "WAITING\n"; }
|
|
# During waiting for file changes, handle ctrl/C and ctrl/break here, rather than letting
|
|
# system handle them by terminating script (and any script that calls it). This allows,
|
|
# for example, the clean up code in the following command line to work:
|
|
# latexmk -pvc foo; cleanup;
|
|
&catch_break;
|
|
$have_break = 0;
|
|
WAIT: while (1) {
|
|
sleep( $sleep_time );
|
|
if ($have_break) { last WAIT; }
|
|
if ( rdb_new_changes(keys %rules_to_watch) ) {
|
|
if (!$silent) {
|
|
warn "$My_name: Need to remake files.\n";
|
|
&rdb_diagnose_changes( ' ' );
|
|
}
|
|
last WAIT;
|
|
}
|
|
# Don't count waiting time in processing:
|
|
$processing_time1 = processing_time();
|
|
# Does this do this job????
|
|
local $new_files = 0;
|
|
rdb_for_some( [keys %current_primaries], sub{ $new_files += &rdb_find_new_files } );
|
|
if ($new_files > 0) {
|
|
warn "$My_name: New file(s) found.\n";
|
|
last WAIT;
|
|
}
|
|
if ($have_break) { last WAIT; }
|
|
} # end WAIT:
|
|
&default_break;
|
|
if ($have_break) {
|
|
print "$My_name: User typed ctrl/C or ctrl/break. I'll finish.\n";
|
|
return;
|
|
}
|
|
$waiting = 0; if ($diagnostics) { warn "NOT WAITING\n"; }
|
|
} #end infinite_loop CHANGE:
|
|
} #END sub make_preview_continuous
|
|
|
|
#************************************************************
|
|
|
|
sub process_rc_file {
|
|
# Usage process_rc_file( filename )
|
|
# NEW VERSION
|
|
# Run rc_file whose name is given in first argument
|
|
# Exit with code 0 on success
|
|
# Exit with code 1 if file cannot be read or does not exist.
|
|
# Stop if there is a syntax error or other problem.
|
|
# PREVIOUSLY:
|
|
# Exit with code 2 if is a syntax error or other problem.
|
|
my $rc_file = $_[0];
|
|
my $ret_code = 0;
|
|
warn "$My_name: Executing Perl code in file '$rc_file'...\n"
|
|
if $diagnostics;
|
|
# I could use the do command of perl, but the preceeding -r test
|
|
# to get good diagnostics gets the wrong result under cygwin
|
|
# (e.g., on /cygdrive/c/latexmk/LatexMk)
|
|
my $RCH = new FileHandle;
|
|
if ( !-e $rc_file ) {
|
|
warn "$My_name: The rc-file '$rc_file' does not exist\n";
|
|
return 1;
|
|
}
|
|
elsif ( -d $rc_file ) {
|
|
warn "$My_name: The supposed rc-file '$rc_file' is a directory; but it\n",
|
|
" should be a normal text file\n";
|
|
return 1;
|
|
}
|
|
elsif ( open $RCH, "<$rc_file" ) {
|
|
{ local $/; eval <$RCH>; }
|
|
close $RCH;
|
|
}
|
|
else {
|
|
warn "$My_name: I cannot read the rc-file '$rc_file'\n";
|
|
return 1;
|
|
}
|
|
# PREVIOUS VERSION
|
|
# if ( ! -r $rc_file ) {
|
|
# warn "$My_name: I cannot read the rc-file '$rc_file'\n",
|
|
# " or at least that's what Perl (for $^O) reports\n";
|
|
# return 1;
|
|
# }
|
|
# do( $rc_file );
|
|
if ( $@ ) {
|
|
# Indent each line of possibly multiline message:
|
|
my $message = prefix( $@, " " );
|
|
warn "$My_name: Initialization file '$rc_file' gave an error:\n",
|
|
"$message\n";
|
|
die "$My_name: Stopping because of problem with rc file\n";
|
|
# Use the following if want non-fatal error.
|
|
return 2;
|
|
}
|
|
return 0;
|
|
} #END process_rc_file
|
|
|
|
#************************************************************
|
|
|
|
sub execute_code_string {
|
|
# Usage execute_code_string( string_of_code )
|
|
# Run the perl code contained in first argument
|
|
# Halt if there is a syntax error or other problem.
|
|
# ???Should I leave the exiting to the caller (perhaps as an option)?
|
|
# But I can always catch it with an eval if necessary.
|
|
# That confuses ctrl/C and ctrl/break handling.
|
|
my $code = $_[0];
|
|
warn "$My_name: Executing initialization code specified by -e:\n",
|
|
" '$code'...\n"
|
|
if $diagnostics;
|
|
eval $code;
|
|
# The return value from the eval is not useful, since it is the value of
|
|
# the last expression evaluated, which could be anything.
|
|
# The correct test of errors is on the value of $@.
|
|
|
|
if ( $@ ) {
|
|
# Indent each line of possibly multiline message:
|
|
my $message = prefix( $@, " " );
|
|
die "$My_name: ",
|
|
"Stopping because executing following code from command line\n",
|
|
" $code\n",
|
|
"gave an error:\n",
|
|
"$message\n";
|
|
}
|
|
} #END execute_code_string
|
|
|
|
#************************************************************
|
|
|
|
sub cleanup1 {
|
|
# Usage: cleanup1( directory, exts_without_period, ... )
|
|
#
|
|
# The directory and the root file name are fixed names, so I must escape
|
|
# any glob metacharacters in them:
|
|
my $dir = fix_pattern( shift );
|
|
my $root_fixed = fix_pattern( $root_filename );
|
|
foreach (@_) {
|
|
(my $name = /%R/ ? $_ : "%R.$_") =~ s/%R/$dir$root_fixed/;
|
|
unlink_or_move( glob( "$name" ) );
|
|
}
|
|
} #END cleanup1
|
|
|
|
#************************************************************
|
|
|
|
sub cleanup_cusdep_generated {
|
|
# Remove files generated by custom dependencies
|
|
rdb_for_all( \&cleanup_one_cusdep_generated );
|
|
} #END cleanup_cusdep_generated
|
|
|
|
#************************************************************
|
|
|
|
sub cleanup_one_cusdep_generated {
|
|
# Remove destination file generated by one custom dependency
|
|
# Assume rule context, but not that the rule is a custom dependency.
|
|
# Only delete destination file if source file exists (so destination
|
|
# file can be recreated)
|
|
if ( $$Pcmd_type ne 'cusdep' ) {
|
|
# NOT cusdep
|
|
return;
|
|
}
|
|
if ( (-e $$Pdest) && (-e $$Psource) ) {
|
|
unlink_or_move( $$Pdest );
|
|
}
|
|
elsif ( (-e $$Pdest) && (!-e $$Psource) ) {
|
|
warn "$My_name: For custom dependency '$rule',\n",
|
|
" I won't delete destination file '$$Pdest'\n",
|
|
" because the source file '$$Psource' doesn't exist,\n",
|
|
" so the destination file may not be able to be recreated\n";
|
|
}
|
|
} #END cleanup_one_cusdep_generated
|
|
|
|
#************************************************************
|
|
#************************************************************
|
|
#************************************************************
|
|
|
|
# Error handling routines, warning routines, help
|
|
|
|
#************************************************************
|
|
|
|
sub die_trace {
|
|
# Call: die_trace( message );
|
|
&traceback; # argument(s) passed unchanged
|
|
die "\n";
|
|
} #END die_trace
|
|
|
|
#************************************************************
|
|
|
|
sub traceback {
|
|
# Call: &traceback
|
|
# or traceback( message, )
|
|
my $msg = shift;
|
|
if ($msg) { warn "$msg\n"; }
|
|
warn "Traceback:\n";
|
|
my $i=0; # Start with immediate caller
|
|
while ( my ($pack, $file, $line, $func) = caller($i++) ) {
|
|
if ($func eq 'die_trace') { next; }
|
|
warn " $func called from line $line\n";
|
|
}
|
|
} #END traceback
|
|
|
|
#************************************************************
|
|
|
|
sub exit_msg1
|
|
{
|
|
# exit_msg1( error_message, retcode [, action])
|
|
# 1. display error message
|
|
# 2. if action set, then restore aux file
|
|
# 3. exit with retcode
|
|
warn "\n------------\n";
|
|
warn "$My_name: $_[0].\n";
|
|
warn "-- Use the -f option to force complete processing.\n";
|
|
|
|
my $retcode = $_[1];
|
|
if ($retcode >= 256) {
|
|
# Retcode is the kind returned by system from an external command
|
|
# which is 256 * command's_retcode
|
|
$retcode /= 256;
|
|
}
|
|
exit $retcode;
|
|
} #END exit_msg1
|
|
|
|
#************************************************************
|
|
|
|
sub warn_running {
|
|
# Message about running program:
|
|
if ( $silent ) {
|
|
warn "$My_name: @_\n";
|
|
}
|
|
else {
|
|
warn "------------\n@_\n------------\n";
|
|
}
|
|
} #END warn_running
|
|
|
|
#************************************************************
|
|
|
|
sub exit_help
|
|
# Exit giving diagnostic from arguments and how to get help.
|
|
{
|
|
warn "\n$My_name: @_\n",
|
|
"Use\n",
|
|
" $my_name -help\nto get usage information\n";
|
|
exit 10;
|
|
} #END exit_help
|
|
|
|
|
|
#************************************************************
|
|
|
|
sub print_help
|
|
{
|
|
print
|
|
"$My_name $version_num: Automatic LaTeX document generation routine\n\n",
|
|
"Usage: $my_name [latexmk_options] [filename ...]\n\n",
|
|
" Latexmk_options:\n",
|
|
" -aux-directory=dir or -auxdir=dir \n",
|
|
" - set name of directory for auxiliary files (aux, log)\n",
|
|
" - Currently this only works with MiKTeX\n",
|
|
" -bibtex - use bibtex when needed (default)\n",
|
|
" -bibtex- - never use bibtex\n",
|
|
" -bibtex-cond - use bibtex when needed, but only if the bib files exist\n",
|
|
" -bm <message> - Print message across the page when converting to postscript\n",
|
|
" -bi <intensity> - Set contrast or intensity of banner\n",
|
|
" -bs <scale> - Set scale for banner\n",
|
|
" -commands - list commands used by $my_name for processing files\n",
|
|
" -c - clean up (remove) all nonessential files, except\n",
|
|
" dvi, ps and pdf files.\n",
|
|
" This and the other clean-ups are instead of a regular make.\n",
|
|
" -C - clean up (remove) all nonessential files\n",
|
|
" including aux, dep, dvi, postscript and pdf files\n",
|
|
" and file of database of file information\n",
|
|
" -CA - clean up (remove) all nonessential files.\n",
|
|
" Equivalent to -C option.\n",
|
|
" -CF - Remove file of database of file information before doing \n",
|
|
" other actions\n",
|
|
" -cd - Change to directory of source file when processing it\n",
|
|
" -cd- - Do NOT change to directory of source file when processing it\n",
|
|
" -dependents or -deps - Show list of dependent files after processing\n",
|
|
" -dependents- or -deps- - Do not show list of dependent files\n",
|
|
" -deps-out=file - Set name of output file for dependency list,\n",
|
|
" and turn on showing of dependency list\n",
|
|
" -dF <filter> - Filter to apply to dvi file\n",
|
|
" -dvi - generate dvi\n",
|
|
" -dvi- - turn off required dvi\n",
|
|
" -e <code> - Execute specified Perl code (as part of latexmk start-up\n",
|
|
" code)\n",
|
|
" -f - force continued processing past errors\n",
|
|
" -f- - turn off forced continuing processing past errors\n",
|
|
" -gg - Super go mode: clean out generated files (-CA), and then\n",
|
|
" process files regardless of file timestamps\n",
|
|
" -g - process regardless of file timestamps\n",
|
|
" -g- - Turn off -g\n",
|
|
" -h - print help\n",
|
|
" -help - print help\n",
|
|
" -jobname=STRING - set basename of output file(s) to STRING.\n",
|
|
" (Like --jobname=STRING on command line for many current\n",
|
|
" implementations of latex/pdflatex.)\n",
|
|
" -l - force landscape mode\n",
|
|
" -l- - turn off -l\n",
|
|
" -latex=<program> - set program used for latex.\n",
|
|
" (replace '<program>' by the program name)\n",
|
|
" -latexoption=<option> - add the given option to the (pdf)latex command\n",
|
|
" -logfilewarninglist or -logfilewarnings \n",
|
|
" give list of warnings after run of (pdf)latex\n",
|
|
" -logfilewarninglist- or -logfilewarnings- \n",
|
|
" do not give list of warnings after run of (pdf)latex\n",
|
|
" -M - Show list of dependent files after processing\n",
|
|
" -MF file - Specifies name of file to receives list dependent files\n",
|
|
" -MP - List of dependent files includes phony target for each source file.\n",
|
|
" -new-viewer - in -pvc mode, always start a new viewer\n",
|
|
" -new-viewer- - in -pvc mode, start a new viewer only if needed\n",
|
|
" -nobibtex - never use bibtex\n",
|
|
" -nodependents - Do not show list of dependent files after processing\n",
|
|
" -norc - omit automatic reading of system, user and project rc files\n",
|
|
" -output-directory=dir or -outdir=dir\n",
|
|
" - set name of directory for output files\n",
|
|
" -pdf - generate pdf by pdflatex\n",
|
|
" -pdfdvi - generate pdf by dvipdf\n",
|
|
" -pdflatex=<program> - set program used for pdflatex.\n",
|
|
" (replace '<program>' by the program name)\n",
|
|
" -pdfps - generate pdf by ps2pdf\n",
|
|
" -pdflua - generate pdf by lualatex\n",
|
|
" -pdfxe - generate pdf by xelatex\n",
|
|
" -pdf- - turn off pdf\n",
|
|
" -ps - generate postscript\n",
|
|
" -ps- - turn off postscript\n",
|
|
" -pF <filter> - Filter to apply to postscript file\n",
|
|
" -p - print document after generating postscript.\n",
|
|
" (Can also .dvi or .pdf files -- see documentation)\n",
|
|
" -print=dvi - when file is to be printed, print the dvi file\n",
|
|
" -print=ps - when file is to be printed, print the ps file (default)\n",
|
|
" -print=pdf - when file is to be printed, print the pdf file\n",
|
|
" -pv - preview document. (Side effect turn off continuous preview)\n",
|
|
" -pv- - turn off preview mode\n",
|
|
" -pvc - preview document and continuously update. (This also turns\n",
|
|
" on force mode, so errors do not cause $my_name to stop.)\n",
|
|
" (Side effect: turn off ordinary preview mode.)\n",
|
|
" -pvc- - turn off -pvc\n",
|
|
" -quiet - silence progress messages from called programs\n",
|
|
" -r <file> - Read custom RC file\n",
|
|
" (N.B. This file could override options specified earlier\n",
|
|
" on the command line.)\n",
|
|
" -recorder - Use -recorder option for (pdf)latex\n",
|
|
" (to give list of input and output files)\n",
|
|
" -recorder- - Do not use -recorder option for (pdf)latex\n",
|
|
" -rules - Show list of rules after processing\n",
|
|
" -rules- - Do not show list of rules after processing\n",
|
|
" -showextraoptions - Show other allowed options that are simply passed\n",
|
|
" as is to latex and pdflatex\n",
|
|
" -silent - silence progress messages from called programs\n",
|
|
" -time - show CPU time used\n",
|
|
" -time- - don't show CPU time used\n",
|
|
" -use-make - use the make program to try to make missing files\n",
|
|
" -use-make- - don't use the make program to try to make missing files\n",
|
|
" -v - display program version\n",
|
|
" -verbose - display usual progress messages from called programs\n",
|
|
" -version - display program version\n",
|
|
" -view=default - viewer is default (dvi, ps, pdf)\n",
|
|
" -view=dvi - viewer is for dvi\n",
|
|
" -view=none - no viewer is used\n",
|
|
" -view=ps - viewer is for ps\n",
|
|
" -view=pdf - viewer is for pdf\n",
|
|
" -lualatex - use lualatex for processing files to pdf\n",
|
|
" and turn dvi/ps modes off\n",
|
|
" -xelatex - use xelatex for processing files to pdf\n",
|
|
" and turn dvi/ps modes off\n",
|
|
"\n",
|
|
" filename = the root filename of LaTeX document\n",
|
|
"\n",
|
|
"-p, -pv and -pvc are mutually exclusive\n",
|
|
"-h, -c and -C override all other options.\n",
|
|
"-pv and -pvc require one and only one filename specified\n",
|
|
"All options can be introduced by '-' or '--'. (E.g., --help or -help.)\n",
|
|
" \n",
|
|
"In addition, latexmk recognizes many other options that are passed to\n",
|
|
"latex and/or pdflatex without interpretation by latexmk. Run latexmk\n",
|
|
"with the option -showextraoptions to see a list of these\n",
|
|
"\n",
|
|
"Report bugs etc to John Collins <jcc8 at psu.edu>.\n";
|
|
|
|
} #END print_help
|
|
|
|
#************************************************************
|
|
|
|
sub print_commands {
|
|
warn "Commands used by $my_name:\n",
|
|
" To run latex, I use \"$latex\"\n",
|
|
" To run pdflatex, I use \"$pdflatex\"\n",
|
|
" To run lualatex, I use \"$lualatex\"\n",
|
|
" To run xelatex, I use \"$xelatex\"\n",
|
|
" To run biber, I use \"$biber\"\n",
|
|
" To run bibtex, I use \"$bibtex\"\n",
|
|
" To run makeindex, I use \"$makeindex\"\n",
|
|
" To make a ps file from a dvi file, I use \"$dvips\"\n",
|
|
" To make a ps file from a dvi file with landscape format, ",
|
|
"I use \"$dvips_landscape\"\n",
|
|
" To make a pdf file from a dvi file, I use \"$dvipdf\"\n",
|
|
" To make a pdf file from a ps file, I use \"$ps2pdf\"\n",
|
|
" To make a pdf file from an xdv file, I use \"$xdvipdfmx\"\n",
|
|
" To view a pdf file, I use \"$pdf_previewer\"\n",
|
|
" To view a ps file, I use \"$ps_previewer\"\n",
|
|
" To view a ps file in landscape format, ",
|
|
"I use \"$ps_previewer_landscape\"\n",
|
|
" To view a dvi file, I use \"$dvi_previewer\"\n",
|
|
" To view a dvi file in landscape format, ",
|
|
"I use \"$dvi_previewer_landscape\"\n",
|
|
" To print a ps file, I use \"$lpr\"\n",
|
|
" To print a dvi file, I use \"$lpr_dvi\"\n",
|
|
" To print a pdf file, I use \"$lpr_pdf\"\n",
|
|
" To find running processes, I use \"$pscmd\", \n",
|
|
" and the process number is at position $pid_position\n";
|
|
warn "Notes:\n",
|
|
" Command starting with \"start\" is run detached\n",
|
|
" Command that is just \"start\" without any other command, is\n",
|
|
" used under MS-Windows to run the command the operating system\n",
|
|
" has associated with the relevant file.\n",
|
|
" Command starting with \"NONE\" is not used at all\n";
|
|
} #END print_commands
|
|
|
|
#************************************************************
|
|
|
|
sub view_file_via_temporary {
|
|
return $always_view_file_via_temporary
|
|
|| ($pvc_view_file_via_temporary && $preview_continuous_mode);
|
|
} #END view_file_via_temporary
|
|
|
|
#************************************************************
|
|
#### Tex-related utilities
|
|
|
|
#**************************************************
|
|
|
|
sub check_biber_log {
|
|
# Check for biber warnings:
|
|
# Usage: check_biber_log( base_of_biber_run, \@biber_source )
|
|
# return 0: OK;
|
|
# 1: biber warnings;
|
|
# 2: biber errors;
|
|
# 3: could not open .blg file;
|
|
# 4: failed to find one or more source files, except for bibfile;
|
|
# 5: failed to find bib file;
|
|
# 6: missing file, one of which is control file
|
|
# 10: only error is missing \citation commands.
|
|
# 11: Malformed bcf file (normally due to error in pdflatex run)
|
|
# Side effect: add source files @biber_source
|
|
my $base = $_[0];
|
|
my $Pbiber_source = $_[1];
|
|
my $log_name = "$base.blg";
|
|
my $log_file = new FileHandle;
|
|
open( $log_file, "<$log_name" )
|
|
or return 3;
|
|
my $have_warning = 0;
|
|
my $have_error = 0;
|
|
my $missing_citations = 0;
|
|
my $no_citations = 0;
|
|
my $error_count = 0; # From my counting of error messages
|
|
my $warning_count = 0; # From my counting of warning messages
|
|
# The next two occur only from biber
|
|
my $bibers_error_count = 0; # From biber's counting of errors
|
|
my $bibers_warning_count = 0; # From biber's counting of warnings
|
|
my $not_found_count = 0;
|
|
my $control_file_missing = 0;
|
|
my $control_file_malformed = 0;
|
|
while (<$log_file>) {
|
|
if (/> WARN /) {
|
|
print "Biber warning: $_";
|
|
$have_warning = 1;
|
|
$warning_count ++;
|
|
}
|
|
elsif (/> (FATAL|ERROR) /) {
|
|
print "Biber error: $_";
|
|
if ( /> (FATAL|ERROR) - Cannot find file '([^']+)'/ #'
|
|
|| /> (FATAL|ERROR) - Cannot find '([^']+)'/ ) { #'
|
|
$not_found_count++;
|
|
push @$Pbiber_source, $2;
|
|
}
|
|
elsif ( /> (FATAL|ERROR) - Cannot find control file '([^']+)'/ ) { #'
|
|
$not_found_count++;
|
|
$control_file_missing = 1;
|
|
push @$Pbiber_source, $2;
|
|
}
|
|
elsif ( /> ERROR - .*\.bcf is malformed/ ) {
|
|
# Special treatment: Malformed .bcf file commonly results from error
|
|
# in (pdf)latex run. This error must be ignored.
|
|
$control_file_malformed = 1;
|
|
}
|
|
else {
|
|
$have_error = 1;
|
|
$error_count ++;
|
|
if ( /> (FATAL|ERROR) - The file '[^']+' does not contain any citations!/ ) { #'
|
|
$no_citations++;
|
|
}
|
|
}
|
|
}
|
|
elsif ( /> INFO - Found .* '([^']+)'\s*$/
|
|
|| /> INFO - Found '([^']+)'\s*$/
|
|
|| /> INFO - Reading '([^']+)'\s*$/
|
|
|| /> INFO - Reading (.*)$/
|
|
|| /> INFO - Processing .* file '([^']+)' .*$/
|
|
) {
|
|
if ( defined $Pbiber_source ) {
|
|
push @$Pbiber_source, $1;
|
|
}
|
|
}
|
|
elsif ( /> INFO - WARNINGS: ([\d]+)\s*$/ ) {
|
|
$bibers_warning_count = $1;
|
|
}
|
|
elsif ( /> INFO - ERRORS: ([\d]+)\s*$/ ) {
|
|
$bibers_error_count = $1;
|
|
}
|
|
}
|
|
close $log_file;
|
|
if ($control_file_malformed){return 11;}
|
|
|
|
my @not_found = &find_file_list1( $Pbiber_source, $Pbiber_source,
|
|
'', \@BIBINPUTS );
|
|
@$Pbiber_source = uniqs( @$Pbiber_source );
|
|
if ( ($#not_found < 0) && ($#$Pbiber_source >= 0) ) {
|
|
warn "$My_name: Found biber source file(s) [@$Pbiber_source]\n"
|
|
unless $silent;
|
|
}
|
|
elsif ( ($#not_found == 0) && ($not_found[0] =~ /\.bib$/) ) {
|
|
# Special treatment if sole missing file is bib file
|
|
# I don't want to treat that as an error
|
|
warn "$My_name: Biber did't find bib file [$not_found[0]]\n";
|
|
return 5;
|
|
}
|
|
else {
|
|
show_array( "$My_name: Failed to find one or more biber source files:",
|
|
@not_found );
|
|
if ($force_mode) {
|
|
warn "==== Force_mode is on, so I will continue. ",
|
|
"But there may be problems ===\n";
|
|
}
|
|
if ($control_file_missing) {
|
|
return 6;
|
|
}
|
|
return 4;
|
|
}
|
|
# print "$My_name: #Biber errors = $error_count, warning messages = $warning_count,\n ",
|
|
# "missing citation messages = $missing_citations, no_citations = $no_citations\n";
|
|
if ( ! $have_error && $no_citations ) {
|
|
# If the only errors are missing citations, or lack of citations, that should
|
|
# count as a warning.
|
|
# HOWEVER: biber doesn't generate a new bbl. So it is an error condition.
|
|
return 10;
|
|
}
|
|
if ($have_error) {return 2;}
|
|
if ($have_warning) {return 1;}
|
|
return 0;
|
|
} #END check_biber_log
|
|
|
|
#**************************************************
|
|
|
|
sub run_bibtex {
|
|
my $return = 999;
|
|
if ( $aux_dir ) {
|
|
# Use \Q and \E round directory name in regex to avoid interpretation
|
|
# of metacharacters in directory name:
|
|
if ( $$Psource =~ /^\Q$aux_dir1\E/ ) {
|
|
# Run bibtex in $aux_dir, fixing input search path
|
|
# to allow for finding files in original directory
|
|
my ( $base, $path, $ext ) = fileparseA( $$Psource );
|
|
my $cwd = good_cwd();
|
|
foreach ( 'BIBINPUTS', 'BSTINPUTS' ) {
|
|
if ( exists $ENV{$_} ) {
|
|
$ENV{$_} = $cwd.$search_path_separator.$ENV{$_};
|
|
}
|
|
else {
|
|
$ENV{$_} = $cwd.$search_path_separator;
|
|
}
|
|
}
|
|
pushd( $path );
|
|
$return = &Run_subst( undef, undef, '', $base.$ext, '', $base );
|
|
popd();
|
|
}
|
|
else {
|
|
warn "$My_name: Directory in file name '$$Psource' for bibtex\n",
|
|
" but it is not the output directory '$aux_dir'\n";
|
|
$return = Run_subst();
|
|
}
|
|
}
|
|
else {
|
|
$return = Run_subst();
|
|
}
|
|
return $return;
|
|
}
|
|
|
|
|
|
#**************************************************
|
|
|
|
sub check_bibtex_log {
|
|
# Check for bibtex warnings:
|
|
# Usage: check_bibtex_log( base_of_bibtex_run )
|
|
# return 0: OK, 1: bibtex warnings, 2: bibtex errors,
|
|
# 3: could not open .blg file.
|
|
# 10: only error is missing \citation commands or a missing aux file
|
|
# (which would normally be corrected after a later run of
|
|
# (pdf)latex).
|
|
|
|
my $base = $_[0];
|
|
my $log_name = "$base.blg";
|
|
my $log_file = new FileHandle;
|
|
open( $log_file, "<$log_name" )
|
|
or return 3;
|
|
my $have_warning = 0;
|
|
my $have_error = 0;
|
|
my $missing_citations = 0;
|
|
my @missing_aux = ();
|
|
my $error_count = 0;
|
|
while (<$log_file>) {
|
|
if (/^Warning--/) {
|
|
#print "Bibtex warning: $_";
|
|
$have_warning = 1;
|
|
}
|
|
elsif ( /^I couldn\'t open auxiliary file (.*\.aux)/ ) {
|
|
push @missing_aux, $1;
|
|
}
|
|
elsif ( /^I found no \\citation commands---while reading file/ ) {
|
|
$missing_citations++;
|
|
}
|
|
elsif (/There (were|was) (\d+) error message/) {
|
|
$error_count = $2;
|
|
#print "Bibtex error: count=$error_count $_";
|
|
$have_error = 1;
|
|
}
|
|
}
|
|
close $log_file;
|
|
my $missing = $missing_citations + $#missing_aux + 1;
|
|
|
|
if ( $#missing_aux > -1 ) {
|
|
# Need to make the missing files.
|
|
warn "$My_name: One or more aux files is missing for bibtex. I'll try\n",
|
|
" to get (pdf)latex to remake them.\n";
|
|
rdb_for_some( [keys %current_primaries], sub{ $$Pout_of_date = 1; } );
|
|
}
|
|
#print "Bibtex errors = $error_count, missing aux files and citations = $missing\n";
|
|
if ($have_error && ($error_count <= $missing )
|
|
&& ($missing > 0) ) {
|
|
# If the only error is a missing citation line, that should only
|
|
# count as a warning.
|
|
# Also a missing aux file should be innocuous; it will be created on
|
|
# next run of (pdf)latex. ?? HAVE I HANDLED THAT CORRECTLY?
|
|
# But have to deal with the problem that bibtex gives a non-zero
|
|
# exit code. So leave things as they are so that the user gets
|
|
# a better diagnostic ??????????????????????????
|
|
# $have_error = 0;
|
|
# $have_warning = 1;
|
|
return 10;
|
|
}
|
|
if ($have_error) {return 2;}
|
|
if ($have_warning) {return 1;}
|
|
return 0;
|
|
} #END check_bibtex_log
|
|
|
|
#**************************************************
|
|
|
|
sub normalize_force_directory {
|
|
# Usage, normalize_force_directory( dir, filename )
|
|
# Perform the following operations:
|
|
# Clean filename
|
|
# If filename contains no path component, insert dir in front
|
|
# Normalize filename
|
|
# Return result
|
|
my $default_dir = $_[0];
|
|
my $filename = clean_filename( $_[1] );
|
|
my ($base_name, $path ) = fileparse( $filename );
|
|
if ( $base_name eq $filename ) {
|
|
$filename = "$default_dir$filename";
|
|
}
|
|
return normalize_filename( $filename );
|
|
} #END normalize force_directory
|
|
|
|
# ------------------------------
|
|
|
|
sub parse_log {
|
|
|
|
# Scan log file for: dependent files
|
|
# reference_changed, bad_reference, bad_citation
|
|
# Return value: 1 if success, 0 if no log file.
|
|
# Put results in UPDATES of global variables (which are normally declared
|
|
# local in calling routine, to be suitably scoped):
|
|
# %dependents: maps definite dependents to code:
|
|
# 0 = from missing-file line
|
|
# May have no extension
|
|
# May be missing path
|
|
# 1 = from 'File: ... Graphic file (type ...)' line
|
|
# no path. Should exist, but may need a search, by kpsewhich.
|
|
# 2 = from regular '(...' coding for input file,
|
|
# Has NO path, which it would do if LaTeX file
|
|
# Highly likely to be mis-parsed line
|
|
# 3 = ditto, but has a path character ('/').
|
|
# Should be LaTeX file that exists.
|
|
# If it doesn't exist, we have probably a mis-parsed line.
|
|
# There's no need to do a search.
|
|
# 4 = definitive, which in this subroutine is only done:
|
|
# for default dependents,
|
|
# and for files that exist and are source of conversion
|
|
# reported by epstopdf et al.
|
|
# 5 = Had a missing file line. Now the file exists.
|
|
# 6 = File was written during run. (Overrides 5)
|
|
# 7 = File was created during run to be read in. (Overrides 5 and 6)
|
|
# (e.g., by epstopdf)
|
|
# Treat the following specially, since they have special rules
|
|
# @bbl_files to list of .bbl files.
|
|
# %idx_files to map from .idx files to .ind files.
|
|
# %generated_log: keys give set of files written by (pdf)latex (e.g., aux, idx)
|
|
# as determined by \openout = ... lines in log file.
|
|
# @missing_subdirs = list of needed subdirectories of aux_dir
|
|
# These are needed for writing aux_files when an included file is in
|
|
# a subdirectory relative to the directory of the main TeX file.
|
|
# This variable is only set when the needed subdirectories don't exist,
|
|
# and the aux_dir is non-trivial, which results in an error message in
|
|
# the log file
|
|
# %conversions Internally made conversions from one file to another
|
|
#
|
|
# These may have earlier found information in them, so they should NOT
|
|
# be initialized.
|
|
#
|
|
# Also SET
|
|
# $reference_changed, $bad_reference, $bad_citation
|
|
# $pwd_latex
|
|
#
|
|
# Put in trivial or default values if log file does not exist/cannot be opened
|
|
#
|
|
# Input globals: $primary_out, $fls_file_analyzed
|
|
#
|
|
|
|
|
|
# Give a quick way of looking up custom-dependency extensions
|
|
my %cusdep_from = ();
|
|
my %cusdep_to = ();
|
|
foreach ( @cus_dep_list ) {
|
|
my ($fromext, $toext) = split;
|
|
$cusdep_from{$fromext} = $cusdep_from{".$fromext"} = $_;
|
|
$cusdep_to{$toext} = $cusdep_to{".$toext"} = $_;
|
|
}
|
|
# print "==== Cusdep from-exts:"; foreach (keys %cusdep_from) {print " '$_'";} print "\n";
|
|
# print "==== Cusdep to-exts:"; foreach (keys %cusdep_to) {print " '$_'";} print "\n";
|
|
|
|
|
|
# Filenames given in log file may be preceded by a pathname
|
|
# denoting current directory. In MiKTeX, this is an absolute
|
|
# pathname; in TeXLive, it is './'. Either way, we'll want to
|
|
# remove this pathname string --- see the comments in sub
|
|
# rdb_set_latex_deps. In order of reliability for use in
|
|
# normalizing filenames from the log file, the following forms
|
|
# of the cwd are used:
|
|
# (a) internally deduced pwd from log file from sequence of lines
|
|
# **file
|
|
# (dir/file
|
|
# if possible. NO THAT'S WRONG if kpsearch is done.
|
|
# (b) from PWD line in fls file (if available), passed as $pwd_latex
|
|
# (c) system-given cwd as interpreted by sub good_cwd.
|
|
# We'll put the first two in @pwd_log
|
|
my @pwd_log = ();
|
|
if ($pwd_latex) { push @pwd_log, $pwd_latex; }
|
|
|
|
# $primary_out is actual output file (dvi or pdf)
|
|
# It is initialized before the call to this routine, to ensure
|
|
# a sensible default in case of misparsing
|
|
|
|
$reference_changed = 0;
|
|
$mult_defined = 0;
|
|
$bad_reference = 0;
|
|
$bad_citation = 0;
|
|
|
|
my $log_file = new FileHandle;
|
|
if ( ! open( $log_file, "<$log_name" ) ) {
|
|
return 0;
|
|
}
|
|
if ($log_file_binary) { binmode $log_file; }
|
|
# Collect lines of log file
|
|
my @lines = ();
|
|
my $line = 0;
|
|
my $engine = 'pdfTeX'; # Simple default in case of problems
|
|
while(<$log_file>) {
|
|
$line++;
|
|
# Could use chomp here, but that fails if there is a mismatch
|
|
# between the end-of-line sequence used by latex and that
|
|
# used by perl. (Notably a problem with MSWin latex and
|
|
# cygwin perl!)
|
|
s/[\n\r]*$//;
|
|
# Handle wrapped lines:
|
|
# They are lines brutally broken at exactly $log_wrap chars
|
|
# excluding line-end. Sometimes a line $log_wrap chars
|
|
# long is an ordinary line, sometimes it is part of a line
|
|
# that was wrapped. To handle all cases, I keep both
|
|
# options open by putting the line into @lines before
|
|
# and after appending the next line:
|
|
my $len = length($_);
|
|
if ($line == 1) {
|
|
if ( /^This is ([^,]+), / ) {
|
|
$engine = $1;
|
|
print "=== TeX engine is '$engine'\n"
|
|
if (!$silent);
|
|
}
|
|
else {
|
|
warn "$My_name: First line of .log file '$log_name' is not in standard format.\n";
|
|
}
|
|
}
|
|
else {
|
|
# LuaTeX sometimes wraps at 80 instead of 79, so work around this
|
|
while ( ( ($len == $log_wrap) || ( ($engine eq 'LuaTeX') && ($len == $log_wrap+1) ) )
|
|
&& !eof($log_file) ) {
|
|
push @lines, $_;
|
|
my $extra = <$log_file>;
|
|
$extra =~ s/[\n\r]*$//;
|
|
$len = length($extra);
|
|
$_ .= $extra;
|
|
}
|
|
}
|
|
push @lines, $_;
|
|
}
|
|
close $log_file;
|
|
|
|
push @lines, ""; # Blank line to terminate. So multiline blocks
|
|
# are always terminated by non-block line, rather than eof.
|
|
|
|
$line = 0;
|
|
my $state = 0; # 0 => before ** line,
|
|
# 1 => after **filename line, before next line (first file-reading line)
|
|
# 2 => pwd_log determined.
|
|
# For parsing multiple line blocks of info
|
|
my $current_pkg = ""; # non-empty string for package name, if in
|
|
# middle of parsing multi-line block of form:
|
|
# Package name ....
|
|
# (name) ...
|
|
# ...
|
|
my $block_type = ""; # Specify information in such a block
|
|
my $delegated_source = ""; # If it is a file conversion, specify source
|
|
my $delegated_output = ""; # and output file. (Don't put in
|
|
# data structure until block is ended.)
|
|
my %new_conversions = ();
|
|
my @retries = ();
|
|
my $log_silent = ($silent || $silence_logfile_warnings);
|
|
my @warning_list = ();
|
|
LINE:
|
|
while( ($line <= $#lines) || ($#retries > -1) ) {
|
|
if ($#retries > -1) {
|
|
$_ = pop @retries;
|
|
}
|
|
else {
|
|
$_ = $lines[$line];
|
|
$line ++;
|
|
}
|
|
if ( /^! pdfTeX warning/ || /^pdfTeX warning/ ) {
|
|
# This kind of warning is produced by some versions of pdftex
|
|
# or produced by my reparse of warnings from other
|
|
# versions.
|
|
next;
|
|
}
|
|
elsif ( /^(.+)(pdfTeX warning.*)$/ ) {
|
|
# Line contains a pdfTeX warnings that may have been
|
|
# inserted directly after other material without an
|
|
# intervening new line. I think pdfTeX always inserts a
|
|
# newline after the warning. (From examination of source
|
|
# code.)
|
|
push @retries, $1;
|
|
# But continue parsing the original line, in case it was a
|
|
# misparse, e.g., of a filename ending in 'pdfTeX';
|
|
}
|
|
if ( $line == 1 ){
|
|
if ( /^This is / ) {
|
|
# First line OK
|
|
next LINE;
|
|
} else {
|
|
warn "$My_name: Error on first line of '$log_name'.\n".
|
|
"This is apparently not a TeX log file. ",
|
|
"The first line is:\n$_\n";
|
|
$failure = 1;
|
|
$failure_msg = "Log file '$log_name' appears to have wrong format.";
|
|
return 0;
|
|
}
|
|
}
|
|
|
|
if ( ($state == 0) && /^\*\*(.*)$/ ) {
|
|
# Line containing first line specified to tex
|
|
# It's either a filename or a command starting with \
|
|
my $first = $1;
|
|
$state = 1;
|
|
if ( ! /^\\/ ) {
|
|
$source_log = $first;
|
|
if ( -e "$source_log.tex" ) { $source_log .= '.tex'; }
|
|
}
|
|
else {
|
|
$state = 2;
|
|
}
|
|
next LINE;
|
|
}
|
|
elsif ( $state == 1 ) {
|
|
$state = 2;
|
|
if (-e $source_log) {
|
|
# then the string preceeding $source_log on the line after the
|
|
# ** line is probably the PWD as it appears in filenames in the
|
|
# log file, except if the file appears in two locations.
|
|
if ( m{^\("([^"]*)[/\\]\Q$source_log\E"} ) {
|
|
unshift @pwd_log, $1;
|
|
}
|
|
elsif ( m{^\((.*)[/\\]\Q$source_log\E} ) {
|
|
unshift @pwd_log, $1;
|
|
}
|
|
}
|
|
}
|
|
|
|
if ( $block_type ) {
|
|
# In middle of parsing block
|
|
if ( /^\($current_pkg\)/ ) {
|
|
# Block continues
|
|
if ( ($block_type eq 'conversion')
|
|
&& /^\($current_pkg\)\s+Output file: <([^>]+)>/ )
|
|
{
|
|
$delegated_output = normalize_clean_filename($1, @pwd_log);
|
|
}
|
|
next LINE;
|
|
}
|
|
# Block has ended.
|
|
if ($block_type eq 'conversion') {
|
|
#print "=== $delegated_source -> $delegated_output\n";
|
|
$new_conversions{$delegated_source} = $delegated_output;
|
|
}
|
|
$current_pkg = $block_type
|
|
= $delegated_source = $delegated_output = "";
|
|
# Then process current line
|
|
}
|
|
|
|
# Check for changed references, bad references and bad citations:
|
|
if (/Rerun to get/) {
|
|
warn "$My_name: References changed.\n" if ! $log_silent;
|
|
$reference_changed = 1;
|
|
}
|
|
if (/^LaTeX Warning: (Reference[^\001]*undefined on input line .*)\./) {
|
|
push @warning_list, $1;
|
|
$bad_reference++;
|
|
}
|
|
elsif (/^LaTeX Warning: (Label [^\001]* multiply defined.*)\./) {
|
|
push @warning_list, $1;
|
|
$mult_defined++;
|
|
}
|
|
elsif (/^LaTeX Warning: (Citation[^\001]*undefined on input line .*)\./) {
|
|
push @warning_list, $1;
|
|
$bad_citation++;
|
|
}
|
|
elsif (/^Package natbib Warning: (Citation[^\001]*undefined on input line .*)\./) {
|
|
push @warning_list, $1;
|
|
$bad_citation++;
|
|
}
|
|
elsif ( /^Document Class: / ) {
|
|
# Class sign-on line
|
|
next LINE;
|
|
}
|
|
elsif ( /^\(Font\)/ ) {
|
|
# Font info line
|
|
next LINE;
|
|
}
|
|
elsif (/^No pages of output\./) {
|
|
$primary_out = '';
|
|
warn "$My_name: Log file says no output from latex\n";
|
|
next LINE;
|
|
}
|
|
elsif ( /^Output written on\s+(.*)\s+\(\d+\s+page/ ) {
|
|
$primary_out = normalize_clean_filename($1, @pwd_log);
|
|
warn "$My_name: Log file says output to '$primary_out'\n"
|
|
unless $silent;
|
|
next LINE;
|
|
}
|
|
elsif ( /^Overfull /
|
|
|| /^Underfull /
|
|
|| /^or enter new name\. \(Default extension: .*\)/
|
|
|| /^\*\*\* \(cannot \\read from terminal in nonstop modes\)/
|
|
) {
|
|
# Latex error/warning, etc.
|
|
next LINE;
|
|
}
|
|
elsif ( /^\\openout\d+\s*=\s*\`([^\']+)\'\.$/ ) {
|
|
# When (pdf)latex is run with an -output-directory
|
|
# or an -aux_directory, the file name does not contain
|
|
# the output path; fix this, after removing quotes:
|
|
$generated_log{normalize_force_directory( $aux_dir1, $1 )} = 1;
|
|
next LINE;
|
|
}
|
|
# Test for conversion produced by package:
|
|
elsif ( /^Package (\S+) Info: Source file: <([^>]+)>/ ) {
|
|
# Info. produced by epstopdf (and possibly others)
|
|
# about file conversion
|
|
$current_pkg = normalize_clean_filename($1, @pwd_log);
|
|
$delegated_source = normalize_clean_filename($2, @pwd_log);
|
|
$block_type = 'conversion';
|
|
next LINE;
|
|
}
|
|
# Test for writing of index file. The precise format of the message
|
|
# depends on which package (makeidx.sty , multind.sty or index.sty) and
|
|
# which version writes the message.
|
|
elsif ( /Writing index file (.*)$/ ) {
|
|
my $idx_file = '';
|
|
if ( /^Writing index file (.*)$/ ) {
|
|
# From makeidx.sty or multind.sty
|
|
$idx_file = $1;
|
|
}
|
|
elsif ( /^index\.sty> Writing index file (.*)$/ ) {
|
|
# From old versions of index.sty
|
|
$idx_file = $1;
|
|
}
|
|
elsif ( /^Package \S* Info: Writing index file (.*) on input line/ ) {
|
|
# From new versions of index.sty
|
|
$idx_file = $1;
|
|
}
|
|
else {
|
|
warn "$My_name: Message indicates index file was written\n",
|
|
" ==> but I do not know how to understand it: <==\n",
|
|
" '$_'\n";
|
|
next LINE;
|
|
}
|
|
# Typically, there is trailing space, not part of filename:
|
|
$idx_file =~ s/\s*$//;
|
|
# When (pdf)latex is run with an -output-directory
|
|
# or an -aux_directory, the file name does not contain
|
|
# the output path; fix this, after removing quotes:
|
|
$idx_file = normalize_force_directory( $aux_dir1, $idx_file );
|
|
my ($idx_base, $idx_path, $idx_ext) = fileparseA( $idx_file );
|
|
$idx_base = $idx_path.$idx_base;
|
|
$idx_file = $idx_base.$idx_ext;
|
|
if ( $idx_ext eq '.idx' ) {
|
|
warn "$My_name: Index file '$idx_file' was written\n"
|
|
unless $silent;
|
|
$idx_files{$idx_file} = [ "$idx_base.ind", $idx_base ];
|
|
}
|
|
elsif ( exists $cusdep_from{$idx_ext} ) {
|
|
if ( !$silent ) {
|
|
warn "$My_name: Index file '$idx_file' was written\n";
|
|
warn " Cusdep '$cusdep_from{$idx_ext}' should be used\n";
|
|
}
|
|
# No action needed here
|
|
}
|
|
else {
|
|
warn "$My_name: Index file '$idx_file' written\n",
|
|
" ==> but it has an extension I do not know how to handle <==\n";
|
|
}
|
|
|
|
next LINE;
|
|
}
|
|
elsif ( /^No file (.*?\.bbl)./ ) {
|
|
# When (pdf)latex is run with an -output-directory
|
|
# or an -aux_directory, the file name does not contain
|
|
# the output path; fix this, after removing quotes:
|
|
my $bbl_file = normalize_force_directory( $aux_dir1, $1 );
|
|
warn "$My_name: Non-existent bbl file '$bbl_file'\n $_\n";
|
|
$dependents{$bbl_file} = 0;
|
|
push @bbl_files, $bbl_file;
|
|
next LINE;
|
|
}
|
|
foreach my $pattern (@file_not_found) {
|
|
if ( /$pattern/ ) {
|
|
my $file = clean_filename($1);
|
|
warn "===========$My_name: Missing input file: '$file' from line\n '$_'\n";
|
|
warn "$My_name: Missing input file: '$file' from line\n '$_'\n"
|
|
unless $silent;
|
|
$dependents{normalize_filename($file, @pwd_log)} = 0;
|
|
my $file1 = $file;
|
|
if ( $aux_dir ) {
|
|
# Allow for the possibility that latex generated
|
|
# a file in $aux_dir, from which the missing file can
|
|
# be created by a cusdep (or other) rule that puts
|
|
# the result in $out_dir. If the announced missing file
|
|
# has no path, then it would be effectively a missing
|
|
# file in $aux_dir, with a path. So give this alternate
|
|
# location.
|
|
my $file1 = normalize_force_directory( $aux_dir1, $file );
|
|
$dependents{$file1} = 0;
|
|
}
|
|
next LINE;
|
|
}
|
|
}
|
|
if ( (! $fls_file_analyzed)
|
|
&& /^File: (.+) Graphic file \(type / ) {
|
|
# First line of message from includegraphics/x
|
|
# But this does NOT include full path information
|
|
# (if exact match is not found and a non-trivial
|
|
# kpsearch was done by (pdf)latex).
|
|
# But the source-file information is in the fls file,
|
|
# if we are using it.
|
|
$dependents{normalize_clean_filename($1, @pwd_log)} = 1;
|
|
next LINE;
|
|
}
|
|
# Now test for generic lines to ignore, only after special cases!
|
|
if ( /^File: / ) {
|
|
# Package sign-on line. Includegraphics/x also produces a line
|
|
# with this signature, but I've already handled it.
|
|
next LINE;
|
|
}
|
|
if ( /^Package: / ) {
|
|
# Package sign-on line
|
|
next LINE;
|
|
}
|
|
if (/^\! LaTeX Error: / ) {
|
|
next LINE;
|
|
}
|
|
if ( m[^! I can't write on file `(.*)/([^/']*)'.\s*$] ) {
|
|
my $dir = $1;
|
|
my $file = $2;
|
|
my $full_dir = $aux_dir1.$dir;
|
|
if ( ($aux_dir ne '') && (! -e $full_dir) && ( $file =~ /\.aux$/) ) {
|
|
warn "$My_name: === There were problems writing to '$file' in '$full_dir'\n",
|
|
" I'll try to make the subdirectory later.\n"
|
|
if $diagnostics;
|
|
push @missing_subdirs, $full_dir;
|
|
}
|
|
else {
|
|
warn "$My_name: ====== There were problems writing to",
|
|
"----- '$file' in '$full_dir'.\n",
|
|
"----- But this is not the standard situation of\n",
|
|
"----- aux file to subdir of output directory, with\n",
|
|
"----- non-existent subdir\n",
|
|
}
|
|
}
|
|
|
|
if ( ($fls_file_analyzed) && (! $analyze_input_log_always) ) {
|
|
# Skip the last part, which is all about finding input
|
|
# file names which should all appear more reliably in the
|
|
# fls file.
|
|
next LINE;
|
|
}
|
|
|
|
my @new_includes = ();
|
|
|
|
GRAPHICS_INCLUDE_CANDIDATE:
|
|
while ( /<([^>]+)(>|$)/g ) {
|
|
if ( -f $1 ) { push @new_includes, $1; }
|
|
} # GRAPHICS_INCLUDE_CANDIDATE:
|
|
|
|
INCLUDE_CANDIDATE:
|
|
while ( /\((.*$)/ ) {
|
|
# Filename found by
|
|
# '(', then filename, then terminator.
|
|
# Terminators: obvious candidates: ')': end of reading file
|
|
# '(': beginning of next file
|
|
# ' ': space is an obvious separator
|
|
# ' [': start of page: latex
|
|
# and pdflatex put a
|
|
# space before the '['
|
|
# '[': start of config file
|
|
# in pdflatex, after
|
|
# basefilename.
|
|
# '{': some kind of grouping
|
|
# Problem:
|
|
# All or almost all special characters are allowed in
|
|
# filenames under some OS, notably UNIX. Luckily most cases
|
|
# are rare, if only because the special characters need
|
|
# escaping. BUT 2 important cases are characters that are
|
|
# natural punctuation
|
|
# Under MSWin, spaces are common (e.g., "C:\Program Files")
|
|
# Under VAX/VMS, '[' delimits directory names. This is
|
|
# tricky to handle. But I think few users use this OS
|
|
# anymore.
|
|
#
|
|
# Solution: use ' [', but not '[' as first try at delimiter.
|
|
# Then if candidate filename is of form 'name1[name2]', then
|
|
# try splitting it. If 'name1' and/or 'name2' exists, put
|
|
# it/them in list, else just put 'name1[name2]' in list.
|
|
# So form of filename is now:
|
|
# '(',
|
|
# then any number of characters that are NOT ')', '(', or '{'
|
|
# (these form the filename);
|
|
# then ' [', or ' (', or ')', or end-of-string.
|
|
# That fails for pdflatex
|
|
# In log file:
|
|
# '(' => start of reading of file, followed by filename
|
|
# ')' => end of reading of file
|
|
# '[' => start of page (normally preceeded by space)
|
|
# Remember:
|
|
# filename (on VAX/VMS) may include '[' and ']' (directory
|
|
# separators)
|
|
# filenames (on MS-Win) commonly include space.
|
|
# filenames on UNIX can included space.
|
|
# Miktex quotes filenames
|
|
# But web2c doesn't. Then
|
|
# (string message
|
|
# is ambiguous: is the filename "string" or "string message".
|
|
# Allow both as candidates, since user filenames with spaces
|
|
# are rare. System filenames with spaces are common, but
|
|
# they are normally followed by a newline rather than messages.
|
|
|
|
# First step: replace $_ by whole of line after the '('
|
|
# Thus $_ is putative filename followed by other stuff.
|
|
$_ = $1;
|
|
# Array of new candidate include files; sometimes more than one.
|
|
my $quoted = 0;
|
|
if ( /^\"([^\"]+)\"/ ) {
|
|
# Quoted file name, as from MikTeX
|
|
$quoted = 1;
|
|
}
|
|
elsif ( /^([^\(^\)]*?)\s+[\[\{\<]/ ) {
|
|
# Terminator: space then '[' or '{' or '<'
|
|
# Use *? in condition: to pick up first ' [' (etc)
|
|
# as terminator
|
|
}
|
|
elsif ( /^([^\(^\)]*)\s+(?=\()/ ) {
|
|
# Terminator is ' (', but '(' isn't in matched string,
|
|
# so we keep the '(' ready for the next match
|
|
}
|
|
elsif ( /^([^\(^\)]*)(\))/ ) {
|
|
# Terminator is ')'
|
|
}
|
|
else {
|
|
#Terminator is end-of-string
|
|
}
|
|
$_ = $'; # Put $_ equal to the unmatched tail of string '
|
|
my $include_candidate = $1;
|
|
$include_candidate =~ s/\s*$//; # Remove trailing space.
|
|
if ( !$quoted && ($include_candidate =~ /(\S+)\s/ ) ){
|
|
# Non-space-containing filename-candidate
|
|
# followed by space followed by message
|
|
# (Common)
|
|
push @new_includes, $1;
|
|
}
|
|
if ( $include_candidate eq "[]" ) {
|
|
# Part of overfull hbox message
|
|
next INCLUDE_CANDIDATE;
|
|
}
|
|
if ( $include_candidate =~ /^\\/ ) {
|
|
# Part of font message
|
|
next INCLUDE_CANDIDATE;
|
|
}
|
|
# Remove quotes around filename, as for MikTeX. I've already
|
|
# treated this as a special case. For safety check here:
|
|
$include_candidate =~ s/^\"(.*)\"$/$1/;
|
|
|
|
push @new_includes, $include_candidate;
|
|
if ( $include_candidate =~ /^(.+)\[([^\]]+)\]$/ ) {
|
|
# Construct of form 'file1[file2]', as produced by pdflatex
|
|
if ( -e $1 ) {
|
|
# If the first component exists, we probably have the
|
|
# pdflatex form
|
|
push @new_includes, $1, $2;
|
|
}
|
|
else {
|
|
# We have something else.
|
|
# So leave the original candidate in the list
|
|
}
|
|
}
|
|
} # INCLUDE_CANDIDATE
|
|
|
|
INCLUDE_NAME:
|
|
foreach my $include_name (@new_includes) {
|
|
$include_name = normalize_filename( $include_name, @pwd_log );
|
|
my ($base, $path, $ext) = fileparseB( $include_name );
|
|
if ( ($path eq './') || ($path eq '.\\') ) {
|
|
$include_name = $base.$ext;
|
|
}
|
|
if ( $include_name !~ m'[/|\\]' ) {
|
|
# Filename does not include a path character
|
|
# High potential for misparsed line
|
|
$dependents{$include_name} = 2;
|
|
} else {
|
|
$dependents{$include_name} = 3;
|
|
}
|
|
if ( $ext eq '.bbl' ) {
|
|
warn "$My_name: Found input bbl file '$include_name'\n"
|
|
unless $silent;
|
|
push @bbl_files, $include_name;
|
|
}
|
|
} # INCLUDE_NAME
|
|
} # LINE
|
|
|
|
# Default includes are always definitive:
|
|
foreach (@default_includes) { $dependents{$_} = 4; }
|
|
|
|
###print "New parse: \n";
|
|
###foreach (sort keys %dependents) { print " '$_': $dependents{$_}\n"; }
|
|
|
|
my @misparsed = ();
|
|
my @missing = ();
|
|
my @not_found = ();
|
|
|
|
my %kpsearch_candidates = ();
|
|
CANDIDATE:
|
|
foreach my $candidate (keys %dependents) {
|
|
my $code = $dependents{$candidate};
|
|
if ( -d $candidate ) {
|
|
# If $candidate is directory, it was presumably found from a
|
|
# mis-parse, so remove it from the list. (Misparse can
|
|
# arise, for example from a mismatch of latexmk's $log_wrap
|
|
# value and texmf.cnf value of max_print_line.)
|
|
delete $dependents{$candidate};
|
|
}
|
|
elsif ( -e $candidate ) {
|
|
if ( exists $generated_log{$candidate} ){
|
|
$dependents{$candidate} = 6;
|
|
}
|
|
elsif ($code == 0) {
|
|
$dependents{$candidate} = 5;
|
|
}
|
|
else {
|
|
$dependents{$candidate} = 4;
|
|
}
|
|
}
|
|
elsif ($code == 1) {
|
|
# Graphics file that is supposed to have been read.
|
|
# Candidate name is as given in source file, not as path
|
|
# to actual file.
|
|
# We have already tested that file doesn't exist, as given.
|
|
# so use kpsewhich.
|
|
# If the file still is not found, assume non-existent;
|
|
$kpsearch_candidates{$candidate} = 1;
|
|
delete $dependents{$candidate};
|
|
}
|
|
elsif ($code == 2) {
|
|
# Candidate is from '(...' construct in log file, for input file
|
|
# which should include pathname if valid input file.
|
|
# Name does not have pathname-characteristic character (hence
|
|
# $code==2.
|
|
# We get here if candidate file does not exist with given name
|
|
# Almost surely result of a misparsed line in log file.
|
|
delete $dependents{$candidate};
|
|
push @misparse, $candidate;
|
|
}
|
|
elsif ($code == 3) {
|
|
# Candidate is from '(...' construct in log file, for input file
|
|
# which should include pathname if valid input file.
|
|
# Name does have pathname-characteristic character (hence
|
|
# $code==3.
|
|
# But we get here only if candidate file does not exist with
|
|
# given name.
|
|
# Almost surely result of a misparsed line in log file.
|
|
# But with lower probability than $code == 2
|
|
delete $dependents{$candidate};
|
|
push @misparse, $candidate;
|
|
}
|
|
elsif ($code == 0) {
|
|
my ($base, $path, $ext) = fileparseA($candidate);
|
|
$ext =~ s/^\.//;
|
|
if ( ($ext eq '') && (-e "$path$base.tex") ) {
|
|
# I don't think the old version was correct.
|
|
# If the missing-file report was of a bare
|
|
# extensionless file, and a corresponding .tex file
|
|
# exists, then the missing file does not correspond
|
|
# to the missing file, unless the .tex file was
|
|
# created during the run.
|
|
# OLD $dependents{"$path$base.tex"} = 4;
|
|
# OLD delete $dependents{$candidate};
|
|
# NEW:
|
|
$dependents{"$path$base.tex"} = 4;
|
|
}
|
|
push @missing, $candidate;
|
|
}
|
|
}
|
|
|
|
my @kpsearch_candidates = keys %kpsearch_candidates;
|
|
if (@kpsearch_candidates) {
|
|
foreach my $result ( kpsewhich( @kpsearch_candidates ) ) {
|
|
$dependents{$result} = 4;
|
|
}
|
|
}
|
|
|
|
CANDIDATE_PAIR:
|
|
foreach my $delegated_source (keys %new_conversions) {
|
|
my $delegated_output = $new_conversions{$delegated_source};
|
|
my $rule = "Delegated $delegated_source, $delegated_output";
|
|
# N.B. $delegated_source eq '' means the output file
|
|
# was created without a named input file.
|
|
foreach my $candidate ($delegated_source, $delegated_output) {
|
|
if (! -e $candidate ) {
|
|
# The file might be somewhere that can be found
|
|
# in the search path of kpathsea:
|
|
my @kpse_result = kpsewhich( $candidate,);
|
|
if ($#kpse_result > -1) {
|
|
$candidate = $kpse_result[0];
|
|
}
|
|
}
|
|
}
|
|
if ( ( (-e $delegated_source) || ($delegated_source eq '') )
|
|
&& (-e $delegated_output) )
|
|
{
|
|
$conversions{$delegated_output} = $delegated_source;
|
|
$dependents{$delegated_output} = 7;
|
|
if ($delegated_source) {
|
|
$dependents{$delegated_source} = 4;
|
|
}
|
|
}
|
|
elsif (!$silent) {
|
|
print "Logfile claimed conversion from '$delegated_source' ",
|
|
"to '$delegated_output'. But:\n";
|
|
if (! -e $delegated_output) {
|
|
print " Output file does not exist\n";
|
|
}
|
|
if ( ($delegated_source ne '') && (! -e $delegated_source) ) {
|
|
print " Input file does not exist\n";
|
|
}
|
|
}
|
|
}
|
|
|
|
if ( ($#warning_list >= 0) && !$log_silent ) {
|
|
@warning_list = uniqs( @warning_list );
|
|
show_array( "$My_name: List of undefined refs and citations:",
|
|
@warning_list );
|
|
}
|
|
|
|
if ( $diagnostics ) {
|
|
@misparse = uniqs( @misparse );
|
|
@missing = uniqs( @missing );
|
|
@not_found = uniqs( @not_found );
|
|
my @dependents = sort( keys %dependents );
|
|
|
|
my $dependents = $#dependents + 1;
|
|
my $misparse = $#misparse + 1;
|
|
my $missing = $#missing + 1;
|
|
my $not_found = $#not_found + 1;
|
|
my $exist = $dependents - $not_found - $missing;
|
|
my $bbl = $#bbl_files + 1;
|
|
|
|
print "$dependents dependent files detected, of which ",
|
|
"$exist exist, $not_found were not found,\n",
|
|
" and $missing appear not to exist.\n";
|
|
print "Dependents:\n";
|
|
foreach (@dependents) {
|
|
print " '$_' ";
|
|
if ( $dependents{$_} == 6 ) { print " written by (pdf)latex";}
|
|
if ( $dependents{$_} == 7 ) { print " converted by (pdf)latex";}
|
|
print "\n";
|
|
}
|
|
if ($not_found > 0) {
|
|
print "Not found:\n";
|
|
foreach (@not_found) { print " $_\n"; }
|
|
}
|
|
if ($missing > 0) {
|
|
print "Not existent:\n";
|
|
foreach (@missing) { print " $_\n"; }
|
|
}
|
|
if ( $bbl > 0 ) {
|
|
print "Input bbl files:\n";
|
|
foreach (@bbl_files) { print " $_\n"; }
|
|
}
|
|
|
|
if ( $misparse > 0 ) {
|
|
print "Possible input files, perhaps from misunderstood lines in .log file:\n";
|
|
foreach ( @misparse ) { print " $_\n"; }
|
|
}
|
|
}
|
|
return 1;
|
|
} #END parse_log
|
|
|
|
#************************************************************
|
|
|
|
sub parse_fls {
|
|
my ($fls_name, $Pinputs, $Poutputs, $Pfirst_read_after_write, $Ppwd_latex ) = @_;
|
|
%$Pinputs = %$Poutputs = %$Pfirst_read_after_write = ();
|
|
my $fls_file = new FileHandle;
|
|
# Make a note of current working directory
|
|
# I'll update it from the fls file later
|
|
# Currently I don't use this, but it would be useful to use
|
|
# this when testing prefix for cwd in a filename, by
|
|
# giving (pdf)latex's best view of the cwd. Note that the
|
|
# value given by the cwd() function may be mangled, e.g., by cygwin
|
|
# compared with native MSWin32.
|
|
#
|
|
# Two relevant forms of cwd exist: The system one, which we can find, and
|
|
# the one reported by (pdf)latex in the fls file. It will be
|
|
# useful to remove leading part of cwd in filenames --- see the
|
|
# comments in sub rdb_set_latex_deps. Given the possible multiplicity
|
|
# of representations of cwd, the one reported in the fls file should
|
|
# be definitive in the fls file.
|
|
|
|
my $cwd = good_cwd();
|
|
if ( ! open ($fls_file, "<$fls_name") ) {
|
|
return 1;
|
|
}
|
|
foreach $_ ( <$fls_file> ) {
|
|
# Remove trailing CR and LF. Thus we get correct behavior when an fls file
|
|
# is produced by MS-Windows program (e.g., in MiKTeX) with CRLF line ends,
|
|
# but is read by Unix Perl (which treats LF as line end, and preserves CRLF
|
|
# in read-in lines):
|
|
$_ =~ s/[\n\r]*$//;
|
|
if (/^\s*PWD\s+(.*)$/) {
|
|
$cwd = $1;
|
|
$$Ppwd_latex = $cwd;
|
|
}
|
|
elsif (/^\s*INPUT\s+(.*)$/) {
|
|
# Take precautions against aliasing of foo, ./foo and other possibilities for cwd.
|
|
my $file = $1;
|
|
# Remove exactly pwd reported in this file, and following separator.
|
|
# MiKTeX reports absolute pathnames, and this way of removing PWD insulates
|
|
# us from coding issues if the PWD contains non-ASCII characters. What
|
|
# coding scheme (UTF-8, code page, etc) is used depends on OS, TeX
|
|
# implementation, ...
|
|
$file =~ s(^\Q$$Ppwd_latex\E[\\/])();
|
|
$file = normalize_filename( $file );
|
|
if ( (exists $$Poutputs{$file}) && (! exists $$Pinputs{$file}) ) {
|
|
$$Pfirst_read_after_write{$file} = 1;
|
|
}
|
|
$$Pinputs{$file} = 1;
|
|
}
|
|
elsif (/^\s*OUTPUT\s+(.*)$/) {
|
|
# Take precautions against aliasing of foo, ./foo and other possibilities for cwd.
|
|
my $file = $1;
|
|
$file =~ s(^\Q$$Ppwd_latex\E[\\/])();
|
|
$$Poutputs{ normalize_filename( $file )} = 1;
|
|
}
|
|
}
|
|
close( $fls_file );
|
|
return 0;
|
|
} #END parse_fls
|
|
|
|
#************************************************************
|
|
|
|
sub clean_filename {
|
|
# Convert quoted filename as found in log file to filename without quotes
|
|
# Allows arbitrarily embedded double-quoted substrings, includes the
|
|
# cases
|
|
# 1. `"string".ext', which arises e.g., from \jobname.bbl:
|
|
# when the base filename contains spaces, \jobname has quotes.
|
|
# and from \includegraphics with basename specified.
|
|
# Also deals with filenames written by asymptote.sty
|
|
# 2. Or "string.ext" from \includegraphcs with basename and ext specified.
|
|
# and from MiKTeX logfile for input files with spaces.
|
|
# Doubled quotes (e.g., A""B) don't get converted.
|
|
# Neither do unmatched quotes.
|
|
my $filename = $_[0];
|
|
while ( $filename =~ s/^([^\"]*)\"([^\"]+)\"(.*)$/$1$2$3/ ) {}
|
|
return $filename;
|
|
}
|
|
|
|
# ------------------------------
|
|
|
|
sub normalize_filename {
|
|
# Usage: normalize_filename( filename [, extra forms of name of cwd] )
|
|
# Returns filename with removal of various forms for cwd, and
|
|
# with conversion of directory separator to '/' only
|
|
#
|
|
my ( $file, @dirs ) = @_;
|
|
my $file1 = $file; # Saved original value
|
|
my $cwd = good_cwd();
|
|
# Normalize files to use / to separate directory components:
|
|
# (Note both / and \ are allowed under MSWin.)
|
|
foreach ($cwd, $file, @dirs) {
|
|
s(\\)(/)g;
|
|
}
|
|
# Remove initial component equal to current working directory.
|
|
# Use \Q and \E round directory name in regex to avoid interpretation
|
|
# of metacharacters in directory name:
|
|
foreach my $dir ( @dirs, '.', $cwd ) {
|
|
if ( $file =~ s(^\Q$dir\E/)() ) {
|
|
last;
|
|
}
|
|
}
|
|
return $file;
|
|
}
|
|
|
|
# ------------------------------
|
|
|
|
sub normalize_clean_filename {
|
|
# Usage: normalize_clean_filename( filename [, extra forms of name of cwd] )
|
|
# Same as normalize_filename, but first remove any double quotes, as
|
|
# done by clean_filename, which is appropriate for filenames from log file.
|
|
my ($file, @dirs) = @_;
|
|
return normalize_filename( clean_filename( $file ) , @dirs );
|
|
}
|
|
|
|
#************************************************************
|
|
|
|
sub fix_pattern {
|
|
# Escape the characters [ and {, to give a pattern for use in glob
|
|
# with these characters taken literally.
|
|
my $pattern = shift;
|
|
$pattern =~ s/\[/\\\[/g;
|
|
$pattern =~ s/\{/\\\{/g;
|
|
return $pattern;
|
|
}
|
|
|
|
#************************************************************
|
|
|
|
sub OS_preferred_filename {
|
|
# Usage: OS_preferred_filename(name)
|
|
# Returns filename with directory separator '/' converted
|
|
# to preferred conventions for current OS.
|
|
# Currently implemented: only '\' for MSWin32
|
|
my $file = $_[0];
|
|
if ( $^O eq 'MSWin32' ) {
|
|
$file =~ s(/)(\\)g;
|
|
}
|
|
return $file;
|
|
}
|
|
|
|
#************************************************************
|
|
|
|
sub parse_aux {
|
|
#Usage: parse_aux( $aux_file, \@new_bib_files, \@new_aux_files, \@new_bst_files )
|
|
# Parse aux_file (recursively) for bib files, and bst files.
|
|
# If can't open aux file, then
|
|
# Return 0 and leave @new_bib_files empty
|
|
# Else set @new_bib_files from information in the aux files
|
|
# And:
|
|
# Return 1 if no problems
|
|
# Return 2 with @new_bib_files empty if there are no \bibdata
|
|
# lines.
|
|
# Return 3 if I couldn't locate all the bib_files
|
|
# Set @new_aux_files to aux files parsed
|
|
|
|
my $aux_file = $_[0];
|
|
local $Pbib_files = $_[1];
|
|
local $Paux_files = $_[2];
|
|
local $Pbst_files = $_[3];
|
|
|
|
@$Pbib_files = ();
|
|
@$Pbst_files = ();
|
|
@$Paux_files = ();
|
|
|
|
parse_aux1( $aux_file );
|
|
if ($#{$Paux_files} < 0) {
|
|
return 0;
|
|
}
|
|
@$Pbib_files = uniqs( @$Pbib_files );
|
|
@$Pbst_files = uniqs( @$Pbst_files );
|
|
|
|
if ( $#{$Pbib_files} == -1 ) {
|
|
warn "$My_name: No .bib files listed in .aux file '$aux_file' \n",
|
|
return 2;
|
|
}
|
|
my @not_found = &find_file_list1( $Pbib_files, $Pbib_files,
|
|
'.bib', \@BIBINPUTS );
|
|
@$Pbib_files = uniqs( @$Pbib_files );
|
|
&find_file_list1( $Pbst_files, $Pbst_files, '.bst' );
|
|
@$Pbst_files = uniqs( @$Pbst_files );
|
|
if ( $#not_found < 0) {
|
|
warn "$My_name: Found bibliography file(s) [@$Pbib_files]\n"
|
|
unless $silent;
|
|
}
|
|
else {
|
|
show_array( "$My_name: Failed to find one or more bibliography files ",
|
|
@not_found );
|
|
if ($force_mode) {
|
|
warn "==== Force_mode is on, so I will continue. ",
|
|
"But there may be problems ===\n";
|
|
}
|
|
else {
|
|
#$failure = -1;
|
|
#$failure_msg = 'Failed to find one or more bib files';
|
|
#warn "$My_name: Failed to find one or more bib files\n";
|
|
}
|
|
return 3;
|
|
}
|
|
return 1;
|
|
} #END parse_aux
|
|
|
|
#************************************************************
|
|
|
|
sub parse_aux1
|
|
# Parse single aux file for bib files.
|
|
# Usage: &parse_aux1( aux_file_name )
|
|
# Append newly found bib_filenames in @$Pbib_files, already
|
|
# initialized/in use.
|
|
# Append aux_file_name to @$Paux_files if aux file opened
|
|
# Recursively check \@input aux files
|
|
# Return 1 if success in opening $aux_file_name and parsing it
|
|
# Return 0 if fail to open it
|
|
{
|
|
my $aux_file = $_[0];
|
|
my $aux_fh = new FileHandle;
|
|
if (! open($aux_fh, $aux_file) ) {
|
|
warn "$My_name: Couldn't find aux file '$aux_file'\n";
|
|
return 0;
|
|
}
|
|
push @$Paux_files, $aux_file;
|
|
AUX_LINE:
|
|
while (<$aux_fh>) {
|
|
if ( /^\\bibdata\{(.*)\}/ ) {
|
|
# \\bibdata{comma_separated_list_of_bib_file_names}
|
|
# These are normally without the '.bib' extension.
|
|
push @$Pbib_files, split /,/, $1;
|
|
}
|
|
elsif ( /^\\bibstyle\{(.*)\}/ ) {
|
|
# \\bibstyle{bst_file_name}
|
|
# Normally without the '.bst' extension.
|
|
push @$Pbst_files, split /,/, $1;
|
|
}
|
|
elsif ( /^\\\@input\{(.*)\}/ ) {
|
|
# \\@input{next_aux_file_name}
|
|
&parse_aux1( $aux_dir1.$1 );
|
|
}
|
|
else {
|
|
foreach my $Psub (@aux_hooks) {
|
|
&$Psub;
|
|
}
|
|
}
|
|
}
|
|
close($aux_fh);
|
|
return 1;
|
|
} #END parse_aux1
|
|
|
|
#************************************************************
|
|
|
|
#************************************************************
|
|
#************************************************************
|
|
#************************************************************
|
|
|
|
# Manipulations of main file database:
|
|
|
|
#************************************************************
|
|
|
|
sub fdb_get {
|
|
# Call: fdb_get(filename [, check_time])
|
|
# Returns an array (time, size, md5) for the current state of the
|
|
# named file.
|
|
# The optional argument check_time is either the run_time of some command
|
|
# that may have changed the file or the last time the file was checked
|
|
# for changes --- see below.
|
|
# For non-existent file, deletes its entry in fdb_current,
|
|
# and returns (0,-1,0)
|
|
# As an optimization, the md5 value is taken from the cache in
|
|
# fdb_current, if the time and size stamp indicate that the
|
|
# file has not changed.
|
|
# The md5 value is recalculated if
|
|
# the current filetime differs from the cached value:
|
|
# file has been written
|
|
# the current filesize differs from the cached value:
|
|
# file has definitely changed
|
|
# But the file can also be rewritten without change in filetime when
|
|
# file processing happens within the 1-second granularity of the
|
|
# timestamp (notably for aux files from latex on a short source file).
|
|
# The only case that concerns us is when the file is an input to a program
|
|
# at some runtime t, the file is rewritten later by the same or another
|
|
# program, with timestamp t, and when the initial file also has
|
|
# timestamp t.
|
|
# A test is applied for this situation if the check_time argument is
|
|
# supplied and is nonzero.
|
|
|
|
my ($file, $check_time) = @_;
|
|
if ( ! defined $check_time ) { $check_time = 0;}
|
|
my ($new_time, $new_size) = get_time_size($file);
|
|
my @nofile = (0,-1,0); # What we use for initializing
|
|
# a new entry in fdb or flagging
|
|
# non-existent file
|
|
if ( $new_size < 0 ) {
|
|
delete $fdb_current{$file};
|
|
return @nofile;
|
|
}
|
|
my $recalculate_md5 = 0;
|
|
if ( ! exists $fdb_current{$file} ) {
|
|
# Ensure we have a record.
|
|
$fdb_current{$file} = [@nofile];
|
|
$recalculate_md5 = 1;
|
|
}
|
|
my $file_data = $fdb_current{$file};
|
|
my ( $time, $size, $md5 ) = @$file_data;
|
|
|
|
if ( ($new_time != $time) || ($new_size != $size)
|
|
|| ( $check_time && ($check_time == $time ) )
|
|
) {
|
|
# Only force recalculation of md5 if time or size changed.
|
|
# However, the physical file time may have changed without
|
|
# affecting the value of the time coded in $time, because
|
|
# times are computed with a 1-second granularity.
|
|
# The only case to treat specially is where the file was created,
|
|
# then used by the current rule, and then rewritten, all within
|
|
# the granularity size, otherwise the value of the reported file
|
|
# time changed, and we've handled it. But we may have already
|
|
# checked this at an earlier time than the current check. So the
|
|
# only dangerous case is where the file time equals a check_time,
|
|
# which is either the run_time of the command or the time of a
|
|
# previous check.
|
|
# Else we assume file is really unchanged.
|
|
$recalculate_md5 = 1;
|
|
}
|
|
if ($recalculate_md5) {
|
|
#warn "--------- RECALC MD5: $rule $file: (N,O,R,C) \n = $new_time, $time, $$Prun_time, $check_time\n";
|
|
@$file_data = ( $new_time, $new_size, get_checksum_md5( $file ) );
|
|
}
|
|
return @$file_data;;
|
|
} #END fdb_get
|
|
|
|
#************************************************************
|
|
|
|
sub fdb_set {
|
|
# Call: fdb_set(filename, $time, $size, $md5 )
|
|
# Set data in file data cache, i.e., %fdb_current
|
|
my ($file, $time, $size, $md5 ) = @_;
|
|
if ( ! exists $fdb_current{$file} ) {
|
|
$fdb_current{$file} = [0, -1, 0];
|
|
}
|
|
@{$fdb_current{$file}} = ( $time, $size, $md5 );
|
|
} #END fdb_set
|
|
|
|
#************************************************************
|
|
|
|
sub fdb_show {
|
|
# Displays contents of fdb
|
|
foreach my $file ( sort keys %fdb_current ) {
|
|
print "'$file': @{$fdb_current{$file}}\n";
|
|
}
|
|
} #END fdb_show
|
|
|
|
#************************************************************
|
|
#************************************************************
|
|
#************************************************************
|
|
|
|
# Routines for manipulating rule database
|
|
|
|
#************************************************************
|
|
|
|
sub rdb_read {
|
|
# Call: rdb_read( $in_name )
|
|
# Sets rule database from saved file, in format written by rdb_write.
|
|
# Returns -1 if file could not be read else number of errors.
|
|
# Thus return value on success is 0
|
|
my $in_name = $_[0];
|
|
my $in_handle = new FileHandle;
|
|
$in_handle->open( $in_name, '<' )
|
|
or return ();
|
|
my $errors = 0;
|
|
my $state = -1; # Values: -1: before start; 0: outside rule;
|
|
# 1: in source section; 2: in generated file section;
|
|
# 10: ignored rule
|
|
my $rule = '';
|
|
my $run_time = 0;
|
|
my $source = '';
|
|
my $dest = '';
|
|
my $base = '';
|
|
local %new_sources = (); # Hash: rule => { file=>[ time, size, md5, fromrule ] }
|
|
my $new_source = undef; # Reference to hash of sources for current rule
|
|
LINE:
|
|
while ( <$in_handle> ) {
|
|
# Remove leading and trailing white space.
|
|
s/^\s*//;
|
|
s/\s*$//;
|
|
if ($state == -1) {
|
|
if ( ! /^# Fdb version ([\d]+)$/ ) {
|
|
warn "$My_name: File-database '$in_name' is not of correct format\n";
|
|
return 1;
|
|
}
|
|
if ( $1 > $fdb_ver) {
|
|
warn "$My_name: File-database '$in_name' is of too new version, $1 > $fdb_ver\n";
|
|
return 1;
|
|
}
|
|
$state = 0;
|
|
}
|
|
# Ignore blank lines and comments
|
|
if ( /^$/ || /^#/ || /^%/ ) { next LINE;}
|
|
if ( /^\[\"([^\"]+)\"\]/ ) {
|
|
# Start of section
|
|
$rule = $1;
|
|
my $tail = $'; #' Single quote in comment tricks the parser in
|
|
# emacs from misparsing an isolated single quote
|
|
$run_time = $check_time = 0;
|
|
$source = $dest = $base = '';
|
|
if ( $tail =~ /^\s*(\S+)\s*$/ ) {
|
|
$run_time = $1;
|
|
}
|
|
elsif ( $tail =~ /^\s*(\S+)\s+\"([^\"]*)\"\s+\"([^\"]*)\"\s+\"([^\"]*)\"\s*$/ ) {
|
|
$run_time = $1;
|
|
$source = $2;
|
|
$dest = $3;
|
|
$base = $4;
|
|
}
|
|
elsif ( $tail =~ /^\s*(\S+)\s+\"([^\"]*)\"\s+\"([^\"]*)\"\s+\"([^\"]*)\"\s+(\S+)\s*$/ ) {
|
|
$run_time = $1;
|
|
$source = $2;
|
|
$dest = $3;
|
|
$base = $4;
|
|
$check_time = $5;
|
|
}
|
|
if ( rdb_rule_exists( $rule ) ) {
|
|
rdb_one_rule( $rule,
|
|
sub{
|
|
if ($$Ptest_kind == 3) { $$Ptest_kind = 1; }
|
|
$$Prun_time = $run_time;
|
|
$$Pcheck_time = $check_time;
|
|
}
|
|
);
|
|
}
|
|
elsif ($rule =~ /^cusdep\s+(\S+)\s+(\S+)\s+(.+)$/ ) {
|
|
# Create custom dependency
|
|
my $fromext = $1;
|
|
my $toext = $2;
|
|
my $base = $3;
|
|
$source = "$base.$fromext";
|
|
$dest = "$base.$toext";
|
|
my $PAnew_cmd = ['do_cusdep', ''];
|
|
foreach my $dep ( @cus_dep_list ) {
|
|
my ($tryfromext,$trytoext,$must,$func_name) = split('\s+',$dep);
|
|
if ( ($tryfromext eq $fromext) && ($trytoext eq $toext) ) {
|
|
$$PAnew_cmd[1] = $func_name;
|
|
}
|
|
}
|
|
# Set source file as non-existent.
|
|
# If it existed on last run, it will be in later
|
|
# lines of the fdb file
|
|
rdb_create_rule( $rule, 'cusdep', '', $PAnew_cmd, 1,
|
|
$source, $dest, $base, 0, $run_time, $check_time, 1 );
|
|
}
|
|
elsif ( $rule =~ /^(makeindex|bibtex|biber)\s*(.*)$/ ) {
|
|
my $PA_extra_gen = [];
|
|
my $rule_generic = $1;
|
|
my $int_cmd = '';
|
|
if ( ! $source ) {
|
|
# If fdb_file was old-style (v. 1)
|
|
$source = $2;
|
|
my $path = '';
|
|
my $ext = '';
|
|
($base, $path, $ext) = fileparseA( $source );
|
|
$base = $path.$base;
|
|
if ($rule_generic eq 'makeindex') {
|
|
$dest = "$base.ind";
|
|
}
|
|
elsif ($rule_generic eq 'bibtex') {
|
|
$dest = "$base.bbl";
|
|
$source = "$base.aux";
|
|
}
|
|
elsif ($rule_generic eq 'biber') {
|
|
$dest = "$base.bbl";
|
|
$source = "$base.bcf";
|
|
}
|
|
}
|
|
if ($rule =~ /^makeindex/) { $PA_extra_gen = [ "$base.ilg" ]; }
|
|
if ($rule =~ /^(bibtex|biber)/) { $PA_extra_gen = [ "$base.blg" ]; }
|
|
if ($rule =~ /^bibtex/) { $int_cmd = "run_bibtex"; }
|
|
warn "$My_name: File-database '$in_name': setting rule '$rule'\n"
|
|
if $diagnostics;
|
|
my $cmd_type = 'external';
|
|
my $ext_cmd = ${$rule_generic};
|
|
warn " Rule kind = '$rule_generic'; ext_cmd = '$ext_cmd';\n",
|
|
" int_cmd = '$int_cmd';\n",
|
|
" source = '$source'; dest = '$dest'; base = '$base';\n"
|
|
if $diagnostics;
|
|
# Set source file as non-existent.
|
|
# If it existed on last run, it will be in later
|
|
# lines of the fdb file
|
|
rdb_create_rule( $rule, $cmd_type, $ext_cmd, $int_cmd, 1,
|
|
$source, $dest, $base, 0, $run_time, $check_time, 1, $PA_extra_gen );
|
|
}
|
|
else {
|
|
warn "$My_name: In file-database '$in_name' rule '$rule'\n",
|
|
" is not in use in this session\n"
|
|
if $diagnostics;
|
|
$new_source = undef;
|
|
$state = 10;
|
|
next LINE;
|
|
}
|
|
$new_source = $new_sources{$rule} = {};
|
|
$state = 1; #Reading a section, source part
|
|
}
|
|
elsif ( ($state <=0) || ($state >= 3) ) {
|
|
next LINE;
|
|
}
|
|
elsif ( /^\(source\)/ ) { $state = 1; next LINE; }
|
|
elsif ( /^\(generated\)/ ) { $state = 2; next LINE; }
|
|
elsif ( ($state == 1) && /^\"([^\"]*)\"\s+(\S+)\s+(\S+)\s+(\S+)\s+\"([^\"]*)\"/ ) {
|
|
# Source file line
|
|
my $file = $1;
|
|
my $time = $2;
|
|
my $size = $3;
|
|
my $md5 = $4;
|
|
my $from_rule = $5;
|
|
#?? print " --- File '$file'\n";
|
|
if ($state != 1) {
|
|
warn "$My_name: In file-database '$in_name' ",
|
|
"line $. is outside a section:\n '$_'\n";
|
|
$errors++;
|
|
next LINE;
|
|
}
|
|
# Set file in database. But ensure we don't do an unnecessary
|
|
# fdb_get, which can trigger a new MD5 calculation, which is
|
|
# lengthy for a big file. Ininitially flagging the file
|
|
# as non-existent solves the problem:
|
|
rdb_ensure_file( $rule, $file, undef, 1 );
|
|
rdb_set_file1( $rule, $file, $time, $size, $md5 );
|
|
fdb_set( $file, $time, $size, $md5 );
|
|
# Save the rest of the data, especially the from_fule until we know all
|
|
# the rules, otherwise the from_rule may not exist.
|
|
# Also we'll have a better chance of looping through files.
|
|
${$new_source}{$file} = [ $time, $size, $md5, $from_rule ];
|
|
}
|
|
elsif ( ($state == 2) && /^\"([^\"]*)\"/ ) {
|
|
my $file = $1;
|
|
rdb_one_rule( $rule, sub{ rdb_add_generated($file); } );
|
|
}
|
|
else {
|
|
warn "$My_name: In file-database '$in_name' ",
|
|
"line $. is of wrong format:\n '$_'\n";
|
|
$errors++;
|
|
next LINE;
|
|
}
|
|
}
|
|
undef $in_handle;
|
|
# Set cus dependencies.
|
|
&rdb_set_dependents( keys %rule_db );
|
|
|
|
#?? Check from_rules exist.
|
|
|
|
return $errors;
|
|
} # END rdb_read
|
|
|
|
#************************************************************
|
|
|
|
sub rdb_write {
|
|
# Call: rdb_write( $out_name )
|
|
# Writes to the given file name the database of file and rule data
|
|
# for all rules needed to make final output
|
|
# !!?? Previously was:
|
|
# OLD Writes to the given file name the database of file and rule data
|
|
# OLD accessible from the primary rules.
|
|
# Returns 1 on success, 0 if file couldn't be opened.
|
|
local $out_name = $_[0];
|
|
local $out_handle = new FileHandle;
|
|
if ( ($out_name eq "") || ($out_name eq "-") ) {
|
|
# Open STDOUT
|
|
$out_handle->open( '>-' );
|
|
}
|
|
else {
|
|
$out_handle->open( $out_name, '>' );
|
|
}
|
|
if (!$out_handle) { return 0; }
|
|
|
|
local %current_primaries = (); # Hash whose keys are primary rules
|
|
# needed, i.e., known latex-like rules which trigger
|
|
# circular dependencies
|
|
local @pre_primary = (); # Array of rules
|
|
local @post_primary = (); # Array of rules
|
|
local @unusual_one_time = (); # Array of rules
|
|
&rdb_classify_rules( \%possible_primaries, keys %requested_filerules );
|
|
|
|
print $out_handle "# Fdb version $fdb_ver\n";
|
|
# !!?? Rules or rules accessible from primary
|
|
# my @rules = rdb_accessible( uniq1( keys %possible_primaries ) ) ;
|
|
my @rules = rdb_accessible( uniq1( keys %possible_primaries, keys %requested_filerules ) ) ;
|
|
# Separate call to sort. Otherwise rdb_accessible seems to get wrong argument.
|
|
@rules = sort( @rules );
|
|
rdb_for_some(
|
|
\@rules,
|
|
sub {
|
|
# Omit data on a unused and never-run primary rule:
|
|
if ( ($$Prun_time == 0)
|
|
&& exists( $possible_primaries{$rule} )
|
|
&& ! exists( $current_primaries{$rule} )
|
|
)
|
|
{
|
|
return;
|
|
}
|
|
print $out_handle "[\"$rule\"] $$Prun_time \"$$Psource\" \"$$Pdest\" \"$$Pbase\" $$Pcheck_time\n";
|
|
rdb_do_files(
|
|
sub { print $out_handle " \"$file\" $$Ptime $$Psize $$Pmd5 \"$$Pfrom_rule\"\n"; }
|
|
);
|
|
print $out_handle " (generated)\n";
|
|
foreach (keys %$PHdest) {
|
|
print $out_handle " \"$_\"\n";
|
|
}
|
|
}
|
|
);
|
|
undef $out_handle;
|
|
return 1;
|
|
} #END rdb_write
|
|
|
|
#************************************************************
|
|
|
|
sub rdb_set_latex_deps {
|
|
# Assume rule context.
|
|
# This is intended to be applied only for a primary (LaTeX-like) rule.
|
|
# Set its dependents etc, using information from log, aux, and fls files.
|
|
# Use fls file only if $recorder is set, and the fls file was generated
|
|
# on this run.
|
|
|
|
# N.B. A complication which we try and handle in determining
|
|
# dependent files is that there may be aliasing of file names,
|
|
# especially when characters are used in file and directory
|
|
# names that are not pure 7-bit-ASCII. Here is a list of some
|
|
# of the difficulties that do arise, between, on the one hand,
|
|
# the filenames specified on latexmk's and the cwd found by
|
|
# latexmk from the system, and, on the other hand, the filenames
|
|
# and their components reported by (pdf)latex in the fls and log
|
|
# files:
|
|
# 1. Whether the separator of path components is / or \ in
|
|
# MSWin.
|
|
# 2. Whether the LFN or the SFN is provided.
|
|
# 3. Whether the filenames include the cwd or whether they
|
|
# are relative to the current directory.
|
|
# 4. Under cygwin, whether the absolute filenames are
|
|
# specified by UNIX or native MSWin conventions.
|
|
# (With cygin, the programs used, including the Perl that
|
|
# executes latexmk, can be any combination of native MSWin
|
|
# programs and cygwin programs with their UNIX-like
|
|
# behavior.)
|
|
# 5. Whether UTF-8 or some other coding is used, and under
|
|
# which circumstances: e.g., in calls to the OS to access
|
|
# files, in files output by programs, on latexmk's command
|
|
# line, on other programs' command lines, by the command
|
|
# interpreterS.
|
|
# 6. If UTF-8 is used, what kind of canonicalization is used,
|
|
# if any. (This is a particular bugbear when files are
|
|
# transferred between different OSes.)
|
|
# 7. Whether the name of a file in the current directory is
|
|
# reported as the simple filename or whether it is
|
|
# preceeded by ".\" or "./".
|
|
# 8. How is it determined whether a pathname is absolute or
|
|
# relative? An absolute pathname in MSWin may start with
|
|
# a drive letter and a colon, but under UNIX-type systems,
|
|
# the colon is an ordinary character.
|
|
# 9. Whether a filename reported in an fls or log file can be
|
|
# used as is by perl to access a file, or on the command
|
|
# line to invoke another program, and whether the use on a
|
|
# command line depends on whether the command line is
|
|
# executed by a CLI, and by which CLI. (E.g., cmd.exe,
|
|
# v. sh v. tcsh, etc.)
|
|
# 10. Whether such a filename for the filename on (pdf)latex's
|
|
# file agrees with the one on the command line.
|
|
# The above questions have arisen from actual experiences and
|
|
# tests.
|
|
#
|
|
# In any case, when determining dependent files, we will try to
|
|
# remove an initial directory string from filenames found in the
|
|
# fls and log files, whenever it denotes the current
|
|
# directory. The directory string may be an absolute pathname,
|
|
# such as MiKTeX writes in both fls and log files, or it may be
|
|
# simply "./" as given by TeXLive in its log file. There are
|
|
# several reasons for removing a directory string when possible:
|
|
#
|
|
# 1. To avoid having multiple names referring to the same
|
|
# file in the list of dependents.
|
|
# 2. Because the name may be in a different coding. Thus
|
|
# under MSWin 7, cmd.exe and perl (by default) work in an
|
|
# "ANSI" coding with some code page, but the filenames
|
|
# written by MiKTeX are UTF-8 coded (and if they are non-ASCII
|
|
# can't be used for file-processing by Perl without some
|
|
# trouble). This is a particular problem if the pathname
|
|
# contains non-ASCII characters; the directory names may not
|
|
# even be under the user's control, unlike typical filenames.
|
|
# 3. When it comes to filenames that are then used in calls to
|
|
# bibtex and makeindex, it is bad to use absolute pathnames
|
|
# instead of clearly relative pathnames, because the default
|
|
# security settings are to prohibit writing files to the
|
|
# corresponding directories, which makes the calls to these
|
|
# programs unnecessarily fail.
|
|
#
|
|
# In removing unnecessary directory-specifying strings, to
|
|
# convert a filename to a simple specification relative to the
|
|
# current directory, it will be important to preferentially use
|
|
# a determination of the current directory from the file being
|
|
# processed. In the fls file, there is normally a PWD line. In
|
|
# the log file, if (pdf)latex is started with a filename instead
|
|
# of a command-executing first line, then this can be determined
|
|
# from the first few lines of the log file -- see parse_log.
|
|
# This gives a more reliable determination of the relevant path
|
|
# string; this is especially important in cases where there is a
|
|
# mismatch of coding of the current directory, particularly
|
|
# notable in the above-mentioned case of non-ASCII characters
|
|
# under MSWin. Other inconsistencies happen when there is a
|
|
# mixure of cygwin and native MSWin software. There can also be
|
|
# inconsistencies between whether the separator of pathname
|
|
# components is "/" or "\". So we will allow for this. The
|
|
# necessary normalizations of filenames are handled by the
|
|
# subroutines normalize_filename and normalize_clean_filename.
|
|
#
|
|
# I have not tried to handle the (currently rare) cases that the
|
|
# OS is neither UNIX-like nor MSWin-like.
|
|
|
|
# Rules should only be primary
|
|
if ( $$Pcmd_type ne 'primary' ) {
|
|
warn "\n$My_name: ==========$My_name: Probable BUG======= \n ",
|
|
" rdb_set_latex_deps called to set files ",
|
|
"for non-primary rule '$rule'\n\n";
|
|
return;
|
|
}
|
|
|
|
|
|
#?? # We'll prune this by all files determined to be needed for source files.
|
|
#?? my %unneeded_source = %$PHsource;
|
|
|
|
# Parse log file to find relevant filenames
|
|
# Result in the following variables:
|
|
local %dependents = (); # Maps files to status
|
|
local @bbl_files = ();
|
|
local %idx_files = (); # Maps idx_file to (ind_file, base)
|
|
local %generated_log = (); # Lists generated files found in log file
|
|
local %generated_fls = (); # Lists generated files found in fls file
|
|
local %source_fls = (); # Lists source files found in fls file
|
|
local %first_read_after_write = (); # Lists source files that are only read
|
|
# after being written (so are not true
|
|
# source files.
|
|
local $primary_out = $$Pdest; # output file (dvi or pdf)
|
|
local %conversions = (); # (pdf)latex-performed conversions.
|
|
# Maps output file created and read by (pdf)latex
|
|
# to source file of conversion.
|
|
local @missing_subdirs = (); # Missing subdirectories in aux_dir
|
|
|
|
local $pwd_latex = undef; # Cwd as reported in fls file by (pdf)latex
|
|
|
|
# The following are also returned, but are global, to be used by caller
|
|
# $reference_changed, $bad_reference $bad_citation, $mult_defined
|
|
|
|
# Do I have my own eps-to-pdf conversion?
|
|
my $epspdf_cusdep = 0;
|
|
foreach (@cus_dep_list) {
|
|
if ( /^eps pdf / ) { $epspdf_cusdep = 1; last; }
|
|
}
|
|
|
|
# Analyze fls file first. It tells us the working directory as seen by (pdf)latex
|
|
# But we'll use the results later, so that they take priority over the findings
|
|
# from the log file.
|
|
my $fls_name = "$aux_dir1$root_filename.fls";
|
|
local $fls_file_analyzed = 0;
|
|
if ($recorder && test_gen_file($fls_name) ) {
|
|
$fls_file_analyzed =
|
|
(0== parse_fls( $fls_name, \%source_fls, \%generated_fls, \%first_read_after_write, \$pwd_latex ));
|
|
if (! $fls_file_analyzed ) {
|
|
warn "$My_name: fls file '$fls_name' appears to have been made but it couldn't be opened.\n";
|
|
}
|
|
}
|
|
|
|
&parse_log;
|
|
$missing_dirs = 'none'; # Status of missing directories
|
|
if (@missing_subdirs) {
|
|
$missing_dirs = 'success';
|
|
if ($allow_subdir_creation) {
|
|
foreach my $dir ( uniqs( @missing_subdirs ) ) {
|
|
if ( -d $dir ) {
|
|
$missing_dirs = 'failure';
|
|
warn "$My_name: ==== Directory '$dir' is said to be missing\n",
|
|
" But it exists!\n";
|
|
}
|
|
elsif ( (-e $dir) && (!-d $dir) ) {
|
|
$missing_dirs = 'failure';
|
|
warn "$My_name: ==== Directory '$dir' is said to be missing\n",
|
|
" But a non-directory file of this name exists!\n";
|
|
}
|
|
else {
|
|
if (mkdir $dir) {
|
|
warn "$My_name: Directory '$dir' created\n";
|
|
}
|
|
else {
|
|
$missing_dirs = 'failure';
|
|
warn "$My_name: Couldn't create directory '$dir'.\n",
|
|
" System error: '$!'\n";
|
|
}
|
|
}
|
|
}
|
|
}
|
|
else {
|
|
$missing_dirs = 'not allowed';
|
|
warn "$My_name: There are missing subdirectories, but their creation\n",
|
|
" is not allowed. The subdirectories are:\n";
|
|
foreach my $dir ( uniqs( @missing_subdirs ) ) {
|
|
warn " '$dir'\n";
|
|
}
|
|
}
|
|
}
|
|
# Use results from fls file. (N.B. The hashes will be empty if the fls file
|
|
# wasn't used/analyzed, so we don't need a test as to whether the fls file was
|
|
# used.
|
|
foreach (keys %source_fls) {
|
|
$dependents{$_} = 4;
|
|
if ( /\.bbl$/ ) { push @bbl_files, $_; }
|
|
}
|
|
foreach (keys %generated_fls) {
|
|
rdb_add_generated( $_ );
|
|
if ( exists($dependents{$_}) ) {
|
|
$dependents{$_} = 6;
|
|
}
|
|
}
|
|
|
|
|
|
for my $conv (sort keys %conversions) {
|
|
my $conv_source = $conversions{$conv};
|
|
if ( $conv =~ /^(.*)-eps-converted-to\.pdf$/ ) {
|
|
# Check all the conditions for pdflatex's conversion eps to pdf
|
|
# are valid; if they are, treat the converted file as not a
|
|
# source file.
|
|
my $base = $1;
|
|
if ( (-e $conv_source) && (-e $conv) && ( $conv_source eq "$base.eps" ) ) {
|
|
# $conv isn't a real source of (pdf)latex
|
|
rdb_remove_files( $rule, $conv );
|
|
delete $dependents{$conv};
|
|
if ($epspdf_cusdep) {
|
|
$dependents{"$base.pdf"} = ((-e "$base.pdf") ? 4 : 0 );
|
|
}
|
|
}
|
|
}
|
|
}
|
|
|
|
|
|
|
|
# ?? !! Should also deal with .run.xml file
|
|
|
|
# Handle result on output file:
|
|
# 1. Non-existent output file, which is because of no content.
|
|
# This could either be because the source file has genuinely
|
|
# no content, or because of a missing input file. Since a
|
|
# missing input file might be correctable by a run of some
|
|
# other program whose running is provoked AFTER a run of
|
|
# (pdf)latex, we'll set a diagnostic and leave it to the
|
|
# rdb_make to handle after all circular dependencies are
|
|
# resolved.
|
|
# 2. The output file might be of a different kind than expected
|
|
# (i.e., dvi instead of pdf, or vv). This could
|
|
# legitimately occur when the source file (or an invoked
|
|
# package or class) sets \pdfoutput.
|
|
$missing_dvi_pdf = '';
|
|
if ($primary_out eq '') {
|
|
warn "$My_name: For rule '$rule', no output was made\n";
|
|
$missing_dvi_pdf = $$Pdest;
|
|
}
|
|
elsif ($primary_out ne $$Pdest) {
|
|
warn "$My_name: ===For rule '$rule', actual output '$primary_out'\n",
|
|
" ======appears not to match expected output '$$Pdest'\n";
|
|
}
|
|
|
|
IDX_FILE:
|
|
foreach my $idx_file ( keys %idx_files ) {
|
|
my ($ind_file, $ind_base) = @{$idx_files{$idx_file}};
|
|
my $from_rule = "makeindex $idx_file";
|
|
if ( ! rdb_rule_exists( $from_rule ) ){
|
|
print "!!!===Creating rule '$from_rule': '$ind_file' from '$idx_file'\n"
|
|
if ($diagnostics);
|
|
rdb_create_rule( $from_rule, 'external', $makeindex, '', 1,
|
|
$idx_file, $ind_file, $ind_base, 1, 0, 0, 1, [ "$ind_base.ilg" ] );
|
|
print " ===Source file '$ind_file' for '$rule'\n"
|
|
if ($diagnostics);
|
|
rdb_ensure_file( $rule, $ind_file, $from_rule );
|
|
}
|
|
# Make sure the .ind file is treated as a detected source file;
|
|
# otherwise if the log file has it under a different name (as
|
|
# with MiKTeX which gives full directory information), there
|
|
# will be problems with the clean-up of the rule concerning
|
|
# no-longer-in-use source files:
|
|
$dependents{$ind_file} = 4;
|
|
if ( ! -e $ind_file ) {
|
|
# Failure was non-existence of makable file
|
|
# Leave failure issue to other rules.
|
|
$failure = 0;
|
|
}
|
|
}
|
|
|
|
local %processed_aux_files = ();
|
|
BBL_FILE:
|
|
foreach my $bbl_file ( uniqs( @bbl_files ) ) {
|
|
my ($bbl_base, $bbl_path, $bbl_ext) = fileparseA( $bbl_file );
|
|
$bbl_base = $bbl_path.$bbl_base;
|
|
my @new_bib_files = ();
|
|
my @new_aux_files = ();
|
|
my @new_bst_files = ();
|
|
my @biber_source = ( "$bbl_base.bcf" );
|
|
my $bib_program = 'bibtex';
|
|
if ( test_gen_file( "$bbl_base.bcf" ) ) {
|
|
$bib_program = 'biber';
|
|
}
|
|
my $from_rule = "$bib_program $bbl_base";
|
|
print "======= Dealing with '$from_rule'\n" if ($diagnostics);
|
|
if ($bib_program eq 'biber') {
|
|
check_biber_log( $bbl_base, \@biber_source );
|
|
# Remove OPPOSITE kind of bbl generation:
|
|
rdb_remove_rule( "bibtex $bbl_base" );
|
|
}
|
|
else {
|
|
parse_aux( "$bbl_base.aux", \@new_bib_files, \@new_aux_files, \@new_bst_files );
|
|
# Remove OPPOSITE kind of bbl generation:
|
|
rdb_remove_rule( "biber $bbl_base" );
|
|
}
|
|
if ( ! rdb_rule_exists( $from_rule ) ){
|
|
print " ===Creating rule '$from_rule'\n" if ($diagnostics);
|
|
if ( $bib_program eq 'biber' ) {
|
|
rdb_create_rule( $from_rule, 'external', $biber, '', 1,
|
|
"$bbl_base.bcf", $bbl_file, $bbl_base, 1, 0, 0, 1, [ "$bbl_base.blg" ] );
|
|
}
|
|
else {
|
|
rdb_create_rule( $from_rule, 'external', $bibtex, 'run_bibtex', 1,
|
|
"$bbl_base.aux", $bbl_file, $bbl_base, 1, 0, 0, 1, [ "$bbl_base.blg" ] );
|
|
}
|
|
}
|
|
local %old_sources = ();
|
|
rdb_one_rule( $from_rule, sub { %old_sources = %$PHsource; } );
|
|
my @new_sources = ( @new_bib_files, @new_aux_files, @new_bst_files );
|
|
if ( $bib_program eq 'biber' ) {
|
|
push @new_sources, @biber_source;
|
|
}
|
|
foreach my $source ( @new_sources ) {
|
|
print " ===Source file '$source' for '$from_rule'\n"
|
|
if ($diagnostics);
|
|
rdb_ensure_file( $from_rule, $source );
|
|
delete $old_sources{$source};
|
|
}
|
|
foreach my $source ( @new_aux_files ) {
|
|
$processed_aux_files{$source} = 1;
|
|
}
|
|
if ($diagnostics) {
|
|
foreach ( keys %old_sources ) {
|
|
print "Removing no-longer-needed dependent '$_' from rule '$from_rule'\n";
|
|
}
|
|
}
|
|
rdb_remove_files( $from_rule, keys %old_sources );
|
|
print " ===Source file '$bbl_file' for '$rule'\n"
|
|
if ($diagnostics);
|
|
rdb_ensure_file( $rule, $bbl_file, $from_rule );
|
|
if ( ! -e $bbl_file ) {
|
|
# Failure was non-existence of makable file
|
|
# Leave failure issue to other rules.
|
|
$failure = 0;
|
|
}
|
|
}
|
|
|
|
if ( ($#aux_hooks > -1) && ! exists $processed_aux_files{$aux_main} ) {
|
|
my @new_bib_files = ();
|
|
my @new_aux_files = ();
|
|
my @new_bst_files = ();
|
|
parse_aux( $aux_main, \@new_bib_files, \@new_aux_files, \@new_bst_files );
|
|
foreach my $source ( @new_aux_files ) {
|
|
$processed_aux_files{$source} = 1;
|
|
}
|
|
}
|
|
|
|
NEW_SOURCE:
|
|
foreach my $new_source (keys %dependents) {
|
|
print " ===Source file for rule '$rule': '$new_source'\n"
|
|
if ($diagnostics);
|
|
if ( exists $first_read_after_write{$new_source} ) {
|
|
if ( dep_at_start($new_source) ) {
|
|
#warn "--- READ ONLY AFTER WRITE OF '$new_source'\n";
|
|
$dependents{$new_source} = 7;
|
|
}
|
|
else {
|
|
#warn "--- READ ONLY AFTER CREATE OF '$new_source'\n";
|
|
$dependents{$new_source} = 6;
|
|
}
|
|
}
|
|
if ( ($dependents{$new_source} == 5)
|
|
|| ($dependents{$new_source} == 6)
|
|
) {
|
|
# (a) File was detected in "No file..." line in log file.
|
|
# Typically file was searched for early in run of
|
|
# latex/pdflatex, was not found, and then was written
|
|
# later in run.
|
|
# or (b) File was written during run.
|
|
# In both cases, if file doesn't already exist in database, we
|
|
# don't know its previous status. Therefore we tell
|
|
# rdb_ensure_file that if it needs to add the file to its
|
|
# database, then the previous version of the file should be
|
|
# treated as non-existent, to ensure another run is forced.
|
|
rdb_ensure_file( $rule, $new_source, undef, 1 );
|
|
}
|
|
elsif ( $dependents{$new_source} == 7 ) {
|
|
# File was result of conversion by (pdf)latex.
|
|
my $cnv_source = $conversions{$new_source};
|
|
rdb_ensure_file( $rule, $new_source );
|
|
if ($cnv_source) {
|
|
# Conversion from $cnv_source to $new_source
|
|
# implies that effectively $cnv_source is a source
|
|
# of the (pdf)latex run.
|
|
rdb_ensure_file( $rule, $cnv_source );
|
|
}
|
|
# Flag that changes of the generated file during a run
|
|
# do not require a rerun:
|
|
rdb_one_file( $new_source, sub{ $$Pcorrect_after_primary = 1; } );
|
|
}
|
|
else {
|
|
# But we don't need special precautions for ordinary user files
|
|
# (or for files that are generated outside of latex/pdflatex).
|
|
rdb_ensure_file( $rule, $new_source );
|
|
}
|
|
if ( ($dependents{$new_source} == 6)
|
|
|| ($dependents{$new_source} == 7)
|
|
) {
|
|
rdb_add_generated($new_source);
|
|
}
|
|
}
|
|
|
|
my @more_sources = &rdb_set_dependents( $rule );
|
|
my $num_new = $#more_sources + 1;
|
|
foreach (@more_sources) {
|
|
$dependents{$_} = 4;
|
|
if ( ! -e $_ ) {
|
|
# Failure was non-existence of makable file
|
|
# Leave failure issue to other rules.
|
|
$failure = 0;
|
|
$$Pchanged = 1; # New files can be made. Ignore error.
|
|
}
|
|
}
|
|
if ($diagnostics) {
|
|
if ($num_new > 0 ) {
|
|
print "$num_new new source files for rule '$rule':\n";
|
|
foreach (@more_sources) { print " '$_'\n"; }
|
|
}
|
|
else {
|
|
print "No new source files for rule '$rule':\n";
|
|
}
|
|
my @first_read_after_write = sort keys %first_read_after_write;
|
|
if ($#first_read_after_write >= 0) {
|
|
print "The following files were only read after being written:\n";
|
|
foreach (@first_read_after_write) {
|
|
print " '$_'\n";
|
|
}
|
|
}
|
|
}
|
|
my @files_not_needed = ();
|
|
foreach (keys %$PHsource) {
|
|
if ( ! exists $dependents{$_} ) {
|
|
print "Removing no-longer-needed dependent '$_' from rule '$rule'\n"
|
|
if $diagnostics;
|
|
push @files_not_needed, $_;
|
|
}
|
|
}
|
|
rdb_remove_files( $rule, @files_not_needed );
|
|
|
|
} # END rdb_set_latex_deps
|
|
|
|
#************************************************************
|
|
|
|
sub test_gen_file {
|
|
# Usage: test_gen_file( filename )
|
|
# Tests whether the file was generated during a run of (pdf)latex.
|
|
# Used by rdb_set_latex_deps.
|
|
# Assumes context for primary rule, and that %generated_log is set.
|
|
# The generated_log test works with TeXLive's tex, because it puts
|
|
# \openout lines in log file.
|
|
# But it doesn't work with MikTeX, which does NOT put \openout lines
|
|
# in log file.
|
|
# So we have a back up test: bcf file exists and is at least as new as
|
|
# the run time (so it should have been generated on the current run).
|
|
my $file = shift;
|
|
return exists $generated_log{$file}
|
|
|| ( -e $file && ( get_mtime( $file ) >= $$Prun_time ));
|
|
}
|
|
|
|
#************************************************************
|
|
|
|
sub dep_at_start {
|
|
# Usage: dep_at_start( filename )
|
|
# Tests whether the file was source file and existed at start of run.
|
|
# Assumes context for primary rule.
|
|
my $time = undef;
|
|
rdb_one_file( shift, sub{ $time = $$Ptime; } );
|
|
return (defined $time) && ($time != 0);
|
|
}
|
|
|
|
#************************************************************
|
|
|
|
sub rdb_find_new_files {
|
|
# Call: rdb_find_new_files
|
|
# Assumes rule context for primary rule.
|
|
# Deal with files which were missing and for which a method
|
|
# of finding them has become available:
|
|
# (a) A newly available source file for a custom dependency.
|
|
# (b) When there was no extension, a file with appropriate
|
|
# extension
|
|
# (c) When there was no extension, and a newly available source
|
|
# file for a custom dependency can make it.
|
|
|
|
my %new_includes = ();
|
|
|
|
MISSING_FILE:
|
|
foreach my $missing ( keys %$PHsource ) {
|
|
next if ( $$PHsource{$missing} != 0 );
|
|
my ($base, $path, $ext) = fileparseA( $missing );
|
|
$ext =~ s/^\.//;
|
|
if ( -e "$missing.tex" ) {
|
|
$new_includes{"$missing.tex"} = 1;
|
|
}
|
|
if ( -e $missing ) {
|
|
$new_includes{$missing} = 1;
|
|
}
|
|
if ( $ext ne "" ) {
|
|
foreach my $dep (@cus_dep_list){
|
|
my ($fromext,$toext) = split('\s+',$dep);
|
|
if ( ( "$ext" eq "$toext" )
|
|
&& ( -e "$path$base.$fromext" )
|
|
) {
|
|
# Source file for the missing file exists
|
|
# So we have a real include file, and it will be made
|
|
# next time by rdb_set_dependents
|
|
$new_includes{$missing} = 1;
|
|
}
|
|
else {
|
|
# no point testing the $toext if the file doesn't exist.
|
|
}
|
|
next MISSING_FILE;
|
|
}
|
|
}
|
|
else {
|
|
# $_ doesn't exist, $_.tex doesn't exist,
|
|
# and $_ doesn't have an extension
|
|
foreach my $dep (@cus_dep_list){
|
|
my ($fromext,$toext) = split('\s+',$dep);
|
|
if ( -e "$path$base.$fromext" ) {
|
|
# Source file for the missing file exists
|
|
# So we have a real include file, and it will be made
|
|
# next time by &rdb__dependents
|
|
$new_includes{"$path$base.$toext"} = 1;
|
|
# next MISSING_FILE;
|
|
}
|
|
if ( -e "$path$base.$toext" ) {
|
|
# We've found the extension for the missing file,
|
|
# and the file exists
|
|
$new_includes{"$path$base.$toext"} = 1;
|
|
# next MISSING_FILE;
|
|
}
|
|
}
|
|
}
|
|
} # end MISSING_FILES
|
|
|
|
# Sometimes bad line-breaks in log file (etc) create the
|
|
# impression of a missing file e.g., ./file, but with an incorrect
|
|
# extension. The above tests find the file with an extension,
|
|
# e.g., ./file.tex, but it is already in the list. So now I will
|
|
# remove files in the new_include list that are already in the
|
|
# include list. Also handle aliasing of file.tex and ./file.tex.
|
|
# For example, I once found:
|
|
# (./qcdbook.aux (./to-do.aux) (./ideas.aux) (./intro.aux) (./why.aux) (./basics
|
|
#.aux) (./classics.aux)
|
|
|
|
my $found = 0;
|
|
foreach my $file (keys %new_includes) {
|
|
my $stripped = $file;
|
|
$stripped =~ s{^\./}{};
|
|
if ( exists $PHsource{$file} ) {
|
|
delete $new_includes{$file};
|
|
}
|
|
else {
|
|
$found ++;
|
|
rdb_ensure_file( $rule, $file );
|
|
}
|
|
}
|
|
|
|
if ( $diagnostics && ( $found > 0 ) ) {
|
|
warn "$My_name: Detected previously missing files:\n";
|
|
foreach ( sort keys %new_includes ) {
|
|
warn " '$_'\n";
|
|
}
|
|
}
|
|
return $found;
|
|
} # END rdb_find_new_files
|
|
|
|
#************************************************************
|
|
|
|
sub rdb_set_dependents {
|
|
# Call rdb_set_dependents( rules ...)
|
|
# Returns array (sorted), of new source files.
|
|
local @new_sources = ();
|
|
local @deletions = ();
|
|
|
|
# Shouldn't recurse. The definite rules to be examined are given.
|
|
rdb_for_some( [@_], 0, \&rdb_one_dep );
|
|
# OLD rdb_recurse( [@_], 0, \&rdb_one_dep );
|
|
foreach (@deletions) {
|
|
my ($rule, $file) = @$_;
|
|
rdb_remove_files( $rule, $file );
|
|
}
|
|
&rdb_make_links;
|
|
return uniqs( @new_sources );
|
|
} #END rdb_set_dependents
|
|
|
|
#************************************************************
|
|
|
|
sub rdb_one_dep {
|
|
# Helper for finding dependencies. One case, $rule and $file given
|
|
# Assume file (and rule) context for DESTINATION file.
|
|
|
|
# Only look for dependency if $rule is primary rule (i.e., latex
|
|
# or pdflatex) or is a custom dependency:
|
|
if ( (! exists $possible_primaries{$rule}) && ($rule !~ /^cusdep/) ) {
|
|
return;
|
|
}
|
|
#print "=============ONE_DEP: '$rule' '$file'\n";
|
|
local $new_dest = $file;
|
|
my ($base_name, $path, $toext) = fileparseA( $new_dest );
|
|
$base_name = $path.$base_name;
|
|
$toext =~ s/^\.//;
|
|
my $Pinput_extensions = $input_extensions{$rule};
|
|
DEP:
|
|
foreach my $dep ( @cus_dep_list ) {
|
|
my ($fromext,$proptoext,$must,$func_name) = split('\s+',$dep);
|
|
if ( $toext eq $proptoext ) {
|
|
my $source = "$base_name.$fromext";
|
|
# Found match of rule
|
|
if ($diagnostics) {
|
|
print "Found cusdep: $source to make $rule:$new_dest ====\n";
|
|
}
|
|
if ( -e $source ) {
|
|
$$Pfrom_rule = "cusdep $fromext $toext $base_name";
|
|
#?? print "?? Ensuring rule for '$$Pfrom_rule'\n";
|
|
local @PAnew_cmd = ( 'do_cusdep', $func_name );
|
|
if ( !-e $new_dest ) {
|
|
push @new_sources, $new_dest;
|
|
}
|
|
if (! rdb_rule_exists( $$Pfrom_rule ) ) {
|
|
print "=== Creating rule for '$$Pfrom_rule'\n";
|
|
rdb_create_rule( $$Pfrom_rule, 'cusdep', '', \@PAnew_cmd, 3,
|
|
$source, $new_dest, $base_name, 0 );
|
|
}
|
|
else {
|
|
rdb_one_rule(
|
|
$$Pfrom_rule,
|
|
sub{ @$PAint_cmd = @PAnew_cmd; $$Pdest = $new_dest;}
|
|
);
|
|
}
|
|
return;
|
|
}
|
|
else {
|
|
# Source file does not exist
|
|
if ( !$force_mode && ( $must != 0 ) ) {
|
|
# But it is required that the source exist ($must !=0)
|
|
$failure = 1;
|
|
$failure_msg = "File '$base_name.$fromext' does not exist ".
|
|
"to build '$base_name.$toext'";
|
|
return;
|
|
}
|
|
elsif ( $$Pfrom_rule =~ /^cusdep $fromext $toext / ) {
|
|
# Source file does not exist, destination has the rule set.
|
|
# So turn the from_rule off
|
|
$$Pfrom_rule = '';
|
|
}
|
|
else {
|
|
}
|
|
}
|
|
}
|
|
elsif ( ($toext eq '')
|
|
&& (! -e $file )
|
|
&& (! -e "$base_name.$proptoext" )
|
|
&& exists $$Pinput_extensions{$proptoext}
|
|
) {
|
|
# Empty extension and non-existent destination
|
|
# This normally results from \includegraphics{A}
|
|
# without graphics extension for file, when file does
|
|
# not exist. So we will try to find something to make it.
|
|
my $source = "$base_name.$fromext";
|
|
if ( -e $source ) {
|
|
$new_dest = "$base_name.$proptoext";
|
|
my $from_rule = "cusdep $fromext $proptoext $base_name";
|
|
push @new_sources, $new_dest;
|
|
print "Ensuring rule for '$from_rule', to make '$new_dest'\n"
|
|
if $diagnostics > -1;
|
|
local @PAnew_cmd = ( 'do_cusdep', $func_name );
|
|
if (! rdb_rule_exists( $from_rule ) ) {
|
|
rdb_create_rule( $from_rule, 'cusdep', '', \@PAnew_cmd, 3,
|
|
$source, $new_dest, $base_name, 0 );
|
|
}
|
|
else {
|
|
rdb_one_rule(
|
|
$$Pfrom_rule,
|
|
sub{ @$PAint_cmd = @PAnew_cmd; $$Pdest = $new_dest;}
|
|
);
|
|
}
|
|
rdb_ensure_file( $rule, $new_dest, $from_rule );
|
|
# We've now got a spurious file in our rule. But don't mess
|
|
# with deleting an item we are in the middle of!
|
|
push @deletions, [$rule, $file];
|
|
return;
|
|
}
|
|
} # End of Rule found
|
|
} # End DEP
|
|
if ( (! -e $file) && $use_make_for_missing_files ) {
|
|
# Try to make the missing file
|
|
#Set character to surround filenames in commands:
|
|
my $q = $quote_filenames ? '"' : '';
|
|
if ( $toext ne '' ) {
|
|
print "$My_name: '$rule': source file '$file' doesn't exist. I'll try making it...\n";
|
|
&Run_subst( "$make $q$file$q" );
|
|
if ( -e $file ) {
|
|
return;
|
|
}
|
|
}
|
|
else {
|
|
print "$My_name: '$rule': source '$file' doesn't exist.\n",
|
|
" I'll try making it with allowed extensions \n";
|
|
foreach my $try_ext ( keys %$Pinput_extensions ) {
|
|
my $new_dest = "$file.$try_ext";
|
|
&Run_subst( "$make $q$new_dest$q" );
|
|
if ( -e $new_dest ) {
|
|
print "SUCCESS in making '$new_dest'\n";
|
|
# Put file in rule, without a from_rule, but
|
|
# set its state as non-existent, to correspond
|
|
# to file's state before the file was made
|
|
# This ensures a rerun of (pdf)latex is provoked.
|
|
rdb_ensure_file( $rule, $new_dest, undef, 1 );
|
|
push @new_sources, $new_dest;
|
|
push @deletions, [$rule, $file];
|
|
# Flag need for a new run of (pdf)latex despite
|
|
# the error due to a missing file.
|
|
$$Pout_of_date_user = 1;
|
|
return;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
} #END rdb_one_dep
|
|
|
|
#************************************************************
|
|
|
|
sub rdb_list {
|
|
# Call: rdb_list()
|
|
# List rules and their source files
|
|
print "===Rules:\n";
|
|
local $count_rules = 0;
|
|
my @accessible_all = rdb_accessible( keys %requested_filerules );
|
|
rdb_for_some(
|
|
\@accessible_all,
|
|
sub{ $count_rules++;
|
|
print "Rule '$rule' depends on:\n";
|
|
},
|
|
sub{ print " '$file'\n"; },
|
|
sub{ print " and generates:\n";
|
|
foreach (keys %$PHdest) { print " '$_'\n"; }
|
|
# print " default_extra_generated:\n";
|
|
# foreach (@$PA_extra_generated) { print " '$_'\n"; }
|
|
},
|
|
);
|
|
if ($count_rules <= 0) {
|
|
print " ---No rules defined\n";
|
|
}
|
|
} #END rdb_list
|
|
|
|
#************************************************************
|
|
|
|
sub deps_list {
|
|
# Call: deps_list(fh)
|
|
# List dependent files to file open on fh
|
|
my $fh = $_[0];
|
|
print $fh "#===Dependents for $filename:\n";
|
|
my @dest_exts = ();
|
|
if ($pdf_mode) {push @dest_exts, '.pdf';}
|
|
if ($dvi_mode) {push @dest_exts, '.dvi';}
|
|
if ($postscript_mode) {push @dest_exts, '.ps';}
|
|
my %source = ( $texfile_name => 1 );
|
|
my @generated = ();
|
|
my @accessible_all = rdb_accessible( keys %requested_filerules );
|
|
rdb_for_some(
|
|
\@accessible_all,
|
|
sub{
|
|
# foreach (keys %$PHdest) { print "----- $_\n"; }
|
|
push @generated, keys %$PHdest;
|
|
},
|
|
sub{ $source{$file} = 1; }
|
|
);
|
|
foreach (keys %generated_exts_all) {
|
|
(my $name = /%R/ ? $_ : "%R.$_") =~ s/%R/$root_filename/;
|
|
push @generated, $name;
|
|
}
|
|
foreach (@generated) {
|
|
delete $source{$_};
|
|
}
|
|
foreach my $ext (@dest_exts) {
|
|
if ($deps_file eq '-' ) {
|
|
print $fh "${out_dir1}${root_filename}${ext} :";
|
|
} else {
|
|
print $fh "${out_dir1}${root_filename}${ext} $deps_file :";
|
|
}
|
|
foreach (sort keys %source) {
|
|
print $fh "\\\n $_";
|
|
}
|
|
print $fh "\n";
|
|
}
|
|
print $fh "#===End dependents for $filename:\n";
|
|
if ($dependents_phony) {
|
|
print $fh "\n#===Phony rules for $filename:\n\n";
|
|
foreach (sort keys %source) {
|
|
print $fh "$_ :\n\n";
|
|
}
|
|
print $fh "#===End phony rules for $filename:\n";
|
|
}
|
|
} #END deps_list
|
|
|
|
#************************************************************
|
|
|
|
sub rdb_show {
|
|
# Call: rdb_show()
|
|
# Displays contents of rule data base.
|
|
# Side effect: Exercises access routines!
|
|
print "===Rules:\n";
|
|
local $count_rules = 0;
|
|
rdb_for_all(
|
|
sub{ $count_rules++;
|
|
my @int_cmd = @$PAint_cmd;
|
|
foreach (@int_cmd) {
|
|
if ( !defined($_) ) { $_='undef';}
|
|
}
|
|
print " [$rule]: '$$Pcmd_type' '$$Pext_cmd' '@int_cmd' $$Ptest_kind ",
|
|
"'$$Psource' '$$Pdest' '$$Pbase' $$Pout_of_date $$Pout_of_date_user\n"; },
|
|
sub{ print " '$file': $$Ptime $$Psize $$Pmd5 '$$Pfrom_rule'\n"; }
|
|
);
|
|
if ($count_rules <= 0) {
|
|
print " ---No rules defined\n";
|
|
}
|
|
} #END rdb_show
|
|
|
|
#************************************************************
|
|
|
|
sub rdb_accessible {
|
|
# Call: rdb_accessible( rule, ...)
|
|
# Returns array of rules accessible from the given rules
|
|
local @accessible = ();
|
|
rdb_recurse( [@_], sub{ push @accessible, $rule; } );
|
|
return @accessible;
|
|
} #END rdb_accessible
|
|
|
|
#************************************************************
|
|
#************************************************************
|
|
#************************************************************
|
|
|
|
sub rdb_make {
|
|
# Call: rdb_make( target, ... )
|
|
# Makes the targets and prerequisites.
|
|
# Leaves one-time rules to last.
|
|
# Does appropriate repeated makes to resolve dependency loops
|
|
|
|
# Returns 0 on success, nonzero on failure.
|
|
|
|
# General method: Find all accessible rules, then repeatedly make
|
|
# them until all accessible rules are up-to-date and the source
|
|
# files are unchanged between runs. On termination, all
|
|
# accessible rules have stable source files.
|
|
#
|
|
# One-time rules are view and print rules that should not be
|
|
# repeated in an algorithm that repeats rules until the source
|
|
# files are stable. It is the calling routine's responsibility to
|
|
# arrange to call them, or to use them here with caution.
|
|
#
|
|
# Note that an update-viewer rule need not be considered
|
|
# one-time. It can be legitimately applied everytime the viewed
|
|
# file changes.
|
|
#
|
|
# Note also that the criterion of stability is to be applied to
|
|
# source files, not to output files. Repeated application of a
|
|
# rule to IDENTICALLY CONSTANT source files may produce different
|
|
# output files. This may be for a trivial reason (e.g., the
|
|
# output file contains a time stamp, as in the header comments for
|
|
# a typical postscript file), or for a non-trivial reason (e.g., a
|
|
# stochastic algorithm, as in abcm2ps).
|
|
#
|
|
# This caused me some actual trouble. In general, circular
|
|
# dependencies produce non-termination, and the the following
|
|
# situation is an example of a generic situation where certain
|
|
# rules must be obeyed in order to obtain proper results:
|
|
# 1. A/the latex source file contains specifications for
|
|
# certain postprocessing operations. Standard (pdf)latex
|
|
# already has this, for indexing and bibliography.
|
|
# 2. In the case in point that caused me trouble, the
|
|
# specification was for musical tunes that were contained
|
|
# in external source files not directly input to
|
|
# (pdf)latex. But in the original version, there was a
|
|
# style file (abc.sty) that caused latex itself to call
|
|
# abcm2ps to make .eps files for each tune that were to be
|
|
# read in on the next run of latex.
|
|
# 3. Thus the specification can cause a non-terminating loop
|
|
# for latexmk, because the output files of abcm2ps changed
|
|
# even with identical input.
|
|
# 4. The solution was to
|
|
# a. Use a style file abc_get.sty that simply wrote the
|
|
# specification on the tunes to the .aux file in a
|
|
# completely deterministic fashion.
|
|
# b. Instead of latex, use a script abclatex.pl that runs
|
|
# latex and then extracts the abc contents for each tune
|
|
# from the source abc file. This is also
|
|
# deterministic.
|
|
# c. Use a cusdep rule in latexmk to convert the tune abc
|
|
# files to eps. This is non-deterministic, but only
|
|
# gets called when the (deterministic) source file
|
|
# changes.
|
|
# This solves the problem. Latexmk works. Also, it is no
|
|
# longer necessary to enable write18 in latex, and multiple
|
|
# unnecessary runs of abcm2ps are no longer used.
|
|
#
|
|
# The order of testing and applying rules is chosen by the
|
|
# following heuristics:
|
|
# 1. Both latex and pdflatex may be used, but the resulting
|
|
# aux files etc may not be completely identical. Define
|
|
# latex and pdflatex as primary rules. Apply the general
|
|
# method of repeated circulating through all rules until
|
|
# the source files are stable for each primary rule
|
|
# separately. Naturally the rules are all accessible
|
|
# rules, but excluding primary rules except for the current
|
|
# primary.
|
|
# 2. Assume that the primary rules are relatively
|
|
# time-consuming, so that unnecessary passes through them
|
|
# to check stability of the source files should be avoided.
|
|
# 3. Assume that although circular dependencies exist, the
|
|
# rules can nevertheless be thought of as basically
|
|
# non-circular, and that many rules are strictly or
|
|
# normally non-circular. In particular cusdep rules are
|
|
# typically non-circular (e.g., fig2eps), as are normal
|
|
# output processing rules like dvi2ps.
|
|
# 4. The order for the non-circular approximation is
|
|
# determined by applying the assumption that an output file
|
|
# from one rule that is read in for an earlier stage is
|
|
# unchanged.
|
|
# HOWEVER, at a first attempt, the ordering is not needed. It
|
|
# only gives an optimization
|
|
# 5. (Note that these assumptions could be violated, e.g., if
|
|
# $dvips is arranged not only to do the basic dvips
|
|
# command, but also to extract information from the ps file
|
|
# and feed it back to an input file for (pdf)latex.)
|
|
# 6. Nevertheless, the overall algorithm should allow
|
|
# circularities. Then the general criterion of stability
|
|
# of source files covers the general case, and also
|
|
# robustly handles the case that the USER changes source
|
|
# files during a run. This is particularly important in
|
|
# -pvc mode, given that a full make on a large document can
|
|
# be quite lengthy in time, and moreover that a user
|
|
# naturally wishes to make corrections in response to
|
|
# errors, particularly latex errors, and have them apply
|
|
# right away.
|
|
# This leads to the following approach:
|
|
# 1. Classify accessible rules as: primary, pre-primary
|
|
# (typically cusdep, bibtex, makeindex, etc), post-primary
|
|
# (typically dvips, etc), and one-time
|
|
# 2. Then stratify the rules into an order of application that
|
|
# corresponds to the basic feedforward structure, with the
|
|
# exclusion of one-time rules.
|
|
# 3. Always require that one-time rules are among the
|
|
# explicitly requested rules, i.e., the last to be applied,
|
|
# were we to apply them. Anything else would not match the
|
|
# idea of a one-time rule.
|
|
# 4. Then work as follows:
|
|
# a. Loop over primaries
|
|
# b. For each primary, examine each pre-primary rule and
|
|
# apply if needed, then the primary rule and then each
|
|
# post-primary rule. The ordering of the pre-primary
|
|
# and post-primary rules was found in step 2.
|
|
# BUT applying the ordering is not essential
|
|
# c. Any time that a pre-primary or primary rule is
|
|
# applied, loop back to the beginning of step b. This
|
|
# ensures that bibtex etc are applied before rerunning
|
|
# (pdf)latex, and also covers changing source files, and
|
|
# gives priority to quick pre-primary rules for changing
|
|
# source files against slow reruns of latex.
|
|
# d. Then apply post-primary rules in order, but not
|
|
# looping back after each rule. This non-looping back
|
|
# is because the rules are normally feed-forward only.
|
|
# BUT applying the ordering is not essential
|
|
# e. But after completing post-primary rules do loop back
|
|
# to b if any rules were applied. This covers exotic
|
|
# circular dependence (and as a byproduct, changing
|
|
# source files).
|
|
# f. On each case of looping back to b, re-evaluate the
|
|
# dependence setup to allow for the effect of changing
|
|
# source files.
|
|
#
|
|
|
|
local @requested_targets = @_;
|
|
local %current_primaries = (); # Hash whose keys are primary rules
|
|
# needed, i.e., known latex-like rules which trigger
|
|
# circular dependencies
|
|
local @pre_primary = (); # Array of rules
|
|
local @post_primary = (); # Array of rules
|
|
local @unusual_one_time = (); # Array of rules
|
|
|
|
|
|
# For diagnostics on changed files, etc:
|
|
local @changed = ();
|
|
local @disappeared = ();
|
|
local @no_dest = (); # Non-existent destination files
|
|
local @rules_never_run = ();
|
|
local @rules_to_apply = ();
|
|
|
|
&rdb_classify_rules( \%possible_primaries, @requested_targets );
|
|
|
|
local %pass = ();
|
|
local $failure = 0; # General accumulated error flag
|
|
local $missing_dvi_pdf = ''; # Did primary run fail to make its output file?
|
|
local $runs = 0;
|
|
local $too_many_passes = 0;
|
|
local %rules_applied = ();
|
|
my $retry_msg = 0; # Did I earlier say I was going to attempt
|
|
# another pass after a failure?
|
|
PRIMARY:
|
|
foreach my $primary (keys %current_primaries ) {
|
|
foreach my $rule (keys %rule_db) {
|
|
$pass{$rule} = 0;
|
|
}
|
|
PASS:
|
|
while (1==1) {
|
|
# Exit condition at end of body of loop.
|
|
$runs = 0;
|
|
my $previous_failure = $failure;
|
|
$failure = 0;
|
|
local $newrule_nofile = 0; # Flags whether rule created for
|
|
# making currently non-existent file, which
|
|
# could become a needed source file for a run
|
|
# and therefore undo an error condition
|
|
if ($diagnostics) {
|
|
print "Make: doing pre_primary and primary...\n";
|
|
}
|
|
# Do the primary run if it is needed. On return $runs == 0
|
|
# signals that nothing was run (and hence no output
|
|
# files changed), either because no input files
|
|
# changed and no run was needed, or because the
|
|
# number of passes through the rule exceeded the
|
|
# limit. In the second case $too_many_runs is set.
|
|
rdb_for_some( [@pre_primary, $primary], \&rdb_make1 );
|
|
if ( ($runs > 0) && ! $too_many_passes ) {
|
|
$retry_msg = 0;
|
|
if ( $force_mode || (! $failure) ) {
|
|
next PASS;
|
|
}
|
|
# Get here on failure, without being in force_mode
|
|
if ( $newrule_nofile ) {
|
|
$retry_msg = 1;
|
|
print "$My_name: Error on run, but found possibility to ",
|
|
"make new source files\n";
|
|
next PASS;
|
|
}
|
|
else { last PASS; }
|
|
}
|
|
if ($runs == 0) {
|
|
# $failure not set on this pass, so use value from previous pass:
|
|
$failure = $previous_failure;
|
|
if ($retry_msg) {
|
|
print "But in fact no new files made\n";
|
|
}
|
|
if ($failure && !$force_mode ) { last PASS; }
|
|
}
|
|
if ( $missing_dvi_pdf ) {
|
|
# No output from primary, after completing circular dependence
|
|
warn "Failure to make '$missing_dvi_pdf'\n";
|
|
$failure = 1;
|
|
last PASS;
|
|
}
|
|
if ($diagnostics) {
|
|
print "Make: doing post_primary...\n";
|
|
}
|
|
rdb_for_some( [@post_primary], \&rdb_make1 );
|
|
if ( ($runs == 0) || $too_many_passes ) {
|
|
# If $too_many_passes is set, it should also be that
|
|
# $runs == 0; but for safety, I also checked
|
|
# $too_many_passes.
|
|
last PASS;
|
|
}
|
|
}
|
|
continue {
|
|
# Re-evaluate rule classification and accessibility,
|
|
# but do not change primaries.
|
|
# Problem is that %current_primaries gets altered
|
|
my %old_curr_prim = %current_primaries;
|
|
&rdb_classify_rules( \%possible_primaries, @requested_targets );
|
|
%current_primaries = %old_curr_prim;
|
|
&rdb_make_links;
|
|
}
|
|
}
|
|
rdb_for_some( [@unusual_one_time], \&rdb_make1 );
|
|
rdb_write( $fdb_name );
|
|
|
|
if (! $silent) {
|
|
if ($failure && $force_mode) {
|
|
print "$My_name: Errors, in force_mode: so I tried finishing targets\n";
|
|
}
|
|
elsif ($failure) {
|
|
print "$My_name: Errors, so I did not complete making targets\n";
|
|
}
|
|
else {
|
|
local @dests = ();
|
|
rdb_for_some( [@_], sub{ push @dests, $$Pdest if ($$Pdest); } );
|
|
print "$My_name: All targets (@dests) are up-to-date\n";
|
|
}
|
|
}
|
|
return $failure;
|
|
} #END rdb_make
|
|
|
|
#-------------------
|
|
|
|
sub rdb_show_rule_errors {
|
|
local @errors = ();
|
|
local @warnings = ();
|
|
rdb_for_all(
|
|
sub{
|
|
if ($$Plast_message ne '') {
|
|
if ($$Plast_result == 200) {
|
|
push @warnings, "$rule: $$Plast_message";
|
|
}
|
|
else {
|
|
push @errors, "$rule: $$Plast_message";
|
|
}
|
|
}
|
|
elsif ($$Plast_result == 1) {
|
|
push @errors, "$rule: failed to create output file";
|
|
}
|
|
elsif ($$Plast_result == 2) {
|
|
push @errors, "$rule: gave an error";
|
|
}
|
|
elsif ($$Prun_time == 0) {
|
|
# This can have innocuous causes. So don't report
|
|
}
|
|
}
|
|
);
|
|
if ($#warnings > -1) {
|
|
warn "Collected warning summary (may duplicate other messages):\n";
|
|
foreach (@warnings){
|
|
warn " $_\n";
|
|
}
|
|
}
|
|
if ($#errors > -1) {
|
|
warn "Collected error summary (may duplicate other messages):\n";
|
|
foreach (@errors){
|
|
warn " $_\n";
|
|
}
|
|
}
|
|
return $#errors+1;
|
|
}
|
|
|
|
#-------------------
|
|
|
|
sub rdb_make1 {
|
|
# Call: rdb_make1
|
|
# Helper routine for rdb_make.
|
|
# Carries out make at level of given rule (all data available).
|
|
# Assumes contexts for recursion, make, and rule, and
|
|
# assumes that source files for the rule are to be considered
|
|
# up-to-date.
|
|
if ($diagnostics) { print " Make1 $rule\n"; }
|
|
if ($failure & ! $force_mode) {return;}
|
|
if ( ! defined $pass{$rule} ) {$pass{$rule} = 0; }
|
|
&rdb_clear_change_record;
|
|
|
|
# Special fix up for bibtex:
|
|
my $bibtex_not_run = -1; # Flags status as to whether this is a
|
|
# bibtex rule and if it is, whether out-of-date condition is to
|
|
# be ignored.
|
|
# -1 => not a bibtex rule
|
|
# 0 => no special treatment
|
|
# 1 => don't run bibtex because of non-existent bibfiles
|
|
# (and setting to do this test)
|
|
# 2 => don't run bibtex because of setting
|
|
my @missing_bib_files = ();
|
|
if ( $rule =~ /^(bibtex|biber)/ ) {
|
|
$bibtex_not_run = 0;
|
|
if ($bibtex_use == 0) {
|
|
$bibtex_not_run = 2;
|
|
}
|
|
elsif ($bibtex_use == 1) {
|
|
foreach ( keys %$PHsource ) {
|
|
if ( ( /\.bib$/ ) && (! -e $_) ) {
|
|
push @missing_bib_files, $_;
|
|
$bibtex_not_run = 1;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
|
|
if ( ($$Prun_time == 0) && exists($possible_primaries{$rule}) ) {
|
|
push @rules_never_run, $rule;
|
|
$$Pout_of_date = 1;
|
|
$$Plast_result = -1;
|
|
}
|
|
else {
|
|
if ( $$Pdest && (! -e $$Pdest) ) {
|
|
# With a non-existent destination, if we haven't made any passes
|
|
# through a rule, rerunning the rule is good, because the file
|
|
# may fail to exist because of being deleted by the user (for ex.)
|
|
# rather than because of a failure on a previous run.
|
|
# (We could do better with a flag in fdb file.)
|
|
# But after the first pass, the situation is different.
|
|
# For a primary rule (pdf)latex, the lack of a destination file
|
|
# could result from there being zero content due to a missing
|
|
# essential input file. The input file could be generated
|
|
# by a program to be run later (e.g., a cusdep or bibtex),
|
|
# so we should wait until all passes are completed before
|
|
# deciding a non-existent destination file is an error.
|
|
# For a custom dependency, the rule may be obsolete, and
|
|
# if the source file does not exist also, we should simply
|
|
# not run the rule, but not set an error condition.
|
|
# Any error will arise at the (pdf)latex level due to a
|
|
# missing source file at that level.
|
|
if ( $$Psource && (! -e $$Psource)
|
|
# OLD && ( ( $$Pcmd_type eq 'cusdep') )
|
|
# NEW
|
|
&& ( ( $$Pcmd_type ne 'primary') )
|
|
) {
|
|
# Main source file doesn't exist, and rule is NOT primary.
|
|
# No action, since a run is pointless. Primary is different:
|
|
# file might be found elsewhere (by kpsearch from (pdf)latex),
|
|
# while non-existence of main source file is a clear error.
|
|
}
|
|
elsif ( $$Pcmd_type eq 'delegated' ) {
|
|
# Delegate to destination rule
|
|
}
|
|
elsif ( $pass{$rule}==0) {
|
|
push @no_dest, $$Pdest;
|
|
$$Pout_of_date = 1;
|
|
}
|
|
if ( $$Pcmd_type eq 'primary' ) {
|
|
$missing_dvi_pdf = $$Pdest;
|
|
}
|
|
}
|
|
}
|
|
|
|
&rdb_flag_changes_here(0);
|
|
|
|
if (!$$Pout_of_date) {
|
|
#?? if ( ($$Pcmd_type eq 'primary') && (! $silent) ) {
|
|
# print "Rule '$rule' up to date\n";
|
|
# }
|
|
return;
|
|
}
|
|
if ($diagnostics) { print " remake\n"; }
|
|
if (!$silent) {
|
|
print "$My_name: applying rule '$rule'...\n";
|
|
&rdb_diagnose_changes( "Rule '$rule': " );
|
|
}
|
|
|
|
# We are applying the rule, so its source file state for when it
|
|
# was last made is as of now:
|
|
# ??IS IT CORRECT TO DO NOTHING IN CURRENT VERSION?
|
|
|
|
# The actual run
|
|
my $return = 0; # Return code from called routine
|
|
# Rule may have been created since last run:
|
|
if ( ! defined $pass{$rule} ) {$pass{$rule} = 0; }
|
|
if ( $pass{$rule} >= $max_repeat ) {
|
|
# Avoid infinite loop by having a maximum repeat count
|
|
# Getting here represents some kind of weird error.
|
|
warn "$My_name: Maximum runs of $rule reached ",
|
|
"without getting stable files\n";
|
|
$too_many_passes = 1;
|
|
# Treat rule as completed, else in -pvc mode get infinite reruns:
|
|
$$Pout_of_date = 0;
|
|
$failure = 1;
|
|
$failure_msg = "'$rule' needed too many passes";
|
|
return;
|
|
}
|
|
|
|
$rules_applied{$rule} = 1;
|
|
$runs++;
|
|
|
|
$pass{$rule}++;
|
|
if ($bibtex_not_run > 0) {
|
|
if ($bibtex_not_run == 1 ) {
|
|
show_array ("$My_name: I WON'T RUN '$rule' because I don't find the following files:",
|
|
@missing_bib_files);
|
|
}
|
|
elsif ($bibtex_not_run == 2 ) {
|
|
warn "$My_name: I AM CONFIGURED/INVOKED NOT TO RUN '$rule'\n";
|
|
}
|
|
$return = &rdb_dummy_run1;
|
|
}
|
|
else {
|
|
warn_running( "Run number $pass{$rule} of rule '$rule'" );
|
|
if ($$Pcmd_type eq 'primary' ) {
|
|
$return = &rdb_primary_run;
|
|
}
|
|
else { $return = &rdb_run1; }
|
|
}
|
|
if ($$Pchanged) {
|
|
$newrule_nofile = 1;
|
|
$return = 0;
|
|
}
|
|
elsif ( $$Pdest && ( !-e $$Pdest ) && (! $failure) ){
|
|
# If there is a destination to make, but for some reason
|
|
# it did not get made, and no other error was reported,
|
|
# then a priori there appears to be an error condition:
|
|
# the run failed. But there are some important cases in
|
|
# which this is a wrong diagnosis.
|
|
if ( ( $$Pcmd_type eq 'cusdep') && $$Psource && (! -e $$Psource) ) {
|
|
# However, if the rule is a custom dependency, this is not by
|
|
# itself an error, if also the source file does not exist. In
|
|
# that case, we may have the situation that (1) the dest file is no
|
|
# longer needed by the tex file, and (2) therefore the user
|
|
# has deleted the source and dest files. After the next
|
|
# latex run and the consequent analysis of the log file, the
|
|
# cusdep rule will no longer be needed, and will be removed.
|
|
|
|
# So in this case, do NOT report an error
|
|
$$Pout_of_date = 0;
|
|
}
|
|
elsif ($$Pcmd_type eq 'primary' ) {
|
|
# For a primary rule, i.e., (pdf)latex, not to produce the
|
|
# expected output file may not be an error condition.
|
|
# Diagnostics were handled in parsing the log file.
|
|
# Special action in main loop in rdb_make
|
|
$missing_dvi_pdf = $$Pdest;
|
|
}
|
|
elsif ($return == -2) {
|
|
# Missing output file was reported to be NOT an error
|
|
$$Pout_of_date = 0;
|
|
}
|
|
elsif ( ($bibtex_use <= 1) && ($bibtex_not_run > 0) ) {
|
|
# Lack of destination file is not to be treated as an error
|
|
# for a bibtex rule when latexmk is configured not to treat
|
|
# this as an error, and the lack of a destination file is the
|
|
# only error.
|
|
$$Pout_of_date = 0;
|
|
}
|
|
else {
|
|
$failure = 1;
|
|
}
|
|
}
|
|
if ( ($return != 0) && ($return != -2) ) {
|
|
$failure = 1;
|
|
$$Plast_result = 2;
|
|
if ( !$$Plast_message ) {
|
|
$$Plast_message = "Run of rule '$rule' gave a non-zero error code";
|
|
}
|
|
# !!?? $failure_msg = $$Plast_message;
|
|
|
|
}
|
|
} #END rdb_make1
|
|
|
|
#************************************************************
|
|
|
|
#??sub rdb_submake {
|
|
#?? # Call: rdb_submake
|
|
#?? # Makes all the source files for a given rule.
|
|
#?? # Assumes contexts for recursion, for make, and rule.
|
|
#?? %visited = %visited_at_rule_start;
|
|
#?? local $failure = 0; # Error flag
|
|
#?? my @v = keys %visited;
|
|
#?? rdb_do_files( sub{ rdb_recurse_rule( $$Pfrom_rule, 0,0,0, \&rdb_make1 ) } );
|
|
#?? return $failure;
|
|
#??} #END rdb_submake
|
|
|
|
#************************************************************
|
|
|
|
sub rdb_classify_rules {
|
|
# Usage: rdb_classify_rules( \%allowed_primaries, requested targets )
|
|
# Assume the following variables are available (global or local):
|
|
# Input:
|
|
# @requested_targets # Set to target rules
|
|
|
|
# Output:
|
|
# %current_primaries # Keys are actual primaries
|
|
# @pre_primary # Array of rules
|
|
# @post_primary # Array of rules
|
|
# @unusual_one_time # Array of rules
|
|
# @pre_primary and @post_primary are in natural order of application.
|
|
|
|
local $P_allowed_primaries = shift;
|
|
local @requested_targets = @_;
|
|
local $state = 0; # Post-primary
|
|
local @classify_stack = ();
|
|
|
|
%current_primaries = ();
|
|
@pre_primary = ();
|
|
@post_primary = ();
|
|
@unusual_one_time = ();
|
|
|
|
rdb_recurse( \@requested_targets, \&rdb_classify1, 0,0, \&rdb_classify2 );
|
|
|
|
# Reverse, as tendency is to find last rules first.
|
|
@pre_primary = reverse @pre_primary;
|
|
@post_primary = reverse @post_primary;
|
|
|
|
if ($diagnostics) {
|
|
print "Rule classification: \n";
|
|
if ($#requested_targets < 0) {
|
|
print " No requested rules\n";
|
|
}
|
|
else {
|
|
print " Requested rules:\n";
|
|
foreach ( @requested_targets ) { print " $_\n"; }
|
|
}
|
|
if ($#pre_primary < 0) {
|
|
print " No pre-primaries\n";
|
|
}
|
|
else {
|
|
print " Pre-primaries:\n";
|
|
foreach (@pre_primary) { print " $_\n"; }
|
|
}
|
|
print " Primaries:\n";
|
|
foreach (keys %current_primaries) { print " $_\n"; }
|
|
if ($#post_primary < 0) {
|
|
print " No post-primaries\n";
|
|
}
|
|
else {
|
|
print " Post-primaries:\n";
|
|
foreach (@post_primary) { print " $_\n"; }
|
|
}
|
|
if ($#unusual_one_time < 0) {
|
|
print " No inner-level one_time rules, as expected\n";
|
|
}
|
|
else {
|
|
print " Inner-level one_time rules:\n";
|
|
foreach ( @unusual_one_time ) { print " $_\n"; }
|
|
}
|
|
my @normal_one_time = keys %one_time;
|
|
if ($#normal_one_time < 0) {
|
|
print " No outer-level one_time rules\n";
|
|
}
|
|
else {
|
|
print " Outer-level one_time rules:\n";
|
|
foreach ( @normal_one_time ) { print " $_\n"; }
|
|
}
|
|
} #end diagnostics
|
|
|
|
} #END rdb_classify_rules
|
|
|
|
#-------------------
|
|
|
|
sub rdb_classify1 {
|
|
# Helper routine for rdb_classify_rules
|
|
# Applied as rule_act1 in recursion over rules
|
|
# Assumes rule context, and local variables from rdb_classify_rules
|
|
push @classify_stack, [$state];
|
|
if ( exists $possible_one_time{$rule} ) {
|
|
# Normally, we will have already extracted the one_time rules,
|
|
# and they will never be accessed here. But just in case of
|
|
# problems or generalizations, we will cover all possibilities:
|
|
if ($depth > 1) {
|
|
warn "ONE TIME rule not at outer level '$rule'\n";
|
|
}
|
|
push @unusual_one_time, $rule;
|
|
}
|
|
elsif ($state == 0) {
|
|
if ( exists ${$P_allowed_primaries}{$rule} ) {
|
|
$state = 1; # In primary rule
|
|
$current_primaries{ $rule } = 1;
|
|
}
|
|
else {
|
|
push @post_primary, $rule;
|
|
}
|
|
}
|
|
else {
|
|
$state = 2; # in post-primary rule
|
|
push @pre_primary, $rule;
|
|
}
|
|
} #END rdb_classify1
|
|
|
|
#-------------------
|
|
|
|
sub rdb_classify2 {
|
|
# Helper routine for rdb_classify_rules
|
|
# Applied as rule_act2 in recursion over rules
|
|
# Assumes rule context
|
|
($state) = @{ pop @classify_stack };
|
|
} #END rdb_classify2
|
|
|
|
#************************************************************
|
|
|
|
|
|
sub rdb_run1 {
|
|
# Assumes contexts for: rule.
|
|
# Unconditionally apply the rule
|
|
# Returns return code from applying the rule.
|
|
# Otherwise: 0 on other kind of success,
|
|
# -1 on error,
|
|
# -2 when missing dest_file is to be ignored
|
|
|
|
# Source file data, by definition, correspond to the file state just
|
|
# before the latest run, and the run_time to the time just before the run:
|
|
&rdb_update_files;
|
|
$$Prun_time = time;
|
|
$$Pchanged = 0; # No special changes in files
|
|
$$Plast_result = 0;
|
|
$$Plast_message = '';
|
|
|
|
# Return values for external command:
|
|
my $return = 0;
|
|
|
|
# Find any internal command
|
|
my @int_args = @$PAint_cmd;
|
|
my $int_cmd = shift @int_args;
|
|
my @int_args_for_printing = @int_args;
|
|
foreach (@int_args_for_printing) {
|
|
if ( ! defined $_ ) { $_ = 'undef'; }
|
|
}
|
|
if ($int_cmd) {
|
|
print "For rule '$rule', running '\&$int_cmd( @int_args_for_printing )' ...\n";
|
|
$return = &$int_cmd( @int_args );
|
|
}
|
|
elsif ($$Pext_cmd) {
|
|
$return = &Run_subst() / 256;
|
|
}
|
|
else {
|
|
warn "$My_name: Either a bug OR a configuration error:\n",
|
|
" No command provided for '$rule'\n";
|
|
&traceback();
|
|
$return = -1;
|
|
$$Plast_result = 2;
|
|
$$Plast_message = "Bug or configuration error; incorrect command type";
|
|
}
|
|
if ( $rule =~ /^biber/ ) {
|
|
my @biber_source = ( );
|
|
my $retcode = check_biber_log( $$Pbase, \@biber_source );
|
|
foreach my $source ( @biber_source ) {
|
|
print " ===Source file '$source' for '$rule'\n"
|
|
if ($diagnostics);
|
|
rdb_ensure_file( $rule, $source );
|
|
}
|
|
if ($retcode == 5) {
|
|
# Special treatment if sole missing file is bib file
|
|
# I don't want to treat that as an error
|
|
$return = 0;
|
|
$$Plast_result = 200;
|
|
$$Plast_message = "Could not find bib file for '$$Pbase'";
|
|
push @warnings, "Bib file not found for '$$Pbase'";
|
|
}
|
|
elsif ($retcode == 6) {
|
|
# Missing control file. Need to remake it (if possible)
|
|
# Don't treat missing bbl file as error.
|
|
warn "$My_name: bibtex control file missing. Since that can\n",
|
|
" be recreated, I'll try to do so.\n";
|
|
$return = -2;
|
|
rdb_for_some( [keys %current_primaries], sub{ $$Pout_of_date = 1; } );
|
|
}
|
|
elsif ($retcode == 4) {
|
|
$$Plast_result = 2;
|
|
$$Plast_message = "Could not find all biber source files for '$$Pbase'";
|
|
push @warnings, "Not all biber source files found for '$$Pbase'";
|
|
}
|
|
elsif ($retcode == 3) {
|
|
$$Plast_result = 2;
|
|
$$Plast_message = "Could not open biber log file for '$$Pbase'";
|
|
push @warnings, $$Plast_message;
|
|
}
|
|
elsif ($retcode == 2) {
|
|
$$Plast_message = "Biber errors: See file '$$Pbase.blg'";
|
|
push @warnings, $$Plast_message;
|
|
}
|
|
elsif ($retcode == 1) {
|
|
push @warnings, "Biber warnings for '$$Pbase'";
|
|
}
|
|
elsif ($retcode == 10) {
|
|
push @warnings, "Biber found no citations for '$$Pbase'";
|
|
# Biber doesn't generate a bbl file in this situation.
|
|
$return = -2;
|
|
}
|
|
elsif ($retcode == 11) {
|
|
push @warnings, "Biber: malformed bcf file for '$$Pbase'. IGNORE";
|
|
if (!$silent) {
|
|
warn "$My_name: biber found malformed bcf file for '$$Pbase'.\n",
|
|
" I'll ignore error, and delete any bbl file.\n";
|
|
}
|
|
# Malformed bcf file is a downstream consequence, normally,
|
|
# of an error in (pdf)latex run. So this is not an error
|
|
# condition in biber itself.
|
|
# Current version of biber deletes bbl file.
|
|
# Older versions (pre-2016) made an incorrect bbl file, which
|
|
# tended to cause latex errors, and give a self-perpetuating error.
|
|
# To be safe, ensure the bbl file doesn't exist.
|
|
unlink $$Pdest;
|
|
# The missing bbl file is now not an error:
|
|
$return = -2;
|
|
# ??????? BCF
|
|
# Following is intended to work, but creates infinite loop
|
|
# in malformed bcf file situation under -pvc.
|
|
# since on each check for change in ANY file, pvc finds changed file
|
|
# Need to restrict pvc reruns to case of changed USER files
|
|
# # To give good properties for (pdf)latex rule, it is best
|
|
# # to have a valid bbl file that exists:
|
|
# create_empty_file( $$Pdest );
|
|
# $return = 0;
|
|
|
|
}
|
|
}
|
|
if ( $rule =~ /^bibtex/ ) {
|
|
my $retcode = check_bibtex_log($$Pbase);
|
|
if ( ! -e $$Psource ) {
|
|
$retcode = 10;
|
|
rdb_for_some( [keys %current_primaries], sub{ $$Pout_of_date = 1; } );
|
|
}
|
|
if ($retcode == 3) {
|
|
$$Plast_result = 2;
|
|
$$Plast_message = "Could not open bibtex log file for '$$Pbase'";
|
|
push @warnings, $$Plast_message;
|
|
}
|
|
elsif ($retcode == 2) {
|
|
$$Plast_message = "Bibtex errors: See file '$$Pbase.blg'";
|
|
$failure = 1;
|
|
push @warnings, $$Plast_message;
|
|
}
|
|
elsif ($retcode == 1) {
|
|
push @warnings, "Bibtex warnings for '$$Pbase'";
|
|
}
|
|
elsif ($retcode == 10) {
|
|
push @warnings, "Bibtex found no citations for '$$Pbase',\n",
|
|
" or bibtex found a missing aux file\n";
|
|
if (! -e $$Pdest ) {
|
|
warn "$My_name: Bibtex did not produce '$$Pdest'. But that\n",
|
|
" was because of missing files, so I will continue.\n";
|
|
$return = -2;
|
|
}
|
|
else {
|
|
$return = 0;
|
|
}
|
|
}
|
|
}
|
|
|
|
$updated = 1;
|
|
if ($$Ptest_kind == 3) {
|
|
# We are time-criterion first time only. Now switch to
|
|
# file-change criterion
|
|
$$Ptest_kind = 1;
|
|
}
|
|
$$Pout_of_date = $$Pout_of_date_user = 0;
|
|
|
|
if ( ($$Plast_result == 0) && ($return != 0) && ($return != -2) ) {
|
|
$$Plast_result = 2;
|
|
if ($$Plast_message eq '') {
|
|
$$Plast_message = "Command for '$rule' gave return code $return";
|
|
if ($rule =~ /^(pdf|lua|xe|)latex/) {
|
|
$$Plast_message .= "\n Refer to '$log_name' for details";
|
|
}
|
|
elsif ($rule =~ /^makeindex/) {
|
|
$$Plast_message .= "\n Refer to '${aux_dir1}${root_filename}.ilg' for details";
|
|
}
|
|
}
|
|
}
|
|
elsif ( $$Pdest && (! -e $$Pdest) && ($return != -2) ) {
|
|
$$Plast_result = 1;
|
|
}
|
|
return $return;
|
|
} # END rdb_run1
|
|
|
|
#-----------------
|
|
|
|
sub rdb_dummy_run1 {
|
|
# Assumes contexts for: rule.
|
|
# Update rule state as if the rule ran successfully,
|
|
# but don't run the rule.
|
|
# Returns 0 (success code)
|
|
|
|
# Source file data, by definition, correspond to the file state just before
|
|
# the latest run, and the run_time to the time just before the run:
|
|
&rdb_update_files;
|
|
$$Prun_time = time;
|
|
$$Pchanged = 0; # No special changes in files
|
|
$$Plast_result = 0;
|
|
$$Plast_message = '';
|
|
|
|
if ($$Ptest_kind == 3) {
|
|
# We are time-criterion first time only. Now switch to
|
|
# file-change criterion
|
|
$$Ptest_kind = 1;
|
|
}
|
|
$$Pout_of_date = $$Pout_of_date_user = 0;
|
|
|
|
return 0;
|
|
} # END rdb_dummy_run1
|
|
|
|
#-----------------
|
|
|
|
sub Run_subst {
|
|
# Call: Run_subst( cmd, msg, options, source, dest, base )
|
|
# Runs command with substitutions.
|
|
# If an argument is omitted or undefined, it is replaced by a default:
|
|
# cmd is the command to execute
|
|
# msg is whether to print a message:
|
|
# 0 for not, 1 according to $silent setting, 2 always
|
|
# options, source, dest, base: correspond to placeholders.
|
|
# Substitutions:
|
|
# %S=source, %D=dest, %B=base, %R=root=base for latex, %O=options,
|
|
# %T=texfile, %Y=$aux_dir1, %Z=$out_dir1
|
|
# This is a globally usable subroutine, and works in a rule context,
|
|
# and outside.
|
|
# Defaults:
|
|
# cmd: $PPext_cmd if defined, else '';
|
|
# msg: 1
|
|
# options: ''
|
|
# source: $$Psource if defined, else $texfile_name;
|
|
# dest: $$Pdest if defined, else $view_file, else '';
|
|
# base: $$Pbase if defined, else $root_filename;
|
|
|
|
my ($ext_cmd, $msg, $options, $source, $dest, $base ) = @_;
|
|
|
|
$ext_cmd ||= ( $Pext_cmd ? $$Pext_cmd : '' );
|
|
$msg = ( defined $msg ? $msg : 1 );
|
|
$options ||= '';
|
|
$source ||= ( $Psource ? $$Psource : $texfile_name );
|
|
$dest ||= ( $Pdest ? $$Pdest : ( $view_file || '' ) );
|
|
$base ||= ( $Pbase ? $$Pbase : $root_filename );
|
|
|
|
if ( $ext_cmd eq '' ) {
|
|
return 0;
|
|
}
|
|
|
|
#Set character to surround filenames:
|
|
my $q = $quote_filenames ? '"' : '';
|
|
|
|
my %subst = (
|
|
'%O' => $options,
|
|
'%R' => $q.$root_filename.$q,
|
|
'%B' => $q.$base.$q,
|
|
'%T' => $q.$texfile_name.$q,
|
|
'%S' => $q.$source.$q,
|
|
'%D' => $q.$dest.$q,
|
|
'%Y' => $q.$aux_dir1.$q,
|
|
'%Z' => $q.$out_dir1.$q,
|
|
'%%' => '%' # To allow literal %B, %R, etc, by %%B.
|
|
);
|
|
if ( ($^O eq "MSWin32" ) && $MSWin_back_slash ) {
|
|
foreach ( '%R', '%B', '%T', '%S', '%D', '%Y', '%Z' ) {
|
|
$subst{$_} =~ s(/)(\\)g;
|
|
}
|
|
}
|
|
|
|
my @tokens = split /(%.)/, $ext_cmd;
|
|
foreach (@tokens) {
|
|
if (exists($subst{$_})) { $_ = $subst{$_}; }
|
|
}
|
|
$ext_cmd = join '', @tokens;
|
|
|
|
my ($pid, $return) =
|
|
( ($msg == 0) || ( ($msg == 1) && $silent ) )
|
|
? &Run($ext_cmd)
|
|
: &Run_msg($ext_cmd);
|
|
return $return;
|
|
} #END Run_subst
|
|
|
|
#-----------------
|
|
|
|
sub rdb_primary_run {
|
|
#?? See multipass_run in previous version Aug 2007 for issues
|
|
# Call: rdb_primary_run
|
|
# Assumes contexts for: recursion, make, & rule.
|
|
# Assumes (a) the rule is a primary,
|
|
# (b) a run has to be made,
|
|
# (c) source files have been made.
|
|
# This routine carries out the run of the rule unconditionally,
|
|
# and then parses log file etc.
|
|
my $return = 0;
|
|
|
|
my $return_latex = &rdb_run1;
|
|
if (-e $$Pdest) { $missing_dvi_pdf = '';}
|
|
|
|
######### Analyze results of run:
|
|
if ( ! -e $log_name ) {
|
|
$failure = 1;
|
|
$$Plast_result = 2;
|
|
$$Plast_message = $failure_msg
|
|
= "(Pdf)LaTeX failed to generate the expected log file '$log_name'";
|
|
return -1;
|
|
}
|
|
|
|
if ($recorder) {
|
|
# Handle problem that some version of (pdf)latex give fls files
|
|
# of name latex.fls or pdflatex.fls instead of $root_filename.fls.
|
|
# Also that setting of -output-directory -aux-directory is not
|
|
# respected by (pdf)latex, at least in some versions.
|
|
my $std_fls_file = "$aux_dir1$root_filename.fls";
|
|
my @other_fls_names = ( );
|
|
if ( $rule =~ /^pdflatex/ ) {
|
|
push @other_fls_names, "pdflatex.fls";
|
|
}
|
|
else {
|
|
push @other_fls_names, "latex.fls";
|
|
}
|
|
if ( $aux_dir1 ne '' ) {
|
|
push @other_fls_names, "$root_filename.fls";
|
|
}
|
|
# Find the first non-standard fls file and copy it to the standard
|
|
# place. But only do this if the file time is compatible with being
|
|
# generated in the current run, as tested by the use of
|
|
# test_gen_file; that avoids problems with fls files leftover from
|
|
# earlier runs with other versions of latex.
|
|
foreach my $cand (@other_fls_names) {
|
|
if ( test_gen_file( $cand ) ) {
|
|
copy $cand, $std_fls_file;
|
|
last;
|
|
}
|
|
}
|
|
if ( ! test_gen_file( $std_fls_file ) ) {
|
|
warn "$My_name: fls file doesn't appear to have been made\n";
|
|
}
|
|
}
|
|
|
|
# Find current set of source files:
|
|
&rdb_set_latex_deps;
|
|
|
|
# For each file of the kind made by epstopdf.sty during a run,
|
|
# if the file has changed during a run, then the new version of
|
|
# the file will have been read during the run. Unlike the usual
|
|
# case, we will NOT need to redo the primary run because of the
|
|
# change of this file during the run. Therefore set the file as
|
|
# up-to-date:
|
|
rdb_do_files( sub { if ($$Pcorrect_after_primary) {&rdb_update1;} } );
|
|
|
|
#?? # There may be new source files, and the run may have caused
|
|
#?? # circular-dependency files to be changed. And the regular
|
|
#?? # source files may have been updated during a lengthy run of
|
|
#?? # latex. So redo the makes for sources of the current rule:
|
|
#?? my $submake_return = &rdb_submake;
|
|
#?? &rdb_clear_change_record;
|
|
#?? &rdb_flag_changes_here(0);
|
|
#?? if ($$Pout_of_date && !$silent) {
|
|
#?? &rdb_diagnose_changes( "Rule '$rule': " );
|
|
#?? }
|
|
|
|
$updated = 1; # Flag that some dependent file has been remade
|
|
|
|
#?? # Fix the state of the files as of now: this will solve the
|
|
#?? # problem of latex and pdflatex interfering with each other,
|
|
#?? # at the expense of some non-optimality
|
|
#?? #?? Check this is correct:
|
|
#?? &rdb_update_files;
|
|
|
|
if ( $diagnostics ) {
|
|
print "$My_name: Rules after run: \n";
|
|
rdb_show();
|
|
}
|
|
|
|
$return = $return_latex;
|
|
|
|
# ???? Is the following needed?
|
|
if ($return_latex && $$Pout_of_date_user) {
|
|
print "Error in (pdf)LaTeX, but change of user file(s), ",
|
|
"so ignore error & provoke rerun\n"
|
|
if (! $silent);
|
|
$return = 0;
|
|
}
|
|
# Summarize issues that may have escaped notice:
|
|
my @warnings = ();
|
|
if ($bad_reference) {
|
|
push @warnings, "Latex failed to resolve $bad_reference reference(s)";
|
|
}
|
|
if ($mult_defined) {
|
|
push @warnings, "Latex found $mult_defined multiply defined reference(s)";
|
|
}
|
|
if ($bad_citation) {
|
|
push @warnings, "Latex failed to resolve $bad_citation citation(s)";
|
|
}
|
|
if ($#warnings > -1) {
|
|
show_array( "$My_name: Summary of warnings:", @warnings );
|
|
}
|
|
return $return;
|
|
} #END rdb_primary_run
|
|
|
|
#************************************************************
|
|
|
|
sub rdb_clear_change_record {
|
|
# Initialize diagnostics for reasons for running rule.
|
|
@changed = ();
|
|
@disappeared = ();
|
|
@no_dest = (); # We are not now using this
|
|
@rules_never_run = ();
|
|
@rules_to_apply = (); # This is used in recursive application
|
|
# of rdb_flag_changes_here, to list
|
|
# rules that were out-of-date for some reason.
|
|
} #END rdb_clear_change_record
|
|
|
|
#************************************************************
|
|
|
|
sub rdb_flag_changes_here {
|
|
# Flag changes in current rule.
|
|
# Assumes rule context.
|
|
# Usage: rdb_flag_changes_here( ignore_run_time )
|
|
# Argument: if true then fdb_get shouldn't do runtime test
|
|
# for recalculation of md5
|
|
|
|
local $ignore_run_time = $_[0];
|
|
if ( ! defined $ignore_run_time ) { $ignore_run_time = 0; }
|
|
|
|
$$Pcheck_time = time;
|
|
|
|
local $dest_mtime = 0;
|
|
$dest_mtime = get_mtime($$Pdest) if ($$Pdest);
|
|
rdb_do_files( \&rdb_file_change1);
|
|
if ($$Pout_of_date) {
|
|
push @rules_to_apply, $rule;
|
|
}
|
|
#?? print "======== flag: $rule $$Pout_of_date ==========\n";
|
|
} #END rdb_flag_changes_here
|
|
|
|
#************************************************************
|
|
|
|
sub rdb_file_change1 {
|
|
# Call: &rdb_file_change1
|
|
# Assumes rule and file context. Assumes $dest_mtime set.
|
|
# Flag whether $file in $rule has changed or disappeared.
|
|
# Set rule's make flag if there's a change.
|
|
|
|
my $check_time_argument = 0;
|
|
if (! $ignore_run_time ) {
|
|
$check_time_argument = max( $$Pcheck_time, $$Prun_time );
|
|
}
|
|
my ($new_time, $new_size, $new_md5) = fdb_get($file, $check_time_argument );
|
|
my $ext_no_period = ext_no_period( $file );
|
|
if ( ($new_size < 0) && ($$Psize >= 0) ) {
|
|
# print "Disappeared '$file' in '$rule'\n";
|
|
push @disappeared, $file;
|
|
# No reaction is good.
|
|
#$$Pout_of_date = 1;
|
|
# ??? 1 Sep. 2008: I do NOT think so, for cusdep no-file-exists issue
|
|
# ??? 30 Sep 2008: I think I have this fixed. There were other changes
|
|
# needed. No-change-flagged is correct. The array @disappeared flags
|
|
# files that have disappeared, if I need to know. But having a source
|
|
# file disappear is not a reason for a remake unless I know how to
|
|
# make the file. If the file is a destination of a rule, that rule
|
|
# will be rerun. It may be that the user is changing another source
|
|
# in such a way that the disappeared file won't be needed. Before the
|
|
# change is applied we get a superfluous infinite loop.
|
|
return;
|
|
}
|
|
if ( ($new_size < 0) && ($$Psize < 0) ) {
|
|
return;
|
|
}
|
|
# Primarily use md5 signature to determine whether file contents have
|
|
# changed.
|
|
# Backup by file size change, but only in the case where there is
|
|
# no pattern of lines to ignore in testing for a change
|
|
if ( ($new_md5 ne $$Pmd5)
|
|
|| (
|
|
(! exists $hash_calc_ignore_pattern{$ext_no_period})
|
|
&& ($new_size != $$Psize)
|
|
)
|
|
) {
|
|
#print "========= CHANGED: '$file' from '$$Pfrom_rule'\n";
|
|
push @changed, $file;
|
|
$$Pout_of_date = 1;
|
|
if ( ! exists $generated_exts_all{$ext_no_period} ) {
|
|
$$Pout_of_date_user = 1;
|
|
}
|
|
}
|
|
elsif ( $new_time != $$Ptime ) {
|
|
$$Ptime = $new_time;
|
|
}
|
|
if ( ( ($$Ptest_kind == 2) || ($$Ptest_kind == 3) )
|
|
&& (! exists $generated_exts_all{$ext_no_period} )
|
|
&& ( $new_time > $dest_mtime )
|
|
) {
|
|
push @changed, $file;
|
|
$$Pout_of_date = $$Pout_of_date_user = 1;
|
|
}
|
|
} #END rdb_file_change1
|
|
|
|
#************************************************************
|
|
|
|
sub rdb_new_changes {
|
|
&rdb_clear_change_record;
|
|
rdb_recurse( [@_], sub{ &rdb_flag_changes_here(1); } );
|
|
return ($#changed >= 0) || ($#no_dest >= 0) || ($#rules_to_apply >= 0);
|
|
} #END rdb_new_changes
|
|
|
|
#************************************************************
|
|
|
|
sub rdb_diagnose_changes {
|
|
# Call: rdb_diagnose_changes or rdb_diagnose_changes( heading )
|
|
# List changes on STDERR
|
|
# Precede the message by the optional heading, else by "$My_name: "
|
|
my $heading = defined($_[0]) ? $_[0] : "$My_name: ";
|
|
|
|
if ($#rules_never_run >= 0) {
|
|
warn "${heading}Rules & subrules not known to be previously run:\n";
|
|
foreach (@rules_never_run) { warn " $_\n"; }
|
|
}
|
|
if ( ($#changed >= 0) || ($#disappeared >= 0) || ($#no_dest >= 0) ) {
|
|
warn "${heading}File changes, etc:\n";
|
|
if ( $#changed >= 0 ) {
|
|
warn " Changed files, or newly in use since previous run(s):\n";
|
|
foreach (uniqs(@changed)) { warn " '$_'\n"; }
|
|
}
|
|
if ( $#disappeared >= 0 ) {
|
|
warn " No-longer-existing files:\n";
|
|
foreach (uniqs(@disappeared)) { warn " '$_'\n"; }
|
|
}
|
|
if ( $#no_dest >= 0 ) {
|
|
warn " Non-existent destination files:\n";
|
|
foreach (uniqs(@no_dest)) { warn " '$_'\n"; }
|
|
}
|
|
}
|
|
elsif ($#rules_to_apply >=0) {
|
|
warn "${heading}The following rules & subrules became out-of-date:\n";
|
|
foreach (@rules_to_apply) { warn " '$_'\n"; }
|
|
}
|
|
else {
|
|
warn "${heading}No file changes\n";
|
|
}
|
|
} #END rdb_diagnose_changes
|
|
|
|
|
|
#************************************************************
|
|
#************************************************************
|
|
#************************************************************
|
|
#************************************************************
|
|
|
|
#************************************************************
|
|
#************************************************************
|
|
#************************************************************
|
|
#************************************************************
|
|
|
|
# Routines for convenient looping and recursion through rule database
|
|
# ================= NEW VERSION ================
|
|
|
|
# There are several places where we need to loop through or recurse
|
|
# through rules and files. This tends to involve repeated, tedious
|
|
# and error-prone coding of much book-keeping detail. In particular,
|
|
# working on files and rules needs access to the variables involved,
|
|
# which either involves direct access to the elements of the database,
|
|
# and consequent fragility against changes and upgrades in the
|
|
# database structure, or involves lots of routines for reading and
|
|
# writing data in the database, then with lots of repetitious
|
|
# house-keeping code.
|
|
#
|
|
# The routines below provide a solution. Looping and recursion
|
|
# through the database are provided by a set of basic routines where
|
|
# each necessary kind of looping and iteration is coded once. The
|
|
# actual actions are provided as references to action subroutines.
|
|
# (These can be either actual references, as in \&routine, or
|
|
# anonymous subroutines, as in sub{...}, or aas a zero value 0 or an
|
|
# omitted argument, to indicate that no action is to be performed.)
|
|
#
|
|
# When the action subroutine(s) are actually called, a context for the
|
|
# rule and/or file (as appropriate) is given by setting named
|
|
## NEW ??
|
|
# variables to REFERENCES to the relevant data values. These can be
|
|
# used to retrieve and set the data values. As a convention,
|
|
# references to scalars are given by variables named start with "$P",
|
|
# as in "$Pdest", while references to arrays start with "$PA", as in
|
|
# "$PAint_cmd", and references to hashes with "$PH", as in "$PHsource".
|
|
# After the action subroutine has finished, checks for data
|
|
# consistency may be made.
|
|
## ??? OLD
|
|
# variables to the relevant data values. After the action subroutine
|
|
# has finished, the database is updated with the values of these named
|
|
# variables, with any necessary consistency checks. Thus the action
|
|
# subroutines can act on sensibly named variables without needed to
|
|
# know the database structure.
|
|
#
|
|
# The only routines that actually use the database structure and need
|
|
# to be changed if that is changed are: (a) the routines rdb_one_rule
|
|
# and rdb_one_file that implement the calling of the action subroutines,
|
|
# (b) routines for creation of single rules and file items, and (c) to
|
|
# a lesser extent, the routine for destroying a file item.
|
|
#
|
|
# Note that no routine is provided for destroying a rule. During a
|
|
# run, a rule, with its source files, may become inaccessible or
|
|
# unused. This happens dynamically, depending on the dependencies
|
|
# caused by changes in the source file or by error conditions that
|
|
# cause the computation of dependencies, particular of latex files, to
|
|
# become wrong. In that situation the files certainly come and go in
|
|
# the database, but subsidiary rules, with their content information
|
|
# on their source files, need to be retained so that their use can be
|
|
# reinstated later depending on dynamic changes in other files.
|
|
#
|
|
# However, there is a potential memory leak unless some pruning is
|
|
# done in what is written to the fdb file. (Probably only accessible
|
|
# rules and those for which source files exist. Other cases have no
|
|
# relevant information that needs to be preserved between runs.)
|
|
|
|
#
|
|
#
|
|
|
|
|
|
#************************************************************
|
|
|
|
# First the top level routines for recursion and iteration
|
|
|
|
#************************************************************
|
|
|
|
sub rdb_recurse {
|
|
# Call: rdb_recurse( rule | [ rules],
|
|
# \&rule_act1, \&file_act1, \&file_act2,
|
|
# \&rule_act2 )
|
|
# The actions are pointers to subroutines, and may be null (0, or
|
|
# undefined) to indicate no action to be applied.
|
|
# Recursively acts on the given rules and all ancestors:
|
|
# foreach rule found:
|
|
# apply rule_act1
|
|
# loop through its files:
|
|
# apply file_act1
|
|
# act on its ancestor rule, if any
|
|
# apply file_act2
|
|
# apply rule_act2
|
|
# Guards against loops.
|
|
# Access to the rule and file data by local variables, only
|
|
# for getting and setting.
|
|
|
|
# This routine sets a context for anything recursive, with @heads,
|
|
# %visited and $depth being set as local variables.
|
|
|
|
local @heads = ();
|
|
my $rules = shift;
|
|
|
|
# Distinguish between single rule (a string) and a reference to an
|
|
# array of rules:
|
|
if ( ref $rules eq 'ARRAY' ) { @heads = @$rules; }
|
|
else { @heads = ( $rules ); }
|
|
|
|
# Keep a list of visited rules, used to block loops in recursion:
|
|
local %visited = ();
|
|
local $depth = 0;
|
|
|
|
foreach $rule ( @heads ) { rdb_recurse_rule( $rule, @_ ); }
|
|
|
|
} #END rdb_recurse
|
|
|
|
#************************************************************
|
|
|
|
sub rdb_for_all {
|
|
# Call: rdb_for_all( \&rule_act1, \&file_act, \&rule_act2 )
|
|
# Loops through all rules and their source files, using the
|
|
# specified set of actions, which are pointers to subroutines.
|
|
# Sorts rules alphabetically.
|
|
# See rdb_for_some for details.
|
|
rdb_for_some( [ sort keys %rule_db ], @_);
|
|
} #END rdb_for_all
|
|
|
|
#************************************************************
|
|
|
|
sub rdb_for_some {
|
|
# Call: rdb_for_some( rule | [ rules],
|
|
# \&rule_act1, \&file_act, \&rule_act2)
|
|
# Actions can be zero, and rules at tail of argument list can be
|
|
# omitted. E.g. rdb_for_some( rule, 0, \&file_act ).
|
|
# Anonymous subroutines can be used, e.g., rdb_for_some( rule, sub{...} ).
|
|
#
|
|
# Loops through rules and their source files, using the
|
|
# specified set of rules:
|
|
# foreach rule:
|
|
# apply rule_act1
|
|
# loop through its files:
|
|
# apply file_act
|
|
# apply rule_act2
|
|
#
|
|
# Rule data and file data are made available in local variables
|
|
# for access by the subroutines.
|
|
|
|
local @heads = ();
|
|
my $rules = shift;
|
|
# Distinguish between single rule (a string) and a reference to an
|
|
# array of rules:
|
|
if ( ref $rules eq 'ARRAY' ) { @heads = @$rules; }
|
|
else { @heads = ( $rules ); }
|
|
|
|
foreach $rule ( @heads ) {
|
|
# $rule is implicitly local
|
|
&rdb_one_rule( $rule, @_ );
|
|
}
|
|
} #END rdb_for_some
|
|
|
|
#************************************************************
|
|
|
|
sub rdb_for_one_file {
|
|
my $rule = shift;
|
|
# Avoid name collisions with general recursion and iteraction routines:
|
|
local $file1 = shift;
|
|
local $action1 = shift;
|
|
rdb_for_some( $rule, sub{rdb_one_file($file1,$action1)} );
|
|
} #END rdb_for_one_file
|
|
|
|
|
|
#************************************************************
|
|
|
|
# Routines for inner part of recursion and iterations
|
|
|
|
#************************************************************
|
|
|
|
sub rdb_recurse_rule {
|
|
# Call: rdb_recurse_rule($rule, \&rule_act1, \&file_act1, \&file_act2,
|
|
# \&rule_act2 )
|
|
# to do the work for one rule, recurisvely called from_rules for
|
|
# the sources of the rules.
|
|
# Assumes recursion context, i.e. that %visited, @heads, $depth.
|
|
# We are overriding actions:
|
|
my ($rule, $rule_act1, $new_file_act1, $new_file_act2, $rule_act2)
|
|
= @_;
|
|
# and must propagate the file actions:
|
|
local $file_act1 = $new_file_act1;
|
|
local $file_act2 = $new_file_act2;
|
|
# Prevent loops:
|
|
if ( (! $rule) || exists $visited{$rule} ) { return; }
|
|
$visited{$rule} = 1;
|
|
# Recursion depth
|
|
$depth++;
|
|
# We may need to repeat actions on dependent rules, without being
|
|
# blocked by the test on visited files. So save %visited:
|
|
# NOT CURRENTLY USED!! local %visited_at_rule_start = %visited;
|
|
# At end, the last value set for %visited wins.
|
|
rdb_one_rule( $rule, $rule_act1, \&rdb_recurse_file, $rule_act2 );
|
|
$depth--;
|
|
} #END rdb_recurse_rule
|
|
|
|
#************************************************************
|
|
|
|
sub rdb_recurse_file {
|
|
# Call: rdb_recurse_file to do the work for one file.
|
|
# This has no arguments, since it is used as an action subroutine,
|
|
# passed as a reference in calls in higher-level subroutine.
|
|
# Assumes contexts set for: Recursion, rule, and file
|
|
&$file_act1 if $file_act1;
|
|
rdb_recurse_rule( $$Pfrom_rule, $rule_act1, $file_act1, $file_act2,
|
|
$rule_act2 )
|
|
if $$Pfrom_rule;
|
|
&$file_act2 if $file_act2;
|
|
} #END rdb_recurse_file
|
|
|
|
#************************************************************
|
|
|
|
sub rdb_do_files {
|
|
# Assumes rule context, including $PHsource.
|
|
# Applies an action to all the source files of the rule.
|
|
local $file_act = shift;
|
|
my @file_list = sort keys %$PHsource;
|
|
foreach my $file ( @file_list ){
|
|
rdb_one_file( $file, $file_act );
|
|
}
|
|
} #END rdb_do_files
|
|
|
|
#************************************************************
|
|
|
|
# Routines for action on one rule and one file. These are the main
|
|
# places (in addition to creation and destruction routines for rules
|
|
# and files) where the database structure is accessed.
|
|
|
|
#************************************************************
|
|
|
|
sub rdb_one_rule {
|
|
# Call: rdb_one_rule( $rule, $rule_act1, $file_act, $rule_act2 )
|
|
# Sets context for rule and carries out the actions.
|
|
#===== Accesses rule part of database structure =======
|
|
|
|
local ( $rule, $rule_act1, $file_act, $rule_act2 ) = @_;
|
|
#?? &R1;
|
|
if ( (! $rule) || ! rdb_rule_exists($rule) ) { return; }
|
|
|
|
local ( $PArule_data, $PHsource, $PHdest ) = @{$rule_db{$rule}};
|
|
local ($Pcmd_type, $Pext_cmd, $PAint_cmd, $Ptest_kind,
|
|
$Psource, $Pdest, $Pbase,
|
|
$Pout_of_date, $Pout_of_date_user, $Prun_time, $Pcheck_time,
|
|
$Pchanged,
|
|
$Plast_result, $Plast_message, $PA_extra_generated )
|
|
= Parray( $PArule_data );
|
|
|
|
&$rule_act1 if $rule_act1;
|
|
&rdb_do_files( $file_act ) if $file_act;
|
|
&$rule_act2 if $rule_act2;
|
|
#?? &R2;
|
|
} #END rdb_one_rule
|
|
|
|
#************************************************************
|
|
|
|
sub rdb_one_file {
|
|
# Call: rdb_one_file($file, $file_act)
|
|
# Sets context for file and carries out the action.
|
|
# Assumes $rule context set.
|
|
#===== Accesses file part of database structure =======
|
|
local ($file, $file_act) = @_;
|
|
#?? &F1;
|
|
if ( (!$file) ||(!exists ${$PHsource}{$file}) ) { return; }
|
|
local $PAfile_data = ${$PHsource}{$file};
|
|
local ($Ptime, $Psize, $Pmd5, $Pfrom_rule, $Pcorrect_after_primary )
|
|
= Parray( $PAfile_data );
|
|
&$file_act() if $file_act;
|
|
if ( ! rdb_rule_exists( $$Pfrom_rule ) ) {
|
|
$$Pfrom_rule = '';
|
|
}
|
|
#?? &F2;
|
|
} #END rdb_one_file
|
|
|
|
#************************************************************
|
|
|
|
# Routines for creation of rules and file items, and for removing file
|
|
# items.
|
|
|
|
#************************************************************
|
|
|
|
sub rdb_remove_rule {
|
|
# rdb_remove_rule( rule, ... )
|
|
foreach my $key (@_) {
|
|
delete $rule_db{$key};
|
|
}
|
|
}
|
|
|
|
#************************************************************
|
|
|
|
sub rdb_create_rule {
|
|
# rdb_create_rule( rule, command_type, ext_cmd, int_cmd, test_kind,
|
|
# source, dest, base,
|
|
# needs_making, run_time, check_time, set_file_not_exists,
|
|
# ref_to_array_of_specs_of_extra_generated_files )
|
|
# int_cmd is either a string naming a perl subroutine or it is a
|
|
# reference to an array containing the subroutine name and its
|
|
# arguments.
|
|
# Makes rule. Error if it already exists.
|
|
# Omitted arguments: replaced by 0 or '' as needed.
|
|
# ==== Sets rule data ====
|
|
my ( $rule, $cmd_type, $ext_cmd, $PAint_cmd, $test_kind,
|
|
$source, $dest, $base,
|
|
$needs_making, $run_time, $check_time, $set_file_not_exists, $extra_gen ) = @_;
|
|
my $changed = 0;
|
|
|
|
# Set defaults, and normalize parameters:
|
|
foreach ( $cmd_type, $ext_cmd, $PAint_cmd, $source, $dest, $base,
|
|
$set_file_not_exists ) {
|
|
if (! defined $_) { $_ = ''; }
|
|
}
|
|
foreach ( $needs_making, $run_time, $check_time, $test_kind ) {
|
|
if (! defined $_) { $_ = 0; }
|
|
}
|
|
if (!defined $test_kind) {
|
|
# Default to test on file change
|
|
$test_kind = 1;
|
|
}
|
|
if ( ref( $PAint_cmd ) eq '' ) {
|
|
# It is a single command. Convert to array reference:
|
|
$PAint_cmd = [ $PAint_cmd ];
|
|
}
|
|
else {
|
|
# COPY the referenced array:
|
|
$PAint_cmd = [ @$PAint_cmd ];
|
|
}
|
|
my $PA_extra_gen = [];
|
|
if ($extra_gen) {
|
|
@$PA_extra_gen = @$extra_gen;
|
|
}
|
|
$rule_db{$rule} =
|
|
[ [$cmd_type, $ext_cmd, $PAint_cmd, $test_kind,
|
|
$source, $dest, $base,
|
|
$needs_making, 0, $run_time, $check_time, $changed,
|
|
-1, '', $PA_extra_gen ],
|
|
{},
|
|
{}
|
|
];
|
|
if ($source) {
|
|
rdb_ensure_file( $rule, $source, undef, $set_file_not_exists );
|
|
}
|
|
rdb_one_rule( $rule, \&rdb_initialize_generated );
|
|
} #END rdb_create_rule
|
|
|
|
#************************************************************
|
|
|
|
sub rdb_initialize_generated {
|
|
# Assume rule context.
|
|
# Initialize hash of generated files
|
|
%$PHdest = ();
|
|
if ($$Pdest) { rdb_add_generated($$Pdest); }
|
|
foreach (@$PA_extra_generated) {
|
|
rdb_add_generated($_);
|
|
}
|
|
} #END rdb_initialize_generated
|
|
|
|
#************************************************************
|
|
|
|
sub rdb_add_generated {
|
|
# Assume rule context.
|
|
# Add arguments to hash of generated files
|
|
foreach (@_) {
|
|
$$PHdest{$_} = 1;
|
|
}
|
|
} #END rdb_add_generated
|
|
|
|
#************************************************************
|
|
|
|
sub rdb_ensure_file {
|
|
# rdb_ensure_file( rule, file[, fromrule[, set_not_exists]] )
|
|
# Ensures the source file item exists in the given rule.
|
|
# Then if the fromrule is specified, set it for the file item.
|
|
# If the item is created, then:
|
|
# (a) by default initialize it to current file state.
|
|
# (b) but if the fourth argument, set_not_exists, is true,
|
|
# initialize the item as if the file does not exist.
|
|
# This case is typically used when the log file for a run
|
|
# of latex/pdflatex claims that the file was non-existent
|
|
# at the beginning of a run.
|
|
#============ rule and file data set here ======================================
|
|
my $rule = shift;
|
|
local ( $new_file, $new_from_rule, $set_not_exists ) = @_;
|
|
if ( ! rdb_rule_exists( $rule ) ) {
|
|
die_trace( "$My_name: BUG in rdb_ensure_file: non-existent rule '$rule'" );
|
|
}
|
|
if ( ! defined $new_file ) {
|
|
die_trace( "$My_name: BUG in rdb_ensure_file: undefined file for '$rule'" );
|
|
}
|
|
if ( ! defined $set_not_exists ) { $set_not_exists = 0; }
|
|
rdb_one_rule( $rule,
|
|
sub{
|
|
if (! exists ${$PHsource}{$new_file} ) {
|
|
if ( $set_not_exists ) {
|
|
${$PHsource}{$new_file} = [0, -1, 0, '', 0];
|
|
}
|
|
else {
|
|
${$PHsource}{$new_file}
|
|
= [fdb_get($new_file, $$Prun_time), '', 0];
|
|
}
|
|
}
|
|
}
|
|
);
|
|
if (defined $new_from_rule ) {
|
|
rdb_for_one_file( $rule, $new_file, sub{ $$Pfrom_rule = $new_from_rule; });
|
|
}
|
|
} #END rdb_ensure_file
|
|
|
|
#************************************************************
|
|
|
|
sub rdb_remove_files {
|
|
# rdb_remove_file( rule, file, ... )
|
|
# Removes file(s) for the rule.
|
|
my $rule = shift;
|
|
if (!$rule) { return; }
|
|
local @files = @_;
|
|
rdb_one_rule( $rule,
|
|
sub{ foreach (@files) { delete ${$PHsource}{$_}; } }
|
|
);
|
|
} #END rdb_remove_files
|
|
|
|
#************************************************************
|
|
|
|
sub rdb_list_source {
|
|
# rdb_list_source( rule )
|
|
# Return array of source files for rule.
|
|
my $rule = shift;
|
|
my @files = ();
|
|
rdb_one_rule( $rule,
|
|
sub{ @files = keys %$PHsource; }
|
|
);
|
|
return @files;
|
|
} #END rdb_list_source
|
|
|
|
#************************************************************
|
|
|
|
sub rdb_set_source {
|
|
# rdb_set_source( rule, file, ... )
|
|
my $rule = shift;
|
|
if (!$rule) { return; }
|
|
my %files = ();
|
|
foreach (@_) {
|
|
rdb_ensure_file( $rule, $_ );
|
|
$files{$_} = 1;
|
|
}
|
|
foreach ( rdb_list_source($rule) ) {
|
|
if ( ! exists $files{$_} ) { rdb_remove_files( $rule, $_ ); }
|
|
}
|
|
return;
|
|
} #END rdb_list_source
|
|
|
|
#************************************************************
|
|
|
|
sub rdb_rule_exists {
|
|
# Call rdb_rule_exists($rule): Returns whether rule exists.
|
|
my $rule = shift;
|
|
if (! $rule ) { return 0; }
|
|
return exists $rule_db{$rule};
|
|
} #END rdb_rule_exists
|
|
|
|
#************************************************************
|
|
|
|
sub rdb_file_exists {
|
|
# Call rdb_file_exists($rule, $file):
|
|
# Returns whether source file item in rule exists.
|
|
local ( $rule, $file ) = @_;
|
|
local $exists = 0;
|
|
rdb_one_rule( $rule,
|
|
sub{ $exists = exists( ${$PHsource}{$file} ) ? 1:0; }
|
|
);
|
|
return $exists;
|
|
} #END rdb_file_exists
|
|
|
|
#************************************************************
|
|
|
|
sub rdb_update_gen_files {
|
|
# Assumes rule context. Update source files of rule to current state.
|
|
rdb_do_files(
|
|
sub{
|
|
if ( exists $generated_exts_all{ ext_no_period($file) } ) {&rdb_update1;}
|
|
}
|
|
);
|
|
} #END rdb_update_gen_files
|
|
|
|
#************************************************************
|
|
|
|
sub rdb_update_files {
|
|
# Call: rdb_update_files
|
|
# Assumes rule context. Update source files of rule to current state.
|
|
rdb_do_files( \&rdb_update1 );
|
|
}
|
|
|
|
#************************************************************
|
|
|
|
sub rdb_update1 {
|
|
# Call: rdb_update1.
|
|
# Assumes file context. Updates file data to correspond to
|
|
# current file state on disk
|
|
($$Ptime, $$Psize, $$Pmd5) = fdb_get($file);
|
|
}
|
|
|
|
#************************************************************
|
|
|
|
sub rdb_set_file1 {
|
|
# Call: fdb_file1(rule, file, new_time, new_size, new_md5)
|
|
# Sets file time, size and md5.
|
|
my $rule = shift;
|
|
my $file = shift;
|
|
local @new_file_data = @_;
|
|
rdb_for_one_file( $rule, $file, sub{ ($$Ptime,$$Psize,$$Pmd5)=@new_file_data; } );
|
|
}
|
|
|
|
#************************************************************
|
|
|
|
sub rdb_dummy_file {
|
|
# Returns file data for non-existent file
|
|
# ==== Uses rule_db structure ====
|
|
return (0, -1, 0, '');
|
|
}
|
|
|
|
#************************************************************
|
|
#************************************************************
|
|
|
|
# Predefined subroutines for custom dependency
|
|
|
|
sub cus_dep_delete_dest {
|
|
# This subroutine is used for situations like epstopdf.sty, when
|
|
# the destination (target) of the custom dependency invoking
|
|
# this subroutine will be made by the primary run provided the
|
|
# file (destination of the custom dependency, source of the
|
|
# primary run) doesn't exist.
|
|
# It is assumed that the resulting file will be read by the
|
|
# primary run.
|
|
|
|
# Remove the destination file, to indicate it needs to be remade:
|
|
unlink_or_move( $$Pdest );
|
|
# Arrange that the non-existent destination file is not treated as
|
|
# an error. The variable changed here is a bit misnamed.
|
|
$$Pchanged = 1;
|
|
# Ensure a primary run is done
|
|
&cus_dep_require_primary_run;
|
|
# Return success:
|
|
return 0;
|
|
}
|
|
|
|
#************************************************************
|
|
|
|
sub cus_dep_require_primary_run {
|
|
# This subroutine is used for situations like epstopdf.sty, when
|
|
# the destination (target) of the custom dependency invoking
|
|
# this subroutine will be made by the primary run provided the
|
|
# file (destination of the custom dependency, source of the
|
|
# primary run) doesn't exist.
|
|
# It is assumed that the resulting file will be read by the
|
|
# primary run.
|
|
|
|
local $cus_dep_target = $$Pdest;
|
|
# Loop over all rules and source files:
|
|
rdb_for_all( 0,
|
|
sub { if ($file eq $cus_dep_target) {
|
|
$$Pout_of_date = 1;
|
|
$$Pcorrect_after_primary = 1;
|
|
}
|
|
}
|
|
);
|
|
# Return success:
|
|
return 0;
|
|
}
|
|
|
|
|
|
#************************************************************
|
|
#************************************************************
|
|
#************************************************************
|
|
#
|
|
# UTILITIES:
|
|
#
|
|
|
|
#************************************************************
|
|
# Miscellaneous
|
|
|
|
sub show_array {
|
|
# For use in diagnostics and debugging.
|
|
# On stderr, print line with $_[0] = label.
|
|
# Then print rest of @_, one item per line preceeded by some space
|
|
warn "$_[0]\n";
|
|
shift;
|
|
if ($#_ >= 0) { foreach (@_){ warn " $_\n";} }
|
|
else { warn " NONE\n"; }
|
|
}
|
|
|
|
#************************************************************
|
|
|
|
sub Parray {
|
|
# Call: Parray( \@A )
|
|
# Returns array of references to the elements of @A
|
|
# But if an element of @A is already a reference, the
|
|
# reference will be returned in the output array, not a
|
|
# reference to the reference.
|
|
my $PA = shift;
|
|
my @P = (undef) x (1+$#$PA);
|
|
foreach my $i (0..$#$PA) {
|
|
$P[$i] = (ref $$PA[$i]) ? ($$PA[$i]) : (\$$PA[$i]);
|
|
}
|
|
return @P;
|
|
}
|
|
|
|
#************************************************************
|
|
|
|
sub glob_list {
|
|
# Glob a collection of filenames. Sort and eliminate duplicates
|
|
# Usage: e.g., @globbed = glob_list(string, ...);
|
|
my @globbed = ();
|
|
foreach (@_) {
|
|
push @globbed, glob;
|
|
}
|
|
return uniqs( @globbed );
|
|
}
|
|
|
|
#==================================================
|
|
|
|
sub glob_list1 {
|
|
# Glob a collection of filenames.
|
|
# But no sorting or elimination of duplicates
|
|
# Usage: e.g., @globbed = glob_list1(string, ...);
|
|
# Since perl's glob appears to use space as separator, I'll do a special check
|
|
# for existence of non-globbed file (assumed to be tex like)
|
|
|
|
my @globbed = ();
|
|
foreach my $file_spec (@_) {
|
|
# Problem, when the PATTERN contains spaces, the space(s) are
|
|
# treated as pattern separaters.
|
|
# Solution: I now the glob from use File::Glob.
|
|
# The following hack avoids issues with glob in the case that a file exists
|
|
# with the specified name (possibly with extension .tex):
|
|
if ( -e $file_spec || -e "$file_spec.tex" ) {
|
|
# Non-globbed file exists, return the file_spec.
|
|
# Return $file_spec only because this is not a file-finding subroutine, but
|
|
# only a globber
|
|
push @globbed, $file_spec;
|
|
}
|
|
else {
|
|
# This glob fails to work as desired, if the pattern contains spaces.
|
|
push @globbed, glob( "$file_spec" );
|
|
}
|
|
}
|
|
return @globbed;
|
|
} #END glob_list1
|
|
|
|
#************************************************************
|
|
# Miscellaneous
|
|
|
|
sub prefix {
|
|
#Usage: prefix( string, prefix );
|
|
#Return string with prefix inserted at the front of each line
|
|
my @line = split( /\n/, $_[0] );
|
|
my $prefix = $_[1];
|
|
for (my $i = 0; $i <= $#line; $i++ ) {
|
|
$line[$i] = $prefix.$line[$i]."\n";
|
|
}
|
|
return join( "", @line );
|
|
} #END prefix
|
|
|
|
|
|
#===============================
|
|
|
|
sub parse_quotes {
|
|
# Split string into words.
|
|
# Words are delimited by space, except that strings
|
|
# quoted all stay inside a word. E.g.,
|
|
# 'asdf B" df "d "jkl"'
|
|
# is split to ( 'asdf', 'B df d', 'jkl').
|
|
# An array is returned.
|
|
my @results = ();
|
|
my $item = '';
|
|
local $_ = shift;
|
|
pos($_) = 0;
|
|
ITEM:
|
|
while() {
|
|
/\G\s*/gc;
|
|
if ( /\G$/ ) {
|
|
last ITEM;
|
|
}
|
|
# Now pos (and \G) is at start of item:
|
|
PART:
|
|
while () {
|
|
if (/\G([^\s\"]*)/gc) {
|
|
$item .= $1;
|
|
}
|
|
if ( /\G\"([^\"]*)\"/gc ) {
|
|
# Match balanced quotes
|
|
$item .= $1;
|
|
next PART;
|
|
}
|
|
elsif ( /\G\"(.*)$/gc ) {
|
|
# Match unbalanced quote
|
|
$item .= $1;
|
|
warn "====Non-matching quotes in\n '$_'\n";
|
|
}
|
|
push @results, $item;
|
|
$item = '';
|
|
last PART;
|
|
}
|
|
}
|
|
return @results;
|
|
} #END parse_quotes
|
|
|
|
#************************************************************
|
|
#************************************************************
|
|
# File handling utilities:
|
|
|
|
|
|
#************************************************************
|
|
|
|
sub get_latest_mtime
|
|
# - arguments: each is a filename.
|
|
# - returns most recent modify time.
|
|
{
|
|
my $return_mtime = 0;
|
|
foreach my $include (@_)
|
|
{
|
|
my $include_mtime = &get_mtime($include);
|
|
# The file $include may not exist. If so ignore it, otherwise
|
|
# we'll get an undefined variable warning.
|
|
if ( ($include_mtime) && ($include_mtime > $return_mtime) )
|
|
{
|
|
$return_mtime = $include_mtime;
|
|
}
|
|
}
|
|
return $return_mtime;
|
|
}
|
|
|
|
#************************************************************
|
|
|
|
sub get_mtime_raw
|
|
{
|
|
my $mtime = (stat($_[0]))[9];
|
|
return $mtime;
|
|
}
|
|
|
|
#************************************************************
|
|
|
|
sub get_mtime {
|
|
return get_mtime0($_[0]);
|
|
}
|
|
|
|
#************************************************************
|
|
|
|
sub get_mtime0 {
|
|
# Return time of file named in argument
|
|
# If file does not exist, return 0;
|
|
if ( -e $_[0] ) {
|
|
return get_mtime_raw($_[0]);
|
|
}
|
|
else {
|
|
return 0;
|
|
}
|
|
}
|
|
|
|
#************************************************************
|
|
|
|
sub get_size {
|
|
# Return time of file named in argument
|
|
# If file does not exist, return 0;
|
|
if ( -e $_[0] ) {
|
|
return get_size_raw($_[0]);
|
|
}
|
|
else {
|
|
return 0;
|
|
}
|
|
}
|
|
|
|
#************************************************************
|
|
|
|
sub get_size_raw
|
|
{
|
|
my $size = (stat($_[0]))[7];
|
|
return $size;
|
|
}
|
|
|
|
#************************************************************
|
|
|
|
sub get_time_size {
|
|
# Return time and size of file named in argument
|
|
# If file does not exist, return (0,-1);
|
|
if ( -e $_[0] ) {
|
|
return get_time_size_raw($_[0]);
|
|
}
|
|
else {
|
|
return (0,-1);
|
|
}
|
|
}
|
|
|
|
#************************************************************
|
|
|
|
sub get_time_size_raw
|
|
{
|
|
my $mtime = (stat($_[0]))[9];
|
|
my $size = (stat($_[0]))[7];
|
|
return ($mtime, $size);
|
|
}
|
|
|
|
#************************************************************
|
|
|
|
sub processing_time
|
|
{ my ($user, $system, $cuser, $csystem) = times();
|
|
return $user + $system + $cuser + $csystem;
|
|
}
|
|
|
|
#************************************************************
|
|
|
|
sub get_checksum_md5 {
|
|
my $source = shift;
|
|
my $input = new FileHandle;
|
|
my $md5 = Digest::MD5->new;
|
|
my $ignore_pattern = undef;
|
|
|
|
#&traceback;
|
|
#warn "======= GETTING MD5: $source\n";
|
|
if ( $source eq "" ) {
|
|
# STDIN:
|
|
open( $input, '-' );
|
|
}
|
|
elsif ( -d $source ) {
|
|
# We won't use checksum for directory
|
|
return 0;
|
|
}
|
|
else {
|
|
open( $input, '<', $source )
|
|
or return 0;
|
|
my ($base, $path, $ext) = fileparseA( $source );
|
|
$ext =~ s/^\.//;
|
|
if ( exists $hash_calc_ignore_pattern{$ext} ) {
|
|
$ignore_pattern = $hash_calc_ignore_pattern{$ext};
|
|
}
|
|
}
|
|
|
|
if ( defined $ignore_pattern ) {
|
|
while (<$input>) {
|
|
if ( ! /$ignore_pattern/ ){
|
|
$md5->add($_);
|
|
}
|
|
}
|
|
}
|
|
else {
|
|
$md5->addfile($input);
|
|
}
|
|
close $input;
|
|
return $md5->hexdigest();
|
|
}
|
|
|
|
#************************************************************
|
|
#************************************************************
|
|
|
|
sub create_empty_file {
|
|
my $name = shift;
|
|
my $h = new FileHandle ">$name"
|
|
or return 1;
|
|
close ($h);
|
|
return 0;
|
|
}
|
|
|
|
#************************************************************
|
|
#************************************************************
|
|
|
|
sub find_file1 {
|
|
#?? Need to use kpsewhich, if possible
|
|
|
|
# Usage: find_file1(name, ref_to_array_search_path)
|
|
# Modified find_file, which doesn't die.
|
|
# Given filename and path, return array of:
|
|
# full name
|
|
# retcode
|
|
# On success: full_name = full name with path, retcode = 0
|
|
# On failure: full_name = given name, retcode = 1
|
|
|
|
my $name = $_[0];
|
|
# Make local copy of path, since we may rewrite it!
|
|
my @path = ();
|
|
if ($_[1]) {
|
|
@path = @{$_[1]};
|
|
}
|
|
if ( $name =~ /^\// ) {
|
|
# Absolute path (if under UNIX)
|
|
# This needs fixing, in general
|
|
if (-e $name) { return( $name, 0 );}
|
|
else { return( $name, 1 );}
|
|
}
|
|
foreach my $dir ( @path ) {
|
|
#??print "-------------dir='$dir', ";
|
|
# Make $dir concatenatable, and empty for current dir:
|
|
if ( $dir eq '.' ) {
|
|
$dir = '';
|
|
}
|
|
elsif ( $dir =~ /[\/\\:]$/ ) {
|
|
#OK if dir ends in / or \ or :
|
|
}
|
|
elsif ( $dir ne '' ) {
|
|
#Append directory separator only to non-empty dir
|
|
$dir = "$dir/";
|
|
}
|
|
#?? print " newdir='$dir'\n";
|
|
if (-e "$dir$name") {
|
|
return("$dir$name", 0);
|
|
}
|
|
}
|
|
my @kpse_result = kpsewhich( $name );
|
|
if ($#kpse_result > -1) {
|
|
return( $kpse_result[0], 0);
|
|
}
|
|
return("$name" , 1);
|
|
} #END find_file1
|
|
|
|
#************************************************************
|
|
|
|
sub find_file_list1 {
|
|
# Modified version of find_file_list that doesn't die.
|
|
# Given output and input arrays of filenames, a file suffix, and a path,
|
|
# fill the output array with full filenames
|
|
# Return array of not-found files.
|
|
# Usage: find_file_list1( ref_to_output_file_array,
|
|
# ref_to_input_file_array,
|
|
# suffix,
|
|
# ref_to_array_search_path
|
|
# )
|
|
# SPECIAL TREATMENT TO .bib extension, because of behavior of bibtex
|
|
# OTHER SPECIAL TREATMENT IF EXTENSION IS GIVEN.
|
|
|
|
my $ref_output = $_[0];
|
|
my $ref_input = $_[1];
|
|
my $suffix = $_[2];
|
|
my $ref_search = $_[3];
|
|
my @not_found = ();
|
|
|
|
#?? show_array( "=====find_file_list1. Suffix: '$suffix'\n Source:", @$ref_input );
|
|
#?? show_array( " Bibinputs:", @$ref_search );
|
|
|
|
my @return_list = (); # Generate list in local array, since input
|
|
# and output arrays may be same
|
|
my $retcode = 0;
|
|
foreach my $file1 (@$ref_input) {
|
|
my $file = $file1;
|
|
if ($suffix eq '.bib') { $file =~ s/\.bib$//; }
|
|
my ($tmp_file, $find_retcode) = &find_file1( "$file$suffix", $ref_search );
|
|
if ($tmp_file) {
|
|
push @return_list, $tmp_file;
|
|
}
|
|
if ( $find_retcode != 0 ) {
|
|
push @not_found, $file.$suffix;
|
|
}
|
|
}
|
|
@$ref_output = @return_list;
|
|
#?? show_array( " Output", @$ref_output );
|
|
#?? foreach (@$ref_output) { if ( /\/\// ) { print " ====== double slash in '$_'\n"; } }
|
|
return @not_found;
|
|
} #END find_file_list1
|
|
|
|
#************************************************************
|
|
|
|
sub unlink_or_move {
|
|
if ( $del_dir eq '' ) {
|
|
unlink @_;
|
|
}
|
|
else {
|
|
foreach (@_) {
|
|
if (-e $_ && ! rename $_, "$del_dir/$_" ) {
|
|
warn "$My_name:Cannot move '$_' to '$del_dir/$_'\n";
|
|
}
|
|
}
|
|
}
|
|
}
|
|
|
|
#************************************************************
|
|
|
|
sub kpsewhich {
|
|
# Usage: kpsewhich( filespec, ...)
|
|
# Returns array of files with paths as found by kpsewhich
|
|
# kpsewhich( 'try.sty', 'jcc.bib' );
|
|
# With standard use of kpsewhich (i.e., without -all option), the array
|
|
# has either 0 or 1 element.
|
|
# Can also do, e.g.,
|
|
# kpsewhich( '-format=bib', 'trial.bib', 'file with spaces');
|
|
my $cmd = $kpsewhich;
|
|
my @args = @_;
|
|
if ( ($cmd eq '') || ( $cmd =~ /^NONE($| )/ ) ) {
|
|
# Kpsewhich not set up.
|
|
warn "$My_name: Kpsewhich command needed but not set up\n";
|
|
return ();
|
|
}
|
|
foreach (@args) {
|
|
if ( ! /^-/ ) {
|
|
$_ = "\"$_\"";
|
|
}
|
|
}
|
|
$cmd =~ s/%[RBTDO]//g;
|
|
$cmd =~ s/%S/@args/g;
|
|
my @found = ();
|
|
local $fh;
|
|
if ( $kpsewhich_show || $diagnostics ) {
|
|
print "$My_name.kpsewhich: Running '$cmd'...\n";
|
|
}
|
|
open $fh, "$cmd|"
|
|
or die "Cannot open pipe for \"$cmd\"\n";
|
|
while ( <$fh> ) {
|
|
s/[\r\n]*$//;
|
|
push @found, $_;
|
|
}
|
|
close $fh;
|
|
if ( $kpsewhich_show || $diagnostics ) {
|
|
show_array( "$My_name.kpsewhich: '$cmd' ==>", @found );
|
|
}
|
|
return @found;
|
|
}
|
|
|
|
####################################################
|
|
|
|
sub add_cus_dep {
|
|
# Usage: add_cus_dep( from_ext, to_ext, flag, sub_name )
|
|
# Add cus_dep after removing old versions
|
|
my ($from_ext, $to_ext, $must, $sub_name) = @_;
|
|
remove_cus_dep( $from_ext, $to_ext );
|
|
push @cus_dep_list, "$from_ext $to_ext $must $sub_name";
|
|
}
|
|
|
|
####################################################
|
|
|
|
sub remove_cus_dep {
|
|
# Usage: remove_cus_dep( from_ext, to_ext )
|
|
my ($from_ext, $to_ext) = @_;
|
|
my $i = 0;
|
|
while ($i <= $#cus_dep_list) {
|
|
# Use \Q and \E round directory name in regex to avoid interpretation
|
|
# of metacharacters in directory name:
|
|
if ( $cus_dep_list[$i] =~ /^\Q$from_ext $to_ext \E/ ) {
|
|
splice @cus_dep_list, $i, 1;
|
|
}
|
|
else {
|
|
$i++;
|
|
}
|
|
}
|
|
}
|
|
|
|
####################################################
|
|
|
|
sub show_cus_dep {
|
|
show_array( "Custom dependency list:", @cus_dep_list );
|
|
}
|
|
|
|
####################################################
|
|
|
|
sub add_aux_hook {
|
|
# Usage: add_aux_hook( sub_name )
|
|
# Add the name subroutine to the array of hooks for
|
|
# processing lines of aux files.
|
|
# The argument is either a string naming the subroutine, e.g.
|
|
# add_aux_hook( 'subname' );
|
|
# or a Perl reference to the subroutine, e.g.,
|
|
# add_aux_hook( \&subname );
|
|
# It is also possible to use an anonymous subroutine, e.g.,
|
|
# add_aux_hook( sub{ code of subroutine... } );
|
|
my ($sub_name) = @_;
|
|
push @aux_hooks, $sub_name;
|
|
}
|
|
|
|
####################################################
|
|
|
|
sub add_input_ext {
|
|
# Usage: add_input_ext( rule, ext, ... )
|
|
# Add extension(s) (specified without a leading period) to the
|
|
# list of input extensions for the given rule. The rule should be
|
|
# 'latex' or 'pdflatex'. These extensions are used when an input
|
|
# file without an extension is found by (pdf)latex, as in
|
|
# \input{file} or \includegraphics{figure}. When latexmk searches
|
|
# custom dependencies to make the missing file, it will assume that
|
|
# the file has one of the specified extensions.
|
|
my $rule = shift;
|
|
if ( ! exists $input_extensions{$rule} ) {
|
|
$input_extensions{$rule} = {};
|
|
}
|
|
my $Prule = $input_extensions{$rule};
|
|
foreach (@_) { $$Prule{$_} = 1; }
|
|
}
|
|
|
|
####################################################
|
|
|
|
sub remove_input_ext {
|
|
# Usage: remove_input_ext( rule, ext, ... )
|
|
# Remove extension(s) (specified without a leading period) to the
|
|
# list of input extensions for the given rule. The rule should be
|
|
# 'latex' or 'pdflatex'. See sub add_input_ext for the use.
|
|
my $rule = shift;
|
|
if ( ! exists $input_extensions{$rule} ) { return; }
|
|
my $Prule = $input_extensions{$rule};
|
|
foreach (@_) { delete $$Prule{$_}; }
|
|
}
|
|
|
|
####################################################
|
|
|
|
sub show_input_ext {
|
|
# Usage: show_input_ext( rule )
|
|
my $rule = shift;
|
|
show_array ("Input extensions for rule '$rule': ",
|
|
keys %{$input_extensions{$rule}} );
|
|
}
|
|
|
|
####################################################
|
|
|
|
sub find_dirs1 {
|
|
# Same as find_dirs, but argument is single string with directories
|
|
# separated by $search_path_separator
|
|
find_dirs( &split_search_path( $search_path_separator, ".", $_[0] ) );
|
|
}
|
|
|
|
|
|
#************************************************************
|
|
|
|
sub find_dirs {
|
|
# @_ is list of directories
|
|
# return: same list of directories, except that for each directory
|
|
# name ending in //, a list of all subdirectories (recursive)
|
|
# is added to the list.
|
|
# Non-existent directories and non-directories are removed from the list
|
|
# Trailing "/"s and "\"s are removed
|
|
local @result = ();
|
|
my $find_action
|
|
= sub
|
|
{ ## Subroutine for use in File::find
|
|
## Check to see if we have a directory
|
|
if (-d) { push @result, $File::Find::name; }
|
|
};
|
|
foreach my $directory (@_) {
|
|
my $recurse = ( $directory =~ m[//$] );
|
|
# Remove all trailing /s, since directory name with trailing /
|
|
# is not always allowed:
|
|
$directory =~ s[/+$][];
|
|
# Similarly for MSWin reverse slash
|
|
$directory =~ s[\\+$][];
|
|
if ( ! -e $directory ){
|
|
next;
|
|
}
|
|
elsif ( $recurse ){
|
|
# Recursively search directory
|
|
find( $find_action, $directory );
|
|
}
|
|
else {
|
|
push @result, $directory;
|
|
}
|
|
}
|
|
return @result;
|
|
}
|
|
|
|
#************************************************************
|
|
|
|
sub uniq
|
|
# Read arguments, delete neighboring items that are identical,
|
|
# return array of results
|
|
{
|
|
my @sort = ();
|
|
my ($current, $prev);
|
|
my $first = 1;
|
|
while (@_)
|
|
{
|
|
$current = shift;
|
|
if ($first || ($current ne $prev) )
|
|
{
|
|
push @sort, $current;
|
|
$prev = $current;
|
|
$first = 0;
|
|
}
|
|
}
|
|
return @sort;
|
|
}
|
|
|
|
#==================================================
|
|
|
|
sub uniq1 {
|
|
# Usage: uniq1( strings )
|
|
# Returns array of strings with duplicates later in list than
|
|
# first occurence deleted. Otherwise preserves order.
|
|
|
|
my @strings = ();
|
|
my %string_hash = ();
|
|
|
|
foreach my $string (@_) {
|
|
if (!exists( $string_hash{$string} )) {
|
|
$string_hash{$string} = 1;
|
|
push @strings, $string;
|
|
}
|
|
}
|
|
return @strings;
|
|
}
|
|
|
|
#************************************************************
|
|
|
|
sub uniqs {
|
|
# Usage: uniq2( strings )
|
|
# Returns array of strings sorted and with duplicates deleted
|
|
return uniq( sort @_ );
|
|
}
|
|
|
|
#************************************************************
|
|
|
|
sub ext {
|
|
# Return extension of filename. Extension includes the period
|
|
my $file_name = $_[0];
|
|
my ($base_name, $path, $ext) = fileparseA( $file_name );
|
|
return $ext;
|
|
}
|
|
|
|
#************************************************************
|
|
|
|
sub ext_no_period {
|
|
# Return extension of filename. Extension excludes the period
|
|
my $file_name = $_[0];
|
|
my ($base_name, $path, $ext) = fileparseA( $file_name );
|
|
$ext =~ s/^\.//;
|
|
return $ext;
|
|
}
|
|
|
|
#************************************************************
|
|
|
|
sub fileparseA {
|
|
# Like fileparse but replace $path for current dir ('./' or '.\') by ''
|
|
# Also default second argument to get normal extension.
|
|
my $given = $_[0];
|
|
my $pattern = '\.[^\.]*';
|
|
if ($#_ > 0 ) { $pattern = $_[1]; }
|
|
my ($base_name, $path, $ext) = fileparse( $given, $pattern );
|
|
if ( ($path eq './') || ($path eq '.\\') ) {
|
|
$path = '';
|
|
}
|
|
return ($base_name, $path, $ext);
|
|
}
|
|
|
|
#************************************************************
|
|
|
|
sub fileparseB {
|
|
# Like fileparse but with default second argument for normal extension
|
|
my $given = $_[0];
|
|
my $pattern = '\.[^\.]*';
|
|
if ($#_ > 0 ) { $pattern = $_[1]; }
|
|
my ($base_name, $path, $ext) = fileparse( $given, $pattern );
|
|
return ($base_name, $path, $ext);
|
|
}
|
|
|
|
#************************************************************
|
|
|
|
sub split_search_path
|
|
{
|
|
# Usage: &split_search_path( separator, default, string )
|
|
# Splits string by separator and returns array of the elements
|
|
# Allow empty last component.
|
|
# Replace empty terms by the default.
|
|
my $separator = $_[0];
|
|
my $default = $_[1];
|
|
my $search_path = $_[2];
|
|
my @list = split( /$separator/, $search_path);
|
|
if ( $search_path =~ /$separator$/ ) {
|
|
# If search path ends in a blank item, the split subroutine
|
|
# won't have picked it up.
|
|
# So add it to the list by hand:
|
|
push @list, "";
|
|
}
|
|
# Replace each blank argument (default) by current directory:
|
|
for ($i = 0; $i <= $#list ; $i++ ) {
|
|
if ($list[$i] eq "") {$list[$i] = $default;}
|
|
}
|
|
return @list;
|
|
}
|
|
|
|
#################################
|
|
|
|
|
|
sub tempfile1 {
|
|
# Makes a temporary file of a unique name. I could use file::temp,
|
|
# but it is not present in all versions of perl
|
|
# Filename is of form $tmpdir/$_[0]nnn$suffix, where nnn is an integer
|
|
my $tmp_file_count = 0;
|
|
my $prefix = $_[0];
|
|
my $suffix = $_[1];
|
|
while (1==1) {
|
|
# Find a new temporary file, and make it.
|
|
$tmp_file_count++;
|
|
my $tmp_file = "${tmpdir}/${prefix}${tmp_file_count}${suffix}";
|
|
if ( ! -e $tmp_file ) {
|
|
open( TMP, ">$tmp_file" )
|
|
or next;
|
|
close(TMP);
|
|
return $tmp_file;
|
|
}
|
|
}
|
|
die "$My_name.tempfile1: BUG TO ARRIVE HERE\n";
|
|
}
|
|
|
|
#################################
|
|
|
|
#************************************************************
|
|
#************************************************************
|
|
# Process/subprocess routines
|
|
|
|
sub Run_msg {
|
|
# Same as Run, but give message about my running
|
|
warn_running( "Running '$_[0]'" );
|
|
my $time1 = processing_time();
|
|
my ($pid, $return) = Run($_[0]);
|
|
my $time = processing_time() - $time1;
|
|
push @timings, "'$_[0]': time = $time\n";
|
|
return ($pid, $return);
|
|
} #END Run_msg
|
|
|
|
#==================
|
|
|
|
sub Run {
|
|
# Usage: Run ("command string");
|
|
# or Run ("one-or-more keywords command string");
|
|
# Possible keywords: internal, NONE, start, nostart.
|
|
#
|
|
# A command string not started by keywords just gives a call to system with
|
|
# the specified string, I return after that has finished executing.
|
|
# Exceptions to this behavior are triggered by keywords.
|
|
# The general form of the string is
|
|
# Zero or more occurences of the start keyword,
|
|
# followed by at most one of the other key words (internal, nostart, NONE),
|
|
# followed by (a) a command string to be executed by the systerm
|
|
# or (b) if the command string is specified to be internal, then
|
|
# it is of the form
|
|
#
|
|
# routine arguments
|
|
#
|
|
# which implies invocation of the named Perl subroutine
|
|
# with the given arguments, which are obtained by splitting
|
|
# the string into words, delimited by spaces, but with
|
|
# allowance for double quotes.
|
|
#
|
|
# The meaning of the keywords is:
|
|
#
|
|
# start: The command line is to be running detached, as appropriate for
|
|
# a previewer. The method is appropriate for the operating system
|
|
# (and the keyword is inspired by the action of the start command
|
|
# that implements in under MSWin).
|
|
# HOWEVER: the start keyword is countermanded by the nostart,
|
|
# internal, and NONE keywords. This allows rules that do
|
|
# previewing to insert a start keyword to create a presumption
|
|
# of detached running unless otherwise.
|
|
# nostart: Countermands a previous start keyword; the following command
|
|
# string is then to be obeyed by the system, and any necessary
|
|
# detaching (as of a previewer) is done by the executed command(s).
|
|
# internal: The following command string, of the form 'routine arguments'
|
|
# specifies a call to the named Perl subroutine.
|
|
# NONE: This does not run anything, but causes an error message to be
|
|
# printed. This is provided to allow program names defined in the
|
|
# configuration to flag themselves as unimplemented.
|
|
# Note that if the word "start" is duplicated at the beginning, that is
|
|
# equivalent to a single "start".
|
|
#
|
|
# Return value is a list (pid, exitcode):
|
|
# If a process is spawned sucessfully, and I know the PID,
|
|
# return (pid, 0),
|
|
# else if process is spawned sucessfully, but I do not know the PID,
|
|
# return (0, 0),
|
|
# else if process is run,
|
|
# return (0, exitcode of process)
|
|
# else if I fail to run the requested process
|
|
# return (0, suitable return code)
|
|
# where return code is 1 if cmdline is null or begins with "NONE" (for
|
|
# an unimplemented command)
|
|
# or the return value of the Perl subroutine.
|
|
my $cmd_line = $_[0];
|
|
if ( $cmd_line eq '' ) {
|
|
traceback( "$My_name: Bug OR configuration error\n".
|
|
" In run of '$rule', attempt to run a null program" );
|
|
return (0, 1);
|
|
}
|
|
# Deal with latexmk-defined pseudocommands 'start' and 'NONE'
|
|
# at front of command line:
|
|
my $detach = 0;
|
|
while ( $cmd_line =~ s/^start +// ) {
|
|
# But first remove extra starts (which may have been inserted
|
|
# to force a command to be run detached, when the command
|
|
# already contained a "start").
|
|
$detach = 1;
|
|
}
|
|
if ( $cmd_line =~ s/^nostart +// ) {
|
|
$detach = 0;
|
|
}
|
|
if ( $cmd_line =~ /^internal\s+([a-zA-Z_]\w*)\s+(.*)$/ ) {
|
|
my $routine = $1;
|
|
my @args = parse_quotes( $2 );
|
|
warn "$My_name: calling $routine( $2 )\n";
|
|
return ( 0, &$routine( @args ) );
|
|
}
|
|
elsif ( $cmd_line =~ /^internal\s+([a-zA-Z_]\w*)\s*$/ ) {
|
|
my $routine = $1;
|
|
warn "$My_name: calling $routine()\n";
|
|
return ( 0, &$routine() );
|
|
}
|
|
elsif ( $cmd_line =~ /^NONE/ ) {
|
|
warn "$My_name: ",
|
|
"Program not implemented for this version. Command line:\n";
|
|
warn " '$cmd_line'\n";
|
|
return (0, 1);
|
|
}
|
|
elsif ($detach) {
|
|
# Run detached. How to do this depends on the OS
|
|
return &Run_Detached( $cmd_line );
|
|
}
|
|
else {
|
|
# The command is given to system as a single argument, to force shell
|
|
# metacharacters to be interpreted:
|
|
return( 0, system( $cmd_line ) );
|
|
}
|
|
} #END Run
|
|
|
|
#************************************************************
|
|
|
|
sub Run_Detached {
|
|
# Usage: Run_Detached ("program arguments ");
|
|
# Runs program detached. Returns 0 on success, 1 on failure.
|
|
# Under UNIX use a trick to avoid the program being killed when the
|
|
# parent process, i.e., me, gets a ctrl/C, which is undesirable for pvc
|
|
# mode. (The simplest method, system("program arguments &"), makes the
|
|
# child process respond to the ctrl/C.)
|
|
# Return value is a list (pid, exitcode):
|
|
# If process is spawned sucessfully, and I know the PID,
|
|
# return (pid, 0),
|
|
# else if process is spawned sucessfully, but I do not know the PID,
|
|
# return (0, 0),
|
|
# else if I fail to spawn a process
|
|
# return (0, 1)
|
|
|
|
my $cmd_line = $_[0];
|
|
|
|
## warn "Running '$cmd_line' detached...\n";
|
|
if ( $cmd_line =~ /^NONE / ) {
|
|
warn "$My_name: ",
|
|
"Program not implemented for this version. Command line:\n";
|
|
warn " '$cmd_line'\n";
|
|
return (0, 1);
|
|
}
|
|
|
|
if ( "$^O" eq "MSWin32" ){
|
|
# Win95, WinNT, etc: Use MS's start command:
|
|
# Need extra double quotes to deal with quoted filenames:
|
|
# MSWin start takes first quoted argument to be a Window title.
|
|
return( 0, system( "start \"\" $cmd_line" ) );
|
|
} else {
|
|
# Assume anything else is UNIX or clone
|
|
# For this purpose cygwin behaves like UNIX.
|
|
## warn "Run_Detached.UNIX: A\n";
|
|
my $pid = fork();
|
|
## warn "Run_Detached.UNIX: B pid=$pid\n";
|
|
if ( ! defined $pid ) {
|
|
## warn "Run_Detached.UNIX: C\n";
|
|
warn "$My_name: Could not fork to run the following command:\n";
|
|
warn " '$cmd_line'\n";
|
|
return (0, 1);
|
|
}
|
|
elsif( $pid == 0 ){
|
|
## warn "Run_Detached.UNIX: D\n";
|
|
# Forked child process arrives here
|
|
# Insulate child process from interruption by ctrl/C to kill parent:
|
|
# setpgrp(0,0);
|
|
# Perhaps this works if setpgrp doesn't exist
|
|
# (and therefore gives fatal error):
|
|
eval{ setpgrp(0,0);};
|
|
exec( $cmd_line );
|
|
# Exec never returns; it replaces current process by new process
|
|
die "$My_name forked process: could not run the command\n",
|
|
" '$cmd_line'\n";
|
|
}
|
|
##warn "Run_Detached.UNIX: E\n";
|
|
# Original process arrives here
|
|
return ($pid, 0);
|
|
}
|
|
# NEVER GET HERE.
|
|
##warn "Run_Detached.UNIX: F\n";
|
|
} #END Run_Detached
|
|
|
|
#************************************************************
|
|
|
|
sub find_process_id {
|
|
# find_process_id(string) finds id of process containing string and
|
|
# being run by the present user. Typically the string will be the
|
|
# name of the process or part of its command line.
|
|
# On success, this subroutine returns the process ID.
|
|
# On failure, it returns 0.
|
|
# This subroutine only works on UNIX systems at the moment.
|
|
|
|
if ( $pid_position < 0 ) {
|
|
# I cannot do a ps on this system
|
|
return (0);
|
|
}
|
|
|
|
my $looking_for = $_[0];
|
|
my @ps_output = `$pscmd`;
|
|
my @ps_lines = ();
|
|
|
|
# There may be multiple processes. Find only latest,
|
|
# almost surely the one with the highest process number
|
|
# This will deal with cases like xdvi where a script is used to
|
|
# run the viewer and both the script and the actual viewer binary
|
|
# have running processes.
|
|
my @found = ();
|
|
|
|
shift(@ps_output); # Discard the header line from ps
|
|
foreach (@ps_output) {
|
|
next unless ( /$looking_for/ ) ;
|
|
s/^\s*//;
|
|
my @ps_line = split ('\s+');
|
|
push @found, $ps_line[$pid_position];
|
|
push @ps_lines, $_;
|
|
}
|
|
|
|
if ($#found < 0) {
|
|
# No luck in finding the specified process.
|
|
return(0);
|
|
}
|
|
@found = reverse sort @found;
|
|
if ($diagnostics) {
|
|
print "Found the following processes concerning '$looking_for'\n",
|
|
" @found\n",
|
|
" I will use $found[0]\n";
|
|
print " The relevant lines from '$pscmd' were:\n";
|
|
foreach (@ps_lines) { print " $_"; }
|
|
}
|
|
return $found[0];
|
|
}
|
|
|
|
#************************************************************
|
|
#************************************************************
|
|
#************************************************************
|
|
|
|
#============================================
|
|
|
|
sub cache_good_cwd {
|
|
# Set cached value of cwd to current cwd.
|
|
# Under cygwin, the cwd is converted to a native MSWin path so
|
|
# that the result can be used for input to MSWin programs as well
|
|
# as cygwin programs.
|
|
my $cwd = cwd();
|
|
if ( $^O eq "cygwin" ) {
|
|
my $cmd = "cygpath -w \"$cwd\"";
|
|
my $Win_cwd = `$cmd`;
|
|
chomp $Win_cwd;
|
|
if ( $Win_cwd ) {
|
|
$cwd = $Win_cwd;
|
|
}
|
|
else {
|
|
warn "$My_name: Could not correctly run command\n",
|
|
" '$cmd'\n",
|
|
" to get MSWin version of cygwin path\n",
|
|
" '$cwd'\n",
|
|
" The result was\n",
|
|
" '$Win_cwd'\n";
|
|
}
|
|
}
|
|
$cache{cwd} = $cwd;
|
|
} # END cache_good_cwd
|
|
|
|
#============================================
|
|
|
|
sub good_cwd {
|
|
# Return cwd, but under cygwin, convert to MSWin path.
|
|
# Use cached result
|
|
return $cache{cwd};
|
|
} # END good_cwd
|
|
|
|
#============================================
|
|
|
|
# Directory stack routines
|
|
|
|
sub pushd {
|
|
push @dir_stack, [cwd(), $cache{cwd}];
|
|
if ( $#_ > -1) {
|
|
chdir $_[0];
|
|
&cache_good_cwd;
|
|
}
|
|
}
|
|
|
|
#************************************************************
|
|
|
|
sub popd {
|
|
if ($#dir_stack > -1 ) {
|
|
my $Parr = pop @dir_stack;
|
|
chdir $$Parr[0];
|
|
$cache{cwd} = $$Parr[1];
|
|
}
|
|
}
|
|
|
|
#************************************************************
|
|
|
|
sub ifcd_popd {
|
|
if ( $do_cd ) {
|
|
warn "$My_name: Undoing directory change\n";
|
|
&popd;
|
|
}
|
|
}
|
|
|
|
#************************************************************
|
|
|
|
sub finish_dir_stack {
|
|
while ($#dir_stack > -1 ) { &popd; }
|
|
}
|
|
|
|
#************************************************************
|
|
#************************************************************
|
|
# Break handling routines (for wait-loop in preview continuous)
|
|
|
|
sub end_wait {
|
|
# Handler for break: Set global variable $have_break to 1.
|
|
# Some systems (e.g., MSWin reset) appear to reset the handler.
|
|
# So I'll re-enable it
|
|
&catch_break;
|
|
$have_break = 1;
|
|
}
|
|
|
|
#========================
|
|
|
|
sub catch_break {
|
|
# Capture ctrl/C and ctrl/break.
|
|
# $SIG{INT} corresponds to ctrl/C on LINUX/?UNIX and MSWin
|
|
# $SIG{BREAK} corresponds to ctrl/break on MSWin, doesn't exist on LINUX
|
|
$SIG{INT} = \&end_wait;
|
|
if ( exists $SIG{BREAK} ) {
|
|
$SIG{BREAK} = \&end_wait;
|
|
}
|
|
}
|
|
|
|
#========================
|
|
|
|
sub default_break {
|
|
# Arrange for ctrl/C and ctrl/break to give default behavior
|
|
$SIG{INT} = 'DEFAULT';
|
|
if ( exists $SIG{BREAK} ) {
|
|
$SIG{BREAK} = 'DEFAULT';
|
|
}
|
|
}
|
|
|
|
#************************************************************
|
|
#************************************************************
|